BAPTA - Ontology Report - Rat Genome Database

Submit Data | Help | Video Tutorials | News | Publications | Download | REST API | Citing RGD | Contact

Advanced Search (OLGA)

CHEBI ONTOLOGY - ANNOTATIONS

{{ watchLinkText }}

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:	BAPTA	go back to main search page
Accession:	CHEBI:60888	browse the term
Definition:	A polyamino carboxylic acid in which bis(carboxymethyl)nitrilo groups are bonded to C-2 and C-2' of 1,1'-[ethane-1,2-diylbis(oxy)]dibenzene.
Synonyms:	exact_synonym:	2,2',2'',2'''-[ethane-1,2-diylbis(oxy-2,1-phenylenenitrilo)]tetraacetic acid
	related_synonym:	1,2-Bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid; 1,2-Bis(o-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid; Bapeta; Formula=C22H24N2O10; InChI=1S/C22H24N2O10/c25-19(26)11-23(12-20(27)28)15-5-1-3-7-17(15)33-9-10-34-18-8-4-2-6-16(18)24(13-21(29)30)14-22(31)32/h1-8H,9-14H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32); InChIKey=FTEDXVNDVHYDQW-UHFFFAOYSA-N; SMILES=OC(=O)CN(CC(O)=O)c1ccccc1OCCOc1ccccc1N(CC(O)=O)CC(O)=O
	xref:	CAS:85233-19-8
	xref_mesh:	MESH:C025603
	xref:	Reaxys:5192406

show annotations for term's descendants Sort by:
Rat (48) Mouse (48) Human (48) Chinchilla (0) Bonobo (0) Dog (0) Squirrel (0) Pig (1) Green Monkey (0) Naked Mole-rat (0) All
Genes (48)

BAPTA

term browser

Symbol

Object Name

Qualifiers

Evidence

Notes

Source

PubMed Reference(s)

RGD Reference(s)

Position

G

ATP binding cassette subfamily A member 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Capsaicin results in increased expression of ABCA1 protein]

NCBI chr 5:67,678,267...67,801,162
Ensembl chr 5:67,681,297...67,801,170

G

angiotensinogen

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [AGT protein modified form results in increased abundance of Superoxides]

NCBI chr19:52,529,139...52,549,618
Ensembl chr19:52,529,185...52,540,977

G

AKT serine/threonine kinase 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in decreased phosphorylation of AKT1 protein]

NCBI chr 6:131,713,716...131,735,319
Ensembl chr 6:131,713,720...131,733,921

G

activating transcription factor 6

increases expression
multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of ATF6 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of ATF6 protein]

NCBI chr13:82,927,579...83,106,381
Ensembl chr13:82,930,034...83,107,177

G

activating transcription factor 6 beta

multiple interactions
increases expression

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of ATF6B protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of ATF6B protein

NCBI chr20:4,090,921...4,098,920
Ensembl chr20:4,090,921...4,098,894

G

BH3 interacting domain death agonist

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Diclofenac results in increased activity of BID protein]

NCBI chr 4:154,113,198...154,136,353
Ensembl chr 4:154,113,198...154,134,720

G

calcium voltage-gated channel subunit alpha1 E

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid affects the reaction [Methacholine Chloride affects the reaction [CACNA1E protein results in increased transport of Barium]]

NCBI chr13:66,574,659...67,063,443
Ensembl chr13:66,581,920...66,894,450

G

calpain 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CAPN1 protein]

NCBI chr 1:203,275,912...203,300,848
Ensembl chr 1:203,277,344...203,300,177

G

calpain 2

multiple interactions
increases expression

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CAPN2 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of CAPN2 protein

NCBI chr13:94,150,244...94,200,969
Ensembl chr13:94,150,240...94,200,969

G

caspase 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [[lead acetate results in increased abundance of Lead] which results in increased cleavage of CASP1 protein]

NCBI chr 8:2,587,812...2,597,403
Ensembl chr 8:2,587,831...2,597,383

G

caspase 12

multiple interactions
increases expression

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CASP12 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of CASP12 protein

NCBI chr 8:2,642,296...2,669,549
Ensembl chr 8:2,642,434...2,674,037

G

caspase 3

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased activity of CASP3 protein]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Pilocarpine results in increased activity of CASP3 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased cleavage of CASP3 protein]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [GW 7845 results in increased activity of CASP3 protein]; [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid co-treated with Egtazic Acid] inhibits the reaction [Cadmium results in increased cleavage of CASP3 protein]

PMID:19927300 PMID:20810541 PMID:28181380 PMID:29111403

NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648

G

caspase 4

increases expression
multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of CASP4 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of CASP4 protein]

NCBI chr 8:2,599,017...2,635,097
Ensembl chr 8:2,598,876...2,635,092

G

caspase 8

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased cleavage of CASP8 protein]; [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid co-treated with Egtazic Acid] inhibits the reaction [Cadmium results in increased cleavage of CASP8 protein]

NCBI chr 9:60,263,863...60,312,542
Ensembl chr 9:60,264,075...60,312,542

G

cAMP responsive element binding protein 1

decreases phosphorylation

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in decreased phosphorylation of CREB1 protein

NCBI chr 9:65,903,511...65,972,562
Ensembl chr 9:65,903,547...65,970,816

G

CREB binding protein

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [CREBBP protein binds to NFE2L2 protein]]

NCBI chr10:11,335,551...11,461,888
Ensembl chr10:11,335,953...11,461,888

G

catenin beta 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [bisphenol A results in increased localization of CTNNB1 protein]

NCBI chr 8:120,640,008...120,667,110
Ensembl chr 8:120,639,995...120,667,111

G

cytochrome c, somatic

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [GW 7845 affects the localization of CYCS protein]

NCBI chr 4:79,651,894...79,653,994
Ensembl chr 4:79,651,378...79,654,054
Ensembl chr18:79,651,378...79,654,054

G

DNA-damage inducible transcript 3

increases expression
multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of DDIT3 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased expression of DDIT3 protein]; [Egtazic Acid co-treated with 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid] inhibits the reaction [Cadmium results in increased expression of DDIT3 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of DDIT3 protein]

PMID:28181380 PMID:29111403

NCBI chr 7:63,115,645...63,121,203
Ensembl chr 7:63,116,380...63,121,201

G

eukaryotic translation initiation factor 2 alpha kinase 3

multiple interactions
increases expression

[fisetin co-treated with 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid] results in decreased expression of EIF2AK3 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in increased expression of EIF2AK3 protein

NCBI chr 4:102,805,495...102,866,914
Ensembl chr 4:102,805,510...102,866,911

G

Fos proto-oncogene, AP-1 transcription factor subunit

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Ionomycin results in increased expression of FOS mRNA]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [PDGFB protein results in increased expression of FOS mRNA]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Tetradecanoylphorbol Acetate results in increased expression of FOS mRNA]

NCBI chr 6:105,121,170...105,124,036
Ensembl chr 6:105,121,170...105,124,036

G

glycogen synthase kinase 3 beta

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in decreased phosphorylation of GSK3B protein]

NCBI chr11:62,498,997...62,648,665
Ensembl chr11:62,504,316...62,648,646

G

heme oxygenase 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [NFE2L2 protein binds to HMOX1 promoter]]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone results in increased expression of HMOX1 mRNA]

NCBI chr19:13,466,287...13,474,082
Ensembl chr19:13,467,244...13,474,079

G

heat shock protein 90 alpha family class A member 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Humic Substances results in increased expression of HSP90AA1 protein]

NCBI chr 6:129,702,376...129,707,907
Ensembl chr 6:129,702,383...129,707,268

G

heat shock protein 90 alpha family class B member 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Humic Substances results in increased expression of HSP90AB1 protein]

NCBI chr 9:15,432,986...15,438,358
Ensembl chr 9:15,433,691...15,438,488

G

heat shock protein family A (Hsp70) member 5

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [fisetin results in increased expression of HSPA5 protein]

NCBI chr 3:18,055,507...18,059,969
Ensembl chr 3:18,055,405...18,059,891

G

interleukin 1 alpha

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [tributyltin results in increased expression of IL1A protein]

NCBI chr 3:116,526,601...116,537,055
Ensembl chr 3:116,526,604...116,536,822

G

interleukin 1 beta

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [[lead acetate results in increased abundance of Lead] which results in increased expression of and results in increased secretion of IL1B protein]

NCBI chr 3:116,577,005...116,583,386
Ensembl chr 3:116,577,010...116,583,415

G

interleukin 4

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Toluene 2,4-Diisocyanate results in increased secretion of IL4 protein]

NCBI chr10:37,771,203...37,776,750
Ensembl chr10:37,771,203...37,776,750

G

LDL receptor related protein 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Capsaicin results in decreased expression of LRP1 protein]

NCBI chr 7:63,380,325...63,461,029
Ensembl chr 7:63,380,356...63,460,910

G

microtubule-associated protein 1 light chain 3 beta

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [cupric chloride results in increased lipidation of MAP1LC3B protein]

NCBI chr19:49,665,795...49,673,655
Ensembl chr19:49,665,791...49,677,690
Ensembl chr16:49,665,791...49,677,690

G

mitogen activated protein kinase 3

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Tetrachlorodibenzodioxin results in increased expression of MAPK3 mRNA]

NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863

G

mitogen-activated protein kinase 8

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Pilocarpine results in increased activity of MAPK8 protein]

NCBI chr16:8,638,897...8,721,960
Ensembl chr16:8,638,924...8,721,981

G

matrix metallopeptidase 9

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Acrolein results in increased expression of MMP9 protein]

NCBI chr 3:153,684,158...153,692,118
Ensembl chr 3:153,683,858...153,692,120

G

neurofilament light chain

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in decreased expression of NEFL mRNA]

NCBI chr15:42,301,920...42,305,793
Ensembl chr15:42,301,916...42,305,793

G

NFE2 like bZIP transcription factor 2

affects localization
multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid affects the localization of NFE2L2 protein
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [CREBBP protein binds to NFE2L2 protein]]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone promotes the reaction [NFE2L2 protein binds to HMOX1 promoter]]; 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2-tert-butylhydroquinone results in increased activity of NFE2L2 protein]

NCBI chr 3:60,594,239...60,621,712
Ensembl chr 3:60,594,242...60,621,737

G

NLR family, pyrin domain containing 3

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [[lead acetate results in increased abundance of Lead] which results in increased expression of NLRP3 protein]

NCBI chr10:44,326,770...44,353,814
Ensembl chr10:44,328,566...44,352,811

G

nitric oxide synthase 3

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Humic Substances results in increased expression of and results in increased phosphorylation of NOS3 protein]

NCBI chr 4:10,793,834...10,814,170
Ensembl chr 4:10,793,834...10,814,166

G

poly (ADP-ribose) polymerase 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [2,3,5-(triglutathion-S-yl)hydroquinone results in increased activity of PARP1 protein]
1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Cadmium results in increased cleavage of PARP1 protein]; [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid co-treated with Egtazic Acid] inhibits the reaction [Cadmium results in increased cleavage of PARP1 protein]

PMID:24752504 PMID:29111403

NCBI chr13:92,307,593...92,339,406
Ensembl chr13:92,307,586...92,339,404

G

platelet derived growth factor subunit B

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [PDGFB protein results in increased expression of FOS mRNA]

NCBI chr 7:111,539,444...111,557,984
Ensembl chr 7:111,540,345...111,557,984

G

protein kinase cAMP-activated catalytic subunit alpha

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [diphenylditelluride results in decreased expression of PRKACA protein]

NCBI chr19:24,155,081...24,178,430
Ensembl chr19:24,155,090...24,178,430

G

RNA binding fox-1 homolog 3

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [cupric chloride results in decreased expression of RBFOX3 protein]

NCBI chr10:103,720,355...104,157,277
Ensembl chr10:103,720,636...104,156,935

G

ribosomal protein S6 kinase B1

multiple interactions
decreases phosphorylation

oxophenylarsine inhibits the reaction [1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in decreased phosphorylation of RPS6KB1 protein]

NCBI chr10:71,323,777...71,367,908
Ensembl chr10:71,323,777...71,367,908

G

secretin

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Ursodeoxycholic Acid analog results in increased activity of SCT]

NCBI chr 1:196,382,857...196,383,668
Ensembl chr 1:196,382,856...196,383,658

G

synuclein alpha

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [Rotenone results in increased expression of and results in increased phosphorylation of SNCA protein]

NCBI chr 4:89,696,420...89,797,240
Ensembl chr 4:89,696,420...89,796,262

G

sequestosome 1

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [cupric chloride results in increased expression of SQSTM1 protein]

NCBI chr10:34,525,517...34,536,670
Ensembl chr10:34,525,519...34,536,673

G

tumor necrosis factor

multiple interactions

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid inhibits the reaction [[lead acetate results in increased abundance of Lead] which results in increased expression of and results in increased secretion of TNF protein]

NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629

G

X-linked inhibitor of apoptosis

decreases degradation

1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid results in decreased degradation of XIAP protein

NCBI chr X:120,890,537...120,938,413
Ensembl chr X:120,897,907...120,934,700

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	19874
role	19844
chemical role	19473
ligand	6754
chelator	6741
BAPTA	48
5,5'-dibromo-BAPTA	0
5,5'-dimethyl-BAPTA	0
Path 2
Term	Annotations
CHEBI ontology	19874
subatomic particle	19872
composite particle	19872
hadron	19872
baryon	19872
nucleon	19872
atomic nucleus	19872
atom	19872
main group element atom	19811
main group molecular entity	19811
s-block molecular entity	19647
hydrogen molecular entity	19628
hydrides	19139
inorganic hydride	18156
pnictogen hydride	18146
nitrogen hydride	18059
azane	17866
ammonia	17865
organic amino compound	17865
amino acid	16057
polyamino carboxylic acid	99
BAPTA	48
5,5'-dibromo-BAPTA	0
5,5'-dimethyl-BAPTA	0

paths to the root