CHEBI ONTOLOGY - ANNOTATIONS |
|
The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.
|
Term: | 5alpha-androstane |
|
Accession: | CHEBI:28859
|
browse the term
|
Definition: | The 5alpha-stereoisomer of androstane. |
Synonyms: | related_synonym: | Androstane; Formula=C19H32; InChI=1S/C19H32/c1-18-11-5-7-16(18)15-9-8-14-6-3-4-12-19(14,2)17(15)10-13-18/h14-17H,3-13H2,1-2H3/t14-,15+,16+,17+,18+,19+/m1/s1; InChIKey=QZLYKIGBANMMBK-UGCZWRCOSA-N; SMILES=[H][C@]12CCCC[C@]1(C)[C@@]1([H])CC[C@]3(C)CCC[C@@]3([H])[C@]1([H])CC2 |
| alt_id: | CHEBI:20638; CHEBI:2712 |
| xref: | Beilstein:2043119; CAS:438-22-2; KEGG:C01554; LIPID_MAPS_instance:LMST02020056; PMID:13749674 |
|
|
|
G |
Aadat |
aminoadipate aminotransferase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AADAT mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:29,509,392...29,544,332
Ensembl chr16:29,509,394...29,544,332
|
|
G |
Aass |
aminoadipate-semialdehyde synthase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AASS mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:51,606,461...51,663,136
Ensembl chr 4:51,606,462...51,663,136
|
|
G |
Abca5 |
ATP binding cassette subfamily A member 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ABCA5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:95,240,159...95,309,195
Ensembl chr10:95,240,154...95,308,976
|
|
G |
Abcc1 |
ATP binding cassette subfamily C member 1 |
decreases expression increases expression |
ISO |
Dihydrotestosterone results in decreased expression of ABCC1 mRNA Dihydrotestosterone results in increased expression of ABCC1 mRNA |
CTD |
PMID:17003774 PMID:29581250 |
|
NCBI chr10:528,961...655,179
Ensembl chr10:531,812...655,114
|
|
G |
Abcc3 |
ATP binding cassette subfamily C member 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ABCC3 mRNA |
CTD |
PMID:17003774 |
|
NCBI chr10:79,296,681...79,342,749
Ensembl chr10:79,296,693...79,342,595
|
|
G |
Abcc4 |
ATP binding cassette subfamily C member 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ABCC4 mRNA; Dihydrotestosterone results in increased expression of ABCC4 protein |
CTD |
PMID:17003774 PMID:29581250 |
|
NCBI chr15:95,541,186...95,774,898
Ensembl chr15:95,542,315...95,774,283
|
|
G |
Abcc5 |
ATP binding cassette subfamily C member 5 |
affects expression |
ISO |
Dihydrotestosterone affects the expression of ABCC5 mRNA |
CTD |
PMID:17003774 |
|
NCBI chr11:80,473,809...80,567,257
Ensembl chr11:80,473,872...80,567,253
|
|
G |
Abhd2 |
abhydrolase domain containing 2, acylglycerol lipase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ABHD2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:133,217,403...133,298,564
Ensembl chr 1:133,217,375...133,299,061
|
|
G |
Abhd3 |
abhydrolase domain containing 3, phospholipase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ABHD3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:1,723,203...1,778,488
Ensembl chr18:1,720,718...1,803,428
|
|
G |
Acaca |
acetyl-CoA carboxylase alpha |
decreases phosphorylation increases expression decreases expression |
ISO |
Dihydrotestosterone results in decreased phosphorylation of ACACA protein Dihydrotestosterone results in increased expression of ACACA mRNA Dihydrotestosterone results in decreased expression of ACACA mRNA |
CTD |
PMID:16990341 PMID:18801408 PMID:29581250 |
|
NCBI chr10:69,014,261...69,276,453
Ensembl chr10:69,014,170...69,276,457
|
|
G |
Acacb |
acetyl-CoA carboxylase beta |
decreases phosphorylation |
ISO |
Dihydrotestosterone results in decreased phosphorylation of ACACB protein |
CTD |
PMID:16990341 |
|
NCBI chr12:42,365,800...42,477,651
Ensembl chr12:42,366,548...42,457,655
|
|
G |
Acad8 |
acyl-CoA dehydrogenase family, member 8 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ACAD8 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:25,382,271...25,406,404
Ensembl chr 8:25,382,273...25,406,414
|
|
G |
Acadl |
acyl-CoA dehydrogenase, long chain |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ACADL mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:68,333,981...68,372,149
Ensembl chr 9:68,333,980...68,372,220
|
|
G |
Acot9 |
acyl-CoA thioesterase 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ACOT9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:40,073,197...40,123,573
Ensembl chr X:40,064,810...40,123,559
|
|
G |
Acp3 |
acid phosphatase 3 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of ACP3 mRNA |
CTD |
PMID:12391264 |
|
NCBI chr 8:104,905,570...104,956,146
Ensembl chr 8:104,905,586...104,954,236
|
|
G |
Acsl3 |
acyl-CoA synthetase long-chain family member 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ACSL3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:80,115,164...80,164,636
Ensembl chr 9:80,115,112...80,164,627
|
|
G |
Acsm1 |
acyl-CoA synthetase medium-chain family member 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ACSM1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:173,985,715...174,020,565
Ensembl chr 1:173,984,672...174,025,495
|
|
G |
Actr3 |
actin related protein 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ACTR3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:36,800,739...36,843,837
Ensembl chr13:36,800,093...36,844,124
|
|
G |
Acyp2 |
acylphosphatase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ACYP2 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr14:104,201,894...104,371,415
Ensembl chr14:104,201,895...104,371,386
|
|
G |
Adam28 |
ADAM metallopeptidase domain 28 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ADAM28 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:43,774,463...43,840,726
Ensembl chr15:42,944,467...43,840,672
|
|
G |
Adam9 |
ADAM metallopeptidase domain 9 |
multiple interactions increases expression |
ISO |
AR protein affects the reaction [Dihydrotestosterone results in increased expression of ADAM9 protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of ADAM9 protein] Dihydrotestosterone results in increased expression of ADAM9 mRNA |
CTD |
PMID:17342749 PMID:29581250 |
|
NCBI chr16:67,022,538...67,101,647
Ensembl chr16:67,022,655...67,100,917
|
|
G |
Adamts1 |
ADAM metallopeptidase with thrombospondin type 1 motif, 1 |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of ADAMTS1 mRNA; Dihydrotestosterone results in increased expression of ADAMTS1 protein [Progesterone co-treated with Dihydrotestosterone] results in increased expression of ADAMTS1 mRNA; [Progesterone co-treated with Dihydrotestosterone] results in increased expression of ADAMTS1 protein; Estradiol inhibits the reaction [Dihydrotestosterone results in increased expression of ADAMTS1 mRNA]; Estradiol inhibits the reaction [Dihydrotestosterone results in increased expression of ADAMTS1 protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in increased expression of ADAMTS1 mRNA]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in increased expression of ADAMTS1 protein] |
CTD |
PMID:17018655 PMID:29581250 |
|
NCBI chr11:24,932,227...24,941,068
Ensembl chr11:24,931,761...24,941,103
|
|
G |
Adcyap1r1 |
ADCYAP receptor type I |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ADCYAP1R1 mRNA |
CTD |
PMID:17254854 |
|
NCBI chr 4:84,593,558...84,642,700
Ensembl chr 4:84,593,892...84,642,700
|
|
G |
Adm |
adrenomedullin |
multiple interactions increases expression |
EXP |
VEGFA protein affects the reaction [Dihydrotestosterone results in increased expression of ADM mRNA] |
CTD |
PMID:17113911 |
|
NCBI chr 1:164,745,484...164,747,655
Ensembl chr 1:164,745,466...164,747,654
|
|
G |
Adprm |
ADP-ribose/CDP-alcohol diphosphatase, manganese-dependent |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ADPRM mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:51,732,073...51,744,635
Ensembl chr10:51,731,993...51,744,635
|
|
G |
Adrb2 |
adrenoceptor beta 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ADRB2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:55,642,459...55,644,501
Ensembl chr18:55,502,903...55,644,512
|
|
G |
Aff3 |
ALF transcription elongation factor 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AFF3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:40,399,099...40,856,716
Ensembl chr 9:40,404,375...40,857,247
|
|
G |
Aff4 |
ALF transcription elongation factor 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AFF4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:37,498,825...37,579,751
Ensembl chr10:37,498,825...37,579,751
|
|
G |
Agps |
alkylglycerone phosphate synthase |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of AGPS mRNA |
CTD |
PMID:16631469 |
|
NCBI chr 3:60,747,323...60,845,831
Ensembl chr 3:60,747,323...60,845,830
|
|
G |
Agr2 |
anterior gradient 2, protein disulphide isomerase family member |
affects expression increases expression |
ISO |
Dihydrotestosterone affects the expression of AGR2 mRNA Dihydrotestosterone results in increased expression of AGR2 mRNA |
CTD |
PMID:17094431 PMID:29581250 |
|
NCBI chr 6:52,708,602...52,729,378
Ensembl chr 6:52,708,602...52,729,371
|
|
G |
Ahr |
aryl hydrocarbon receptor |
multiple interactions affects binding |
ISO |
AHR protein inhibits the reaction [[FHL2 protein co-treated with Tetrachlorodibenzodioxin] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]; AHR protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [6-methyl-1,3,8-trichlorodibenzofuran results in increased activity of AHR protein]; FHL2 protein inhibits the reaction [AHR protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]] Dihydrotestosterone binds to AHR protein |
CTD |
PMID:15026081 PMID:19815066 PMID:20436506 |
|
NCBI chr 6:52,234,089...52,271,568
Ensembl chr 6:52,234,089...52,271,568
|
|
G |
Ak4 |
adenylate kinase 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AK4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:116,039,222...116,099,064
Ensembl chr 5:116,039,616...116,098,618
|
|
G |
Ak9 |
adenylate kinase 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AK9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:44,724,494...44,941,135
Ensembl chr20:44,724,496...44,941,136
|
|
G |
Akap12 |
A-kinase anchoring protein 12 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AKAP12 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:40,730,123...40,819,863
Ensembl chr 1:40,730,123...40,819,886
|
|
G |
Akr1c1 |
aldo-keto reductase family 1, member C1 |
multiple interactions increases metabolic processing |
ISO |
Flufenamic Acid inhibits the reaction [AKR1C1 protein results in increased metabolism of Dihydrotestosterone] |
CTD |
PMID:14672942 |
|
NCBI chr17:65,810,474...65,837,385
Ensembl chr17:65,810,475...65,837,326
|
|
G |
Akr1c2 |
aldo-keto reductase family 1, member C2 |
multiple interactions increases metabolic processing increases reduction |
ISO |
AKR1C2 protein results in increased metabolism of and results in decreased activity of Dihydrotestosterone; Flufenamic Acid inhibits the reaction [AKR1C2 protein results in increased metabolism of Dihydrotestosterone] AKR1C2 protein results in increased reduction of Dihydrotestosterone |
CTD |
PMID:11158055 PMID:14672942 PMID:17170221 PMID:22245609 |
|
NCBI chr17:65,759,778...65,808,013
Ensembl chr17:65,759,788...65,775,764
|
|
G |
Akr1c3 |
aldo-keto reductase family 1, member C3 |
multiple interactions increases metabolic processing |
ISO |
[AKR1C3 protein results in increased metabolism of Androstenedione] which results in increased chemical synthesis of Dihydrotestosterone; Flufenamic Acid inhibits the reaction [AKR1C3 protein results in increased metabolism of Dihydrotestosterone] |
CTD |
PMID:14672942 PMID:19010312 |
|
NCBI chr17:66,110,970...66,127,867
Ensembl chr17:66,110,963...66,127,873
|
|
G |
Akr1d1 |
aldo-keto reductase family 1, member D1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AKR1D1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:66,154,246...66,187,505
Ensembl chr 4:66,154,248...66,186,372
|
|
G |
Akt1 |
AKT serine/threonine kinase 1 |
decreases activity |
ISO |
Dihydrotestosterone analog results in decreased activity of AKT1 |
CTD |
PMID:17303658 |
|
NCBI chr 6:131,713,716...131,735,319
Ensembl chr 6:131,713,720...131,733,921
|
|
G |
Akt2 |
AKT serine/threonine kinase 2 |
multiple interactions |
EXP |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of AKT2 protein]]; Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of AKT2 protein] |
CTD |
PMID:35982617 |
|
NCBI chr 1:82,877,228...82,933,828
Ensembl chr 1:82,883,547...82,933,817
|
|
G |
Aldh1a3 |
aldehyde dehydrogenase 1 family, member A3 |
multiple interactions increases activity increases expression |
ISO |
AR protein promotes the reaction [Dihydrotestosterone results in increased expression of ALDH1A3 mRNA]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of ALDH1A3 mRNA] Dihydrotestosterone results in increased activity of ALDH1A3 protein |
CTD |
PMID:17526768 PMID:29581250 |
|
NCBI chr 1:119,982,272...120,017,416
Ensembl chr 1:119,982,277...120,017,436
|
|
G |
Alg2 |
ALG2, alpha-1,3/1,6-mannosyltransferase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ALG2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:61,768,738...61,773,297
Ensembl chr 5:61,768,740...61,773,297
|
|
G |
Alpk2 |
alpha-kinase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ALPK2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:58,775,603...58,906,150
Ensembl chr18:58,775,605...58,906,258
|
|
G |
Alpl |
alkaline phosphatase, biomineralization associated |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ALPL mRNA |
CTD |
PMID:17898587 |
|
NCBI chr 5:149,951,397...150,006,424
Ensembl chr 5:149,951,409...150,006,446
|
|
G |
Alyref |
Aly/REF export factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ALYREF mRNA |
CTD |
PMID:17023530 |
|
NCBI chr10:105,871,424...105,875,076
Ensembl chr10:105,871,306...105,875,069
|
|
G |
Amacr |
alpha-methylacyl-CoA racemase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AMACR mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:59,946,158...59,958,255
Ensembl chr 2:59,946,153...59,958,255
|
|
G |
Amh |
anti-Mullerian hormone |
increases secretion multiple interactions |
EXP |
Dihydrotestosterone results in increased secretion of AMH protein resveratrol inhibits the reaction [Dihydrotestosterone results in increased secretion of AMH protein] |
CTD |
PMID:25667201 |
|
NCBI chr 7:8,906,776...8,909,192
Ensembl chr 7:8,906,836...8,909,282
|
|
G |
Ang |
angiogenin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ANG mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:24,312,711...24,323,361
|
|
G |
Ankh |
ANKH inorganic pyrophosphate transport regulator |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ANKH mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:78,153,027...78,280,181
Ensembl chr 2:78,153,026...78,280,187
|
|
G |
Ankrd13c |
ankyrin repeat domain 13C |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ANKRD13C mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:247,023,040...247,070,433
Ensembl chr 2:247,022,286...247,070,433
|
|
G |
Ankrd37 |
ankyrin repeat domain 37 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ANKRD37 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:46,268,933...46,271,971
Ensembl chr16:46,268,443...46,271,963
|
|
G |
Ap1s2 |
adaptor related protein complex 1 subunit sigma 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AP1S2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:30,572,746...30,598,961
Ensembl chr X:30,572,751...30,597,262
|
|
G |
Apip |
APAF1 interacting protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of APIP mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:89,431,964...89,458,000
Ensembl chr 3:89,432,037...89,458,340
|
|
G |
Apoe |
apolipoprotein E |
multiple interactions affects response to substance |
ISO |
APOE gene polymorphism affects the reaction [Dihydrotestosterone affects the phosphorylation of MAPK10 protein]; APOE gene polymorphism affects the reaction [Dihydrotestosterone affects the phosphorylation of MAPK9 protein] APOE gene polymorphism affects the susceptibility to Dihydrotestosterone |
CTD |
PMID:17395708 |
|
NCBI chr 1:79,353,924...79,357,852
Ensembl chr 1:79,353,916...79,357,932
|
|
G |
App |
amyloid beta precursor protein |
decreases expression multiple interactions |
ISO EXP |
Dihydrotestosterone results in decreased expression of APP mRNA Dihydrotestosterone promotes the reaction [Trenbolone Acetate analog results in increased expression of APP protein modified form]; trilostane inhibits the reaction [Dihydrotestosterone promotes the reaction [Trenbolone Acetate analog results in increased expression of APP protein modified form]] |
CTD |
PMID:17023530 PMID:25461682 |
|
NCBI chr11:24,019,774...24,236,584
Ensembl chr11:24,019,778...24,236,561
|
|
G |
Appbp2 |
amyloid beta precursor protein binding protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of APPBP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:70,057,774...70,099,877
Ensembl chr10:70,057,774...70,099,835
|
|
G |
Aqp9 |
aquaporin 9 |
increases expression multiple interactions decreases expression |
EXP ISO |
Dihydrotestosterone results in increased expression of AQP9 mRNA; Dihydrotestosterone results in increased expression of AQP9 protein 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in decreased expression of AQP9 mRNA] Dihydrotestosterone results in decreased expression of AQP9 mRNA; Dihydrotestosterone results in decreased expression of AQP9 protein |
CTD |
PMID:17026757 PMID:20378617 |
|
NCBI chr 8:71,797,231...71,837,485
Ensembl chr 8:71,797,234...71,837,395
|
|
G |
Ar |
androgen receptor |
affects expression affects localization increases response to substance increases activity increases expression multiple interactions affects response to substance increases localization affects binding decreases expression |
ISO EXP |
Dihydrotestosterone affects the expression of AR protein Dihydrotestosterone affects the localization of AR protein AR protein mutant form results in increased susceptibility to Dihydrotestosterone Dihydrotestosterone results in increased activity of AR protein Dihydrotestosterone results in increased expression of AR mRNA; Dihydrotestosterone results in increased expression of AR protein (+)-JQ1 compound inhibits the reaction [Dihydrotestosterone affects the localization of AR protein]; 1,1-bis(4-hydroxyphenyl)cyclohexane inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 1,1-bis(4-hydroxyphenyl)cyclohexane inhibits the reaction [Dihydrotestosterone binds to AR protein]; 1,1-bis(4-hydroxyphenyl)cyclohexane inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 17-(5'-isoxazolyl)androsta-4,16-dien-3-one inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,2',3',4,4',5-hexachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,2',3,3',4,4',5-heptachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,2',3,5',6-pentachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,2',4,4',5-brominated diphenyl ether inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,2',4,4'-tetrabromodiphenyl ether inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,2',4,6,6'-pentachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,2-(2-chlorophenyl-4'-chlorophenyl)-1,1-dichloroethene inhibits the reaction [Dihydrotestosterone binds to AR protein]; 2,2-bis(4-hydroxyphenyl)-1,1,1-trichloroethane inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 2,2-bis(4-hydroxyphenyl)-1,1,1-trichloroethane inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,3',4,4',5-pentachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,3,4,2',3',4'-hexachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,3,6,2',3',6'-hexachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,3-dibromopropyl-2,4,6-tribromophenyl ether analog inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; 2,3-dibromopropyl-2,4,6-tribromophenyl ether inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,3-dibromopropyl-2,4,6-tribromophenyl ether inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; 2,4,4'-trichlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,4,5,2',4',5'-hexachlorobiphenyl affects the reaction [Dihydrotestosterone results in increased activity of AR protein modified form]; 2,4,5,2',4',5'-hexachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,4,5,2',5'-pentachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2,4,6-trichlorophenyl 4-nitrophenyl ether inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 2,4,6-trichlorophenyl-4'-aminophenyl ether inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 2,4-dichlorophenol promotes the reaction [Dihydrotestosterone results in increased localization of and results in increased activity of AR protein]; 2,4-Dichlorophenoxyacetic Acid promotes the reaction [Dihydrotestosterone results in increased localization of and results in increased activity of AR protein]; 2,5,2',5'-tetrachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2-(((3,5-dichlorophenyl)carbamoyl)oxy)-2-methyl-3-butenoic acid inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 2-phenylphenol inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; 20-hydroximino-4,16-pregnadien-3-one inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 3',5'-dichloro-2-hydroxy-2-methylbut-3-enanilide inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 3',5'-dichloro-2-hydroxy-2-methylbut-3-enanilide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 3,4,5,3',4'-pentachlorobiphenyl inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 3-hydroxybisphenol A inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 4,16-androstadien-3-one analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 4,4'-bisphenol F inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 4,4'-bisphenol F inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 4,4'-bisphenol F inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; 4,4'-dichlorobenzophenone inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; 4,4'-hexafluorisopropylidene diphenol inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 4,4'-hexafluorisopropylidene diphenol inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 4-androstene-3,17-diol inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; 4-benzylphenol inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 4-cumylphenol inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 4-isopropylphenol inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; 4-nonylphenol inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 4-octylphenol inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(6-methylpyridin-2-yl)nicotinamide analog inhibits the reaction [Dihydrotestosterone affects the localization of AR protein]; 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(6-methylpyridin-2-yl)nicotinamide analog inhibits the reaction [Dihydrotestosterone binds to AR protein]; 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(6-methylpyridin-2-yl)nicotinamide analog inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; 6-(3-(4-cyano-3-trifluoromethylphenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl)pyridine-2-sulfonic acid amide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 6-methyl-1,3,8-trichlorodibenzofuran inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; 6-methyl-1,3,8-trichlorodibenzofuran inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; [2,4,5,2',4',5'-hexachlorobiphenyl co-treated with Dichlorodiphenyl Dichloroethylene] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein modified form]; [AR protein mutant form results in increased susceptibility to Dihydrotestosterone] which affects the localization of AR protein mutant form; [AR protein mutant form results in increased susceptibility to Dihydrotestosterone] which results in increased expression of AR mRNA mutant form; [aroclor 1260 co-treated with Chlorodiphenyl (54% Chlorine) co-treated with 2,4,4'-trichlorobiphenyl co-treated with 2,4,2',4'-tetrachlorobiphenyl co-treated with 3,4,5,3',4'-pentachlorobiphenyl co-treated with 3,4,3',4'-tetrachlorobiphenyl] inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; [Azacitidine analog results in increased expression of AR protein] which results in increased susceptibility to Dihydrotestosterone; [bitertanol co-treated with propiconazole co-treated with cypermethrin] inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; [DDT analog co-treated with Hexachlorocyclohexane analog co-treated with Chlorobenzenes co-treated with Mirex co-treated with Polychlorinated Biphenyls co-treated with Chlordan co-treated with Toxaphene co-treated with Hydrocarbons, Chlorinated] inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; [Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein; [Dihydrotestosterone co-treated with 3-phenoxybenzoic acid] results in decreased expression of AR mRNA; [Dihydrotestosterone co-treated with AR protein] results in increased expression of KLK3 mRNA; [Dihydrotestosterone co-treated with bicalutamide] promotes the reaction [AR protein binds to PHB1 protein]; [Dihydrotestosterone co-treated with bicalutamide] promotes the reaction [AR protein binds to SMARCA4 protein]; [Dihydrotestosterone co-treated with cypermethrin] results in decreased expression of AR mRNA; [Dihydrotestosterone co-treated with Estradiol] results in decreased expression of AR mRNA; [Dihydrotestosterone co-treated with Estradiol] results in increased expression of AR protein; [Dihydrotestosterone co-treated with fenvalerate] results in decreased expression of AR mRNA; [Dihydrotestosterone co-treated with Permethrin] results in decreased expression of AR mRNA; [Dihydrotestosterone results in increased activity of AR protein mutant form] which results in increased phosphorylation of MAPK1 protein; [Dihydrotestosterone results in increased activity of AR protein mutant form] which results in increased phosphorylation of MAPK3 protein; [Dihydrotestosterone results in increased activity of AR protein mutant form] which results in increased phosphorylation of VASP protein; [FHL2 protein co-treated with Tetrachlorodibenzodioxin] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; [procymidone co-treated with prochloraz co-treated with vinclozolin] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; [procymidone co-treated with vinclozolin] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; [propiconazole co-treated with prochloraz co-treated with tebuconazole] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; [propiconazole co-treated with prochloraz] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; [tebuconazole co-treated with prochloraz] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; [terbutylazine co-treated with bitertanol co-treated with propiconazole co-treated with cypermethrin co-treated with Malathion] inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; [TNF protein results in increased susceptibility to Dihydrotestosterone] which results in increased localization of AR protein; AHR protein inhibits the reaction [[FHL2 protein co-treated with Tetrachlorodibenzodioxin] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]; AHR protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; Aldrin inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Aldrin inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; allyl 2,4,6-tribromophenyl ether inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; alpha-hexachlorocyclohexane inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; alpha-hexachlorocyclohexane inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; alpha-naphthoflavone inhibits the reaction [Particulate Matter analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]; alpha-naphthoflavone inhibits the reaction [Vehicle Emissions analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]; alpha-terthienyl inhibits the reaction [Dihydrotestosterone results in increased localization of AR protein]; androsta-5,16-dien-3 beta-ol analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Androstenedione inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; AR mutant form inhibits the reaction [Dihydrotestosterone results in increased expression of GAS6 mRNA]; AR protein affects the reaction [Dihydrotestosterone inhibits the reaction [BCG Vaccine results in increased expression of IL6 mRNA]]; AR protein affects the reaction [Dihydrotestosterone results in increased expression of ADAM9 protein]; AR protein affects the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; AR protein affects the reaction [Dihydrotestosterone results in increased expression of LCP1 mRNA]; AR protein affects the reaction [Dihydrotestosterone results in increased expression of MSMB mRNA]; AR protein affects the reaction [Dihydrotestosterone results in increased expression of TMEFF2 protein]; AR protein affects the reaction [Dihydrotestosterone results in increased phosphorylation of EIF2A protein]; AR protein affects the reaction [vinclozolin inhibits the reaction [Dihydrotestosterone results in increased expression of SRD5A1 mRNA]]; AR protein alternative form promotes the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; AR protein mutant form affects the reaction [Dihydrotestosterone results in decreased expression of ESR2 protein]; AR protein promotes the reaction [Dihydrotestosterone results in increased expression of ALDH1A3 mRNA]; AR protein promotes the reaction [Dihydrotestosterone results in increased expression of FOS mRNA]; AR protein promotes the reaction [Dihydrotestosterone results in increased expression of PIP mRNA]; AR protein promotes the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK1 protein]; AR protein promotes the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK3 protein]; Azinphosmethyl inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; beauvericin inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Benomyl inhibits the reaction [Dihydrotestosterone affects the localization of and results in increased phosphorylation of AR protein]; Benzo(a)pyrene inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; beta-hexachlorocyclohexane inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; bicalutamide inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; bicalutamide inhibits the reaction [alpha-naphthoflavone inhibits the reaction [Particulate Matter analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]]; bicalutamide inhibits the reaction [alpha-naphthoflavone inhibits the reaction [Vehicle Emissions analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]]; bicalutamide inhibits the reaction [AR protein alternative form promotes the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]]; bicalutamide inhibits the reaction [Dihydrotestosterone affects the localization of AR protein]; bicalutamide inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; bicalutamide inhibits the reaction [Dihydrotestosterone binds to AR protein]; bicalutamide inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to MYC enhancer]]; bicalutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of AR mRNA]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein mutant form]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of and results in increased phosphorylation of AR protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; bisphenol A affects the reaction [Dihydrotestosterone binds to AR protein mutant form]; bisphenol A analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; bisphenol A inhibits the reaction [Dihydrotestosterone affects the localization of AR protein]; bisphenol A inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; bisphenol A inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; bisphenol A inhibits the reaction [Dihydrotestosterone results in increased expression of and results in increased stability of AR protein]; bisphenol A inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; bisphenol B inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; bisphenol B inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; bisphenol S inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; bitertanol inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Butylated Hydroxyanisole inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Butylated Hydroxyanisole inhibits the reaction [Dihydrotestosterone binds to AR protein]; Butylated Hydroxytoluene inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; butylbenzyl phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; butylbenzyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; camphoroquinone inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Capsaicin inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Capsaicin inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; Carbamazepine inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; CH 5138514 inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; CH 5166623 inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; CH4933468 inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Chlordan inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Chlordecone inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Chlorpropham inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Chlorpyrifos inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; clorophene inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 enhancer]]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to TMPRSS2 enhancer]]; Cyclodecanes analog promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; cyhalothrin inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; cypermethrin inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; cyprodinil inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; cyprodinil inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Cyproterone Acetate inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; Cyproterone Acetate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Cyproterone Acetate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; DDT inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; DDT inhibits the reaction [Dihydrotestosterone binds to AR protein]; DDT inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; DDT inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; delta-hexachlorocyclohexane inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; delta-hexachlorocyclohexane inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dexamethasone inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; di-n-hexyl phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; di-n-hexyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; di-n-octyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; di-n-pentyl phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; di-n-pentyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; diallyl phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Diazinon inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dibutyl Phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Dibutyl Phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dichlorodiphenyl Dichloroethylene affects the reaction [Dihydrotestosterone results in increased activity of AR protein modified form]; Dichlorodiphenyl Dichloroethylene inhibits the reaction [[Dihydrotestosterone co-treated with Estradiol] results in decreased expression of AR mRNA]; Dichlorodiphenyl Dichloroethylene inhibits the reaction [[Dihydrotestosterone co-treated with Estradiol] results in decreased expression of AR protein]; Dichlorodiphenyl Dichloroethylene inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Dichlorodiphenyl Dichloroethylene inhibits the reaction [Dihydrotestosterone binds to AR protein]; Dichlorodiphenyl Dichloroethylene inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dichlorodiphenyl Dichloroethylene inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Dichlorodiphenyldichloroethane inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dichlorodiphenyldichloroethane inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Dicofol inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; dicyclohexyl phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; dicyclohexyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dieldrin inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Dieldrin inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; diethyl phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; diethyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Diethylhexyl Phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Diethylhexyl Phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Diethylhexyl Phthalate metabolite inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Dihydrotestosterone affects the localization of and results in increased phosphorylation of AR protein; Dihydrotestosterone analog inhibits the reaction [Dichlorodiphenyldichloroethane results in increased activity of AR protein]; Dihydrotestosterone binds to and results in increased activity of AR protein; Dihydrotestosterone binds to and results in increased activity of AR protein mutant form; Dihydrotestosterone inhibits the reaction [2,4,6-trichlorophenyl 4-nitrophenyl ether results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [2,4,6-trichlorophenyl-4'-aminophenyl ether results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [2-phenylphenol results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [acifluorfen-methyl results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [alachlor results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [anilofos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [benthiocarb results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [bifenox results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [bisphenol A results in decreased activity of AR protein]; Dihydrotestosterone inhibits the reaction [bitertanol results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Chlordan results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [chlormethoxynil results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [chlorobenzilate results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [chloropropylate results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [cyanophos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [cyfluthrin results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [DDT results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [dichlofenthion results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Dichlorodiphenyl Dichloroethylene analog results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Dicofol results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Dieldrin results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Diuron results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Endosulfan results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [enilconazole results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Estradiol results in decreased expression of AR protein]; Dihydrotestosterone inhibits the reaction [ethion results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [ethofenprox results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Ethoxyquin results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [ethyl bromophos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [fenarimol results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Fenitrothion results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Fenthion results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [fenvalerate results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [flucythrinate results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Heptachlor Epoxide results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [isofenphos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [isopropyl 4,4'-dibromobenzilate results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Leptophos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Linuron results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [mefenacet results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Methiocarb results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Methoxychlor results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Methyl Parathion results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [nitrofen results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [o,p'-DDT results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [oxyfluorofen results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Parathion results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [pencycuron results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [pendimethalin results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Phenylphosphonothioic Acid, 2-Ethyl 2-(4-Nitrophenyl) Ester results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [phosalone results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [piperophos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [prochloraz results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [procymidone results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [Propanil results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [propiconazole results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [prothiophos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [quinalphos results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [tetrachlorodian results in decreased activity of AR protein]; Dihydrotestosterone inhibits the reaction [tolclofos-methyl results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [triflumizol results in increased activity of AR protein]; Dihydrotestosterone inhibits the reaction [vinclozolin results in increased activity of AR protein]; Dihydrotestosterone promotes the reaction [[MAK protein binds to AR protein] which binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [AR protein binds to EP300 protein]; Dihydrotestosterone promotes the reaction [AR protein binds to GAS6 promoter]; Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [AR protein binds to MYC enhancer]; Dihydrotestosterone promotes the reaction [AR protein binds to RORA promoter]; Dihydrotestosterone promotes the reaction [AR protein binds to SCGB2A1 promoter]; Dihydrotestosterone promotes the reaction [AR protein binds to SMARCA2 protein]; Dihydrotestosterone promotes the reaction [AR protein binds to SRC protein binds to PELP1 protein]; Dihydrotestosterone promotes the reaction [AR protein binds to TMPRSS2 enhancer]; Dihydrotestosterone promotes the reaction [MAK protein binds to and results in increased activity of AR protein]; Dihydrotestosterone results in increased activity of and affects the localization of AR protein; Dihydrotestosterone results in increased activity of and results in increased expression of AR protein; Dihydrotestosterone results in increased activity of and results in increased localization of AR protein; Dihydrotestosterone results in increased expression of and results in increased phosphorylation of AR protein; Dihydrotestosterone results in increased expression of and results in increased stability of AR protein; Dihydrotestosterone results in increased folding of and results in increased stability of AR protein; Dihydrotestosterone results in increased localization of and results in increased activity of AR protein; diisobutyl phthalate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; diisobutyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; diisononyl 1,2-cyclohexanedicarboxylic acid metabolite promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; dimethachlon inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; dimethomorph inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; dimethyl phthalate analog inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; dimethyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Endosulfan inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Endrin inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; enilconazole inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; enzalutamide inhibits the reaction [Dihydrotestosterone affects the localization of AR protein]; enzalutamide inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to MYC enhancer]]; enzalutamide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; enzalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Estriol inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Ethoxyquin inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; fenarimol inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Fenitrothion inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Fenitrothion inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; fenvalerate inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; FHL2 protein affects the reaction [[Dihydrotestosterone co-treated with Tetrachlorodibenzodioxin] results in increased activity of AR protein]; FHL2 protein inhibits the reaction [AHR protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]]; FHL2 protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; fipronil inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; fisetin inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; Flame Retardants inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Flame Retardants inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; fludioxonil inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Flutamide inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Flutamide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Flutamide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; formestane metabolite inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Fulvestrant inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; ganoderol B inhibits the reaction [Dihydrotestosterone binds to AR protein]; Heptachlor inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Hexachlorocyclohexane inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; homosalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Hydrocarbons, Brominated analog promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; hydroxyflutamide inhibits the reaction [[Dihydrotestosterone co-treated with Estradiol] results in decreased expression of AR mRNA]; hydroxyflutamide inhibits the reaction [[Dihydrotestosterone co-treated with Estradiol] results in decreased expression of AR protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [Estradiol results in decreased expression of AR protein]]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; iprodione inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; isopropyl 4,4'-dibromobenzilate inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; L 245976 inhibits the reaction [Dihydrotestosterone binds to AR protein]; Linuron inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Linuron inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Linuron inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Lithocholic Acid inhibits the reaction [Dihydrotestosterone binds to AR protein]; mancozeb inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; metconazole inhibits the reaction [Dihydrotestosterone affects the localization of AR protein]; Methiocarb inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Methoxychlor inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Methoxychlor metabolite inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; methylselenic acid inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 promoter]]; Mitotane inhibits the reaction [Dihydrotestosterone binds to AR protein]; mono-benzyl phthalate promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; monobutyl phthalate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexanecarboxamide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; naphthenic acid inhibits the reaction [Dihydrotestosterone binds to AR protein]; NCOA1 protein promotes the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; NCOA1 protein results in increased activity of [Dihydrotestosterone binds to AR protein]; NCOA2 protein promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; NCOA2 protein promotes the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; NCOA3 protein promotes the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; NCOA4 promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; NCOA4 protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; NCOR1 protein inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; NCOR2 protein inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Niclosamide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; nilutamide inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; nilutamide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Nocodazole inhibits the reaction [Dihydrotestosterone results in increased localization of AR protein]; o,p'-DDT inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; o,p'-DDT inhibits the reaction [Dihydrotestosterone binds to AR protein]; o,p'-DDT inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; oxybenzone inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Oxygen deficiency promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; Paclitaxel inhibits the reaction [Dihydrotestosterone results in increased localization of AR protein]; Parathion inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Particulate Matter analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; PCB 180 inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; pentabrominated diphenyl ether 100 inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; pentabrominated diphenyl ether 100 promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; pentabromodiphenyl ether inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; perfluorobutyric acid promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; perfluorohexanoic acid promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; perfluorooctanoic acid promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; Permethrin inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Permethrin results in decreased activity of [Dihydrotestosterone results in increased activity of AR protein]; Pesticides inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Pesticides inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; phenanthrene inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; phthalic acid inhibits the reaction [Dihydrotestosterone metabolite binds to and results in increased activity of AR protein]; Phthalic Acids analog inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; pirimiphos methyl inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Polybrominated Biphenyls analog promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Polybrominated Biphenyls metabolite inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Polycyclic Aromatic Hydrocarbons inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Pregnadienes analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Proadifen promotes the reaction [Particulate Matter analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]; Proadifen promotes the reaction [Vehicle Emissions analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]; prochloraz inhibits the reaction [Dihydrotestosterone affects the localization of and results in increased phosphorylation of AR protein]; prochloraz inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; prochloraz inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; procymidone inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; procymidone inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Progesterone inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; propiconazole inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; propiconazole inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; pyrene inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; pyrimethanil inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; quinoxyfen inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Resveratrol inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Resveratrol inhibits the reaction [Oxygen deficiency promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]]; Sirolimus promotes the reaction [Dihydrotestosterone affects the expression of AR protein]; Soil Pollutants inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Soil Pollutants inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; SRC protein promotes the reaction [[Dihydrotestosterone co-treated with Tetrachlorodibenzodioxin] results in increased activity of AR protein]; SRC protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; tebuconazole inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; tebuconazole inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; Testosterone inhibits the reaction [Dihydrotestosterone binds to AR protein]; tetrabromobisphenol A inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; tetrachlorodian inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Tetrachlorodibenzodioxin inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Tetrachlorodibenzodioxin inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Tetrachlorodibenzodioxin inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; tetramethrin results in decreased activity of [Dihydrotestosterone results in increased activity of AR protein]; Toxaphene inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; tribromodiphenyl ether 28 inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; tributyl phosphate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; triclocarban promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Triclosan inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Triclosan promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; triphenyl phosphate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; triphenyl phosphate metabolite inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; triptophenolide inhibits the reaction [Dihydrotestosterone affects the localization of AR protein]; triptophenolide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein mutant form]; triptophenolide inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; triptophenolide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA mutant form]; triptophenolide inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; tris(1,3-dichloro-2-propyl)phosphate inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; tris(4-chlorophenyl)methanol inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Vehicle Emissions analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; vinclozolin inhibits the reaction [Dihydrotestosterone affects the localization of and results in increased phosphorylation of AR protein]; vinclozolin inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; vinclozolin inhibits the reaction [Dihydrotestosterone binds to AR protein]; vinclozolin inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; vinclozolin inhibits the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; vinclozolin metabolite inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; vinclozolin metabolite inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; vinclozolin results in decreased activity of [Dihydrotestosterone results in increased activity of AR protein]; Wastewater inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein] AR protein affects the susceptibility to Dihydrotestosterone Dihydrotestosterone binds to AR protein; Dihydrotestosterone binds to AR protein mutant form Dihydrotestosterone analog results in increased activity of AR protein; Dihydrotestosterone results in increased activity of AR protein; Dihydrotestosterone results in increased activity of AR protein modified form; Dihydrotestosterone results in increased activity of AR protein mutant form 2,2',3',4,4',5-hexachlorobiphenyl analog inhibits the reaction [Dihydrotestosterone binds to AR protein]; 2,3,4,2',3',4'-hexachlorobiphenyl analog inhibits the reaction [Dihydrotestosterone binds to AR protein]; aroclor 1242 inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; aroclor 1248 inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; aroclor 1260 inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Chlorodiphenyl (54% Chlorine) inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Cimetidine inhibits the reaction [Dihydrotestosterone binds to AR protein]; Dihydrotestosterone binds to and results in increased activity of AR protein; Dihydrotestosterone inhibits the reaction [Metribolone binds to AR protein]; Dihydrotestosterone results in increased expression of and results in increased activity of AR protein; Hydrazines analog inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; Linuron inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; Polychlorinated Biphenyls analog inhibits the reaction [Dihydrotestosterone binds to AR protein]; Quinazolinones inhibits the reaction [Dihydrotestosterone results in increased expression of and results in increased activity of AR protein] Dihydrotestosterone analog binds to AR; Dihydrotestosterone binds to AR protein bisphenol A inhibits the reaction [Dihydrotestosterone binds to AR protein]; Cimetidine inhibits the reaction [Dihydrotestosterone binds to AR protein]; Dibutyl Phthalate promotes the reaction [Dihydrotestosterone results in decreased localization of AR protein]; Dihydrotestosterone binds to and results in increased activity of AR protein; Fenitrothion inhibits the reaction [Dihydrotestosterone results in increased expression of AR protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of AR mRNA]; methoxyacetic acid promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; nonylphenol inhibits the reaction [Dihydrotestosterone binds to AR protein]; Tamoxifen inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein] |
CTD |
PMID:6835285 PMID:9073609 PMID:9182867 PMID:9705896 PMID:9846162 PMID:10188193 PMID:10402478 PMID:10696776 PMID:10875257 PMID:10910998 PMID:10964759 PMID:11118046 PMID:11222873 PMID:11241555 PMID:11751618 PMID:11861974 PMID:11861975 PMID:11861976 PMID:11906248 PMID:11956172 PMID:11985887 PMID:12368053 PMID:12377982 PMID:12391264 PMID:12606434 PMID:12676605 PMID:12711008 PMID:12730620 PMID:12805653 PMID:12960001 PMID:12970580 PMID:14532843 PMID:14565775 PMID:14579009 PMID:14628596 PMID:14630719 PMID:14751673 PMID:15026081 PMID:15033008 PMID:15056816 PMID:15064155 PMID:15110108 PMID:15171712 PMID:15206167 PMID:15336702 PMID:15466214 PMID:15483189 PMID:15665279 PMID:15840436 PMID:15994348 PMID:16005038 PMID:16020486 PMID:16107550 PMID:16111029 PMID:16125883 PMID:16169144 PMID:16266977 PMID:16540674 PMID:16621434 PMID:16648561 PMID:16857237 PMID:16877366 PMID:16893599 PMID:16951154 PMID:17303658 PMID:17342749 PMID:17499997 PMID:17526768 PMID:17606915 PMID:17804755 PMID:17980950 PMID:18007998 PMID:18275596 PMID:18324645 PMID:18487222 PMID:18801408 PMID:18819937 PMID:18922931 PMID:18973785 PMID:19564212 PMID:19643168 PMID:19672399 PMID:19815066 PMID:19833195 PMID:19924924 PMID:20048160 PMID:20371976 PMID:20410157 PMID:20438827 PMID:20729295 PMID:20807808 PMID:20937368 PMID:20943248 PMID:21036700 PMID:21111724 PMID:21291947 PMID:21295777 PMID:21308717 PMID:21310686 PMID:21357386 PMID:21359227 PMID:21729750 PMID:21962538 PMID:22258452 PMID:23146716 PMID:23399300 PMID:23405127 PMID:23834240 PMID:23871939 PMID:24740322 PMID:24759320 PMID:25297617 PMID:25324206 PMID:25454221 PMID:26022396 PMID:26602169 PMID:26778350 PMID:26867867 PMID:27436773 PMID:27473015 PMID:27561732 PMID:27720946 PMID:27994731 PMID:28009930 PMID:28115641 PMID:28377212 PMID:28500234 PMID:28571686 PMID:28728110 PMID:28757136 PMID:28803809 PMID:29162470 PMID:29248852 PMID:29421333 PMID:29556062 PMID:29601859 PMID:29702199 PMID:29777833 PMID:30408883 PMID:30582956 PMID:30716354 PMID:31195007 PMID:31415812 PMID:33049310 PMID:35344071 PMID:35691152 PMID:35951760 PMID:36308879 PMID:37059213 More...
|
|
NCBI chr X:63,104,771...63,273,934
Ensembl chr X:63,104,771...63,273,925
|
|
G |
Arap2 |
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARAP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:46,717,657...46,917,326
Ensembl chr14:46,718,760...46,917,154
|
|
G |
Arf4 |
ADP-ribosylation factor 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARF4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:1,896,692...1,913,267
Ensembl chr16:1,896,546...1,913,261
|
|
G |
Arfip2 |
ADP-ribosylation factor interacting protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARFIP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:159,974,255...159,980,398
Ensembl chr 1:159,974,201...159,980,336
|
|
G |
Arg1 |
arginase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARG1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:20,475,878...20,488,422
Ensembl chr 1:20,475,968...20,488,422
|
|
G |
Arl4c |
ADP ribosylation factor like GTPase 4C |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARL4C mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:89,300,335...89,303,770
Ensembl chr 9:89,298,005...89,304,513
|
|
G |
Armc12 |
armadillo repeat containing 12 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARMC12 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:6,587,859...6,598,355
Ensembl chr20:6,587,859...6,598,352
|
|
G |
Armcx3 |
armadillo repeat containing, X-linked 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARMCX3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:97,937,115...97,942,098
Ensembl chr X:97,936,999...97,942,098
|
|
G |
Arsg |
arylsulfatase G |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ARSG mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:94,412,261...94,551,224
Ensembl chr10:94,447,399...94,542,941
|
|
G |
Asah1 |
N-acylsphingosine amidohydrolase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ASAH1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:50,966,404...50,997,827
Ensembl chr16:50,966,229...51,008,233
|
|
G |
Ascc3 |
activating signal cointegrator 1 complex subunit 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ASCC3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:53,510,137...53,795,446
Ensembl chr20:53,510,184...53,790,165
|
|
G |
Asrgl1 |
asparaginase and isoaspartyl peptidase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ASRGL1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:206,006,103...206,027,115
Ensembl chr 1:206,006,109...206,027,108
|
|
G |
Atad2 |
ATPase family, AAA domain containing 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATAD2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:89,634,123...89,676,738
Ensembl chr 7:89,634,123...89,676,738
|
|
G |
Atf3 |
activating transcription factor 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATF3 protein |
CTD |
PMID:16516039 |
|
NCBI chr13:102,751,278...102,800,520
Ensembl chr13:102,751,321...102,764,631
|
|
G |
Atf4 |
activating transcription factor 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATF4 protein |
CTD |
PMID:23405127 |
|
NCBI chr 7:111,804,135...111,806,457
Ensembl chr 7:111,804,183...111,806,446
|
|
G |
Atg101 |
autophagy related 101 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATG101 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:132,398,477...132,407,643
Ensembl chr 7:132,398,483...132,407,633
|
|
G |
Atmin |
ATM interactor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATMIN mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:44,996,506...45,013,606
Ensembl chr19:44,996,356...45,013,605
|
|
G |
Atosa |
atos homolog A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATOSA mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:75,694,828...75,772,565
Ensembl chr 8:75,695,022...75,772,549
|
|
G |
Atp10a |
ATPase phospholipid transporting 10A (putative) |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATP10A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:109,556,760...109,730,440
Ensembl chr 1:109,556,782...109,730,437
|
|
G |
Atp11b |
ATPase phospholipid transporting 11B (putative) |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATP11B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:118,585,348...118,691,076
Ensembl chr 2:118,585,342...118,690,232
|
|
G |
Atp1a1 |
ATPase Na+/K+ transporting subunit alpha 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATP1A1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:189,020,722...189,048,826
Ensembl chr 2:189,020,722...189,048,837
|
|
G |
Atp1b3 |
ATPase Na+/K+ transporting subunit beta 3 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of ATP1B3 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr 8:96,910,265...96,941,592
Ensembl chr 8:96,910,309...96,941,598
|
|
G |
Atp6v0a2 |
ATPase H+ transporting V0 subunit a2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATP6V0A2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:31,947,220...31,979,875
Ensembl chr12:31,822,733...32,007,069
|
|
G |
Atp8b2 |
ATPase phospholipid transporting 8B2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ATP8B2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:175,378,514...175,402,265
Ensembl chr 2:175,378,517...175,401,883
|
|
G |
Axin2 |
axin 2 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Androgens deficiency results in decreased expression of AXIN2 mRNA] |
CTD |
PMID:29367455 |
|
NCBI chr10:93,893,830...93,927,042
Ensembl chr10:93,899,245...93,926,231
|
|
G |
Azgp1 |
alpha-2-glycoprotein 1, zinc-binding |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of AZGP1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:16,930,990...16,939,333
Ensembl chr12:16,931,024...16,939,091
|
|
G |
B2m |
beta-2 microglobulin |
multiple interactions increases expression |
ISO |
6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(6-methylpyridin-2-yl)nicotinamide analog inhibits the reaction [Dihydrotestosterone results in increased expression of B2M mRNA] |
CTD |
PMID:27720946 PMID:29581250 |
|
NCBI chr 3:109,095,740...109,101,764
Ensembl chr 3:109,095,729...109,101,766
|
|
G |
B3gnt2 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of B3GNT2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:96,808,473...96,833,674
Ensembl chr14:96,806,664...96,835,273
|
|
G |
B4galt1 |
beta-1,4-galactosyltransferase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of B4GALT1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:55,935,614...55,982,461
Ensembl chr 5:55,935,615...55,982,461
|
|
G |
Baiap2 |
BAR/IMD domain containing adaptor protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BAIAP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:105,223,065...105,290,130
Ensembl chr10:105,223,090...105,290,134
|
|
G |
Bax |
BCL2 associated X, apoptosis regulator |
multiple interactions decreases expression |
EXP ISO |
Dihydrotestosterone inhibits the reaction [Testosterone deficiency results in increased expression of BAX mRNA]; Dihydrotestosterone inhibits the reaction [Testosterone deficiency results in increased expression of BAX protein] Dihydrotestosterone inhibits the reaction [[Curcumin co-treated with Quercetin] results in increased expression of BAX protein] Dihydrotestosterone results in decreased expression of BAX protein |
CTD |
PMID:20850791 PMID:26804032 PMID:27132804 |
|
NCBI chr 1:95,940,001...95,945,407
Ensembl chr 1:95,938,808...95,945,368
|
|
G |
Bbs4 |
Bardet-Biedl syndrome 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BBS4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:59,731,912...59,765,408
Ensembl chr 8:59,731,912...59,765,607
|
|
G |
Bbx |
BBX high mobility group box domain containing |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BBX mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:50,381,249...50,628,934
Ensembl chr11:50,381,247...50,623,251
|
|
G |
Bcap29 |
B-cell receptor-associated protein 29 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BCAP29 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:48,182,702...48,222,698
Ensembl chr 6:48,182,706...48,222,720
|
|
G |
Bcar1 |
BCAR1 scaffold protein, Cas family member |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BCAR1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr19:39,679,215...39,713,907
Ensembl chr19:39,679,204...39,713,907
|
|
G |
Bcl2 |
BCL2, apoptosis regulator |
multiple interactions |
EXP ISO |
Dihydrotestosterone inhibits the reaction [Dehydroepiandrosterone results in increased expression of BCL2 protein] [Dihydrotestosterone co-treated with Curcumin co-treated with Quercetin] results in increased expression of BCL2 protein |
CTD |
PMID:16407456 PMID:27132804 |
|
NCBI chr13:22,689,783...22,853,920
Ensembl chr13:22,684,989...22,853,743 Ensembl chr13:22,684,989...22,853,743
|
|
G |
Bcl2l1 |
Bcl2-like 1 |
increases expression multiple interactions |
ISO EXP |
Dihydrotestosterone results in increased expression of BCL2L1 mRNA Dihydrotestosterone inhibits the reaction [Dehydroepiandrosterone results in increased expression of BCL2L1 protein] |
CTD |
PMID:16407456 PMID:17023530 |
|
NCBI chr 3:141,253,508...141,304,582
Ensembl chr 3:141,253,523...141,303,479
|
|
G |
Bend4 |
BEN domain containing 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BEND4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:40,753,048...40,788,686
Ensembl chr14:40,753,077...40,783,504
|
|
G |
Bglap |
bone gamma-carboxyglutamate protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BGLAP mRNA |
CTD |
PMID:17898587 |
|
NCBI chr 2:173,838,518...173,839,495
Ensembl chr 2:173,838,518...173,839,495
|
|
G |
Bicd2 |
BICD cargo adaptor 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BICD2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:15,259,773...15,304,889
Ensembl chr17:15,259,773...15,304,889
|
|
G |
Bmpr1a |
bone morphogenetic protein receptor type 1A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BMPR1A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:9,736,390...9,829,825
Ensembl chr16:9,736,630...9,780,616
|
|
G |
Bmpr1b |
bone morphogenetic protein receptor type 1B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BMPR1B mRNA |
CTD |
PMID:18007998 PMID:29581250 |
|
NCBI chr 2:230,538,252...230,871,077
Ensembl chr 2:230,541,558...230,871,368
|
|
G |
Brd4 |
bromodomain containing 4 |
affects localization multiple interactions |
ISO |
Dihydrotestosterone affects the localization of BRD4 protein (+)-JQ1 compound inhibits the reaction [Dihydrotestosterone affects the localization of BRD4 protein] |
CTD |
PMID:24759320 |
|
NCBI chr 7:11,216,446...11,296,029
Ensembl chr 7:11,216,446...11,295,539
|
|
G |
Btg1 |
BTG anti-proliferation factor 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BTG1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:31,341,391...31,343,649
Ensembl chr 7:31,341,027...31,343,649
|
|
G |
Bub1b |
BUB1 mitotic checkpoint serine/threonine kinase B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of BUB1B mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 3:105,563,089...105,615,547
Ensembl chr 3:105,563,138...105,615,547
|
|
G |
C13h1orf116 |
similar to human chromosome 1 open reading frame 116 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of C1ORF116 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:42,187,442...42,201,432
Ensembl chr13:42,188,609...42,201,426
|
|
G |
C13h1orf21 |
similar to human chromosome 1 open reading frame 21 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of C1ORF21 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:63,982,587...64,199,676
Ensembl chr13:63,990,592...64,199,596
|
|
G |
C13h2orf76 |
similar to chromosome 2 open reading frame 76 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of C2ORF76 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:31,249,733...31,335,367
Ensembl chr13:31,249,959...31,314,943
|
|
G |
C5h1orf122 |
similar to human chromosome 1 open reading frame 122 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of C1ORF122 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:137,109,093...137,110,130
Ensembl chr 5:137,108,633...137,110,929
|
|
G |
C5h9orf152 |
similar to human chromosome 9 open reading frame 152 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of C9ORF152 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:72,660,573...72,667,941
Ensembl chr 5:72,660,573...72,668,379
|
|
G |
C6h14orf28 |
similar to human chromosome 14 open reading frame 28 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of C14ORF28 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:82,965,304...82,973,942
Ensembl chr 6:82,965,328...82,972,558
|
|
G |
Cacybp |
calcyclin binding protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CACYBP mRNA |
CTD |
PMID:17023530 |
|
NCBI chr13:72,437,485...72,447,810
Ensembl chr13:72,437,490...72,450,177
|
|
G |
Cadps2 |
calcium dependent secretion activator 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CADPS2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:51,780,415...52,309,641
Ensembl chr 4:51,781,053...52,309,829
|
|
G |
Calu |
calumenin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CALU mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:57,949,086...57,976,589
Ensembl chr 4:57,948,997...57,976,593
|
|
G |
Camkk2 |
calcium/calmodulin-dependent protein kinase kinase 2 |
multiple interactions increases expression |
ISO |
Dihydrotestosterone results in increased expression of and affects the localization of CAMKK2 protein Dihydrotestosterone results in increased expression of CAMKK2 mRNA |
CTD |
PMID:22654108 PMID:29581250 |
|
NCBI chr12:33,791,023...33,845,000
Ensembl chr12:33,791,052...33,843,279
|
|
G |
Cap2 |
cyclase associated actin cytoskeleton regulatory protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CAP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:18,054,234...18,203,453
Ensembl chr17:18,054,431...18,203,373
|
|
G |
Capn2 |
calpain 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CAPN2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:94,150,244...94,200,969
Ensembl chr13:94,150,240...94,200,969
|
|
G |
Capzb |
capping actin protein of muscle Z-line subunit beta |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CAPZB mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:151,435,600...151,535,409
Ensembl chr 5:151,434,871...151,535,409
|
|
G |
Carmil1 |
capping protein regulator and myosin 1 linker 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CARMIL1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:40,807,921...41,088,326
Ensembl chr17:40,808,389...41,088,326
|
|
G |
Casd1 |
CAS1 domain containing 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CASD1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:32,659,196...32,739,228
Ensembl chr 4:32,658,748...32,739,202
|
|
G |
Casp3 |
caspase 3 |
increases activity multiple interactions |
ISO EXP |
Dihydrotestosterone analog results in increased activity of CASP3 Dihydrotestosterone inhibits the reaction [[Curcumin co-treated with Quercetin] results in increased expression of CASP3 protein] Dihydrotestosterone promotes the reaction [Trenbolone Acetate analog results in increased activity of CASP3 protein]; trilostane inhibits the reaction [Dihydrotestosterone promotes the reaction [Trenbolone Acetate analog results in increased activity of CASP3 protein]] |
CTD |
PMID:17303658 PMID:25461682 PMID:27132804 |
|
NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648
|
|
G |
Casp7 |
caspase 7 |
increases activity |
ISO |
Dihydrotestosterone analog results in increased activity of CASP7 |
CTD |
PMID:17303658 |
|
NCBI chr 1:255,437,438...255,476,737
Ensembl chr 1:255,437,172...255,476,729
|
|
G |
Cat |
catalase |
decreases activity increases activity |
ISO EXP |
Dihydrotestosterone results in decreased activity of CAT protein Dihydrotestosterone results in increased activity of CAT protein |
CTD |
PMID:16682413 PMID:25667201 |
|
NCBI chr 3:89,842,393...89,874,577
Ensembl chr 3:89,842,399...89,874,478
|
|
G |
Cbll1 |
Cbl proto-oncogene like 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CBLL1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:48,071,190...48,086,174
Ensembl chr 6:48,071,190...48,086,444
|
|
G |
Cbs |
cystathionine beta synthase |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CBS protein |
CTD |
PMID:17854288 |
|
NCBI chr20:9,708,089...9,732,623
Ensembl chr20:9,708,090...9,732,764
|
|
G |
Ccdc141 |
coiled-coil domain containing 141 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCDC141 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:61,948,614...62,109,968
Ensembl chr 3:61,948,646...62,110,079
|
|
G |
Ccdc15 |
coiled-coil domain containing 15 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCDC15 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:36,991,147...37,068,849
Ensembl chr 8:36,998,867...37,068,919
|
|
G |
Ccdc160 |
coiled-coil domain containing 160 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCDC160 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:132,468,141...132,478,616
Ensembl chr X:132,468,213...132,478,431
|
|
G |
Ccl2 |
C-C motif chemokine ligand 2 |
multiple interactions |
ISO |
bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of CCL2 mRNA]]; bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of CCL2 mRNA]]; Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of CCL2 mRNA]; Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of CCL2 mRNA]; Dihydrotestosterone inhibits the reaction [TNF protein results in increased secretion of CCL2 protein] |
CTD |
PMID:16317058 |
|
NCBI chr10:67,005,424...67,007,222
Ensembl chr10:67,005,424...67,007,226
|
|
G |
Ccna2 |
cyclin A2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCNA2 mRNA Dihydrotestosterone results in increased expression of CCNA2 protein |
CTD |
PMID:15647840 PMID:17023530 |
|
NCBI chr 2:119,427,239...119,433,645
Ensembl chr 2:119,426,089...119,433,577
|
|
G |
Ccnb1 |
cyclin B1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCNB1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 2:31,912,190...31,921,163
Ensembl chr 2:31,912,193...31,921,172
|
|
G |
Ccnb2 |
cyclin B2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCNB2 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 8:71,087,594...71,100,794
Ensembl chr 8:71,087,595...71,100,874
|
|
G |
Ccnd1 |
cyclin D1 |
decreases expression increases expression multiple interactions |
ISO |
Dihydrotestosterone results in decreased expression of CCND1 protein Dihydrotestosterone results in increased expression of CCND1 protein Dihydrotestosterone inhibits the reaction [Estradiol results in increased expression of CCND1 mRNA]; Dihydrotestosterone inhibits the reaction [Estradiol results in increased expression of CCND1 protein] Dihydrotestosterone results in increased expression of CCND1 mRNA |
CTD |
PMID:15322241 PMID:17023530 PMID:18275596 PMID:26804032 |
|
NCBI chr 1:200,089,002...200,098,524
Ensembl chr 1:200,089,002...200,098,602
|
|
G |
Ccne1 |
cyclin E1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCNE1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 1:90,781,947...90,791,188
Ensembl chr 1:90,781,949...90,791,101
|
|
G |
Ccsap |
centriole, cilia and spindle-associated protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CCSAP mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:51,824,954...51,843,469
Ensembl chr19:51,826,994...51,842,753
|
|
G |
Cd40 |
CD40 molecule |
multiple interactions |
ISO |
bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of CD40 mRNA]]; Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of CD40 mRNA]; Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of CD40 mRNA] |
CTD |
PMID:16317058 |
|
NCBI chr 3:153,790,372...153,805,279
Ensembl chr 3:153,790,449...153,805,534
|
|
G |
Cd83 |
CD83 molecule |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CD83 mRNA |
CTD |
PMID:17254854 |
|
NCBI chr17:20,887,309...20,907,009
Ensembl chr17:20,887,309...20,907,083
|
|
G |
Cdc14b |
cell division cycle 14B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDC14B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:844,686...934,787
Ensembl chr17:844,685...933,235
|
|
G |
Cdc20 |
cell division cycle 20 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDC20 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 5:131,966,203...131,970,406
Ensembl chr 5:131,966,215...131,970,512
|
|
G |
Cdc42ep3 |
CDC42 effector protein 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDC42EP3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:15,710,894...15,731,366
Ensembl chr 6:15,708,730...15,732,721
|
|
G |
Cdc42se1 |
CDC42 small effector 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDC42SE1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:182,805,691...182,813,520
Ensembl chr 2:182,804,925...182,814,028
|
|
G |
Cdk2 |
cyclin dependent kinase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDK2 protein |
CTD |
PMID:15647840 |
|
NCBI chr 7:1,129,878...1,137,431
Ensembl chr 7:1,129,811...1,137,403
|
|
G |
Cdk2ap2 |
cyclin-dependent kinase 2 associated protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDK2AP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:201,391,056...201,393,137
Ensembl chr 1:201,391,466...201,393,137
|
|
G |
Cdk5rap2 |
CDK5 regulatory subunit associated protein 2 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CDK5RAP2 mRNA |
CTD |
PMID:18007998 |
|
NCBI chr 5:83,792,282...83,961,129
Ensembl chr 5:83,792,284...83,960,782
|
|
G |
Cdk6 |
cyclin-dependent kinase 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDK6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:30,637,650...30,829,688
Ensembl chr 4:30,646,460...30,829,634
|
|
G |
Cdkn1a |
cyclin-dependent kinase inhibitor 1A |
decreases expression multiple interactions |
ISO |
Dihydrotestosterone results in decreased expression of CDKN1A protein Dihydrotestosterone inhibits the reaction [[Curcumin co-treated with Quercetin] results in increased expression of CDKN1A protein] |
CTD |
PMID:15322241 PMID:26804032 PMID:27132804 |
|
NCBI chr20:7,149,177...7,159,727
Ensembl chr20:7,149,217...7,159,585
|
|
G |
Cdkn1b |
cyclin-dependent kinase inhibitor 1B |
decreases expression multiple interactions |
ISO |
Dihydrotestosterone results in decreased expression of CDKN1B mRNA Dihydrotestosterone inhibits the reaction [[Curcumin co-treated with Quercetin] results in increased expression of CDKN1B protein] |
CTD |
PMID:26804032 PMID:27132804 |
|
NCBI chr 4:167,760,067...167,765,177
Ensembl chr 4:167,760,181...167,764,982
|
|
G |
Cdr2 |
cerebellar degeneration-related protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDR2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:175,502,837...175,527,746
Ensembl chr 1:175,502,838...175,537,472
|
|
G |
Cdyl2 |
chromodomain Y-like 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CDYL2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:44,591,734...44,783,258
Ensembl chr19:44,597,459...44,783,022
|
|
G |
Cebpa |
CCAAT/enhancer binding protein alpha |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CEBPA protein Dihydrotestosterone results in decreased expression of CEBPA mRNA; Dihydrotestosterone results in decreased expression of CEBPA protein |
CTD |
PMID:12960001 PMID:18801408 |
|
NCBI chr 1:87,759,631...87,762,303
Ensembl chr 1:87,759,433...87,762,412
|
|
G |
Cebpd |
CCAAT/enhancer binding protein delta |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CEBPD mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:84,764,670...84,765,808
Ensembl chr11:84,764,565...84,765,829
|
|
G |
Cenpn |
centromere protein N |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CENPN mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:44,971,265...44,994,019
Ensembl chr19:44,968,308...44,994,012
|
|
G |
Chd7 |
chromodomain helicase DNA binding protein 7 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CHD7 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:21,812,007...21,995,358
Ensembl chr 5:21,812,070...21,995,358
|
|
G |
Chek2 |
checkpoint kinase 2 |
multiple interactions |
ISO |
[Curcumin co-treated with Dihydrotestosterone] results in increased phosphorylation of CHEK2 protein; Flutamide inhibits the reaction [[Dihydrotestosterone co-treated with Curcumin] results in increased phosphorylation of CHEK2 protein] |
CTD |
PMID:21134073 |
|
NCBI chr12:45,788,823...45,821,382
Ensembl chr12:45,788,827...45,821,286
|
|
G |
Chka |
choline kinase alpha |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CHKA mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:201,076,804...201,125,517
Ensembl chr 1:201,076,860...201,125,516
|
|
G |
Chpf |
chondroitin polymerizing factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CHPF mRNA |
CTD |
PMID:16631469 |
|
NCBI chr 9:76,963,178...76,967,878
Ensembl chr 9:76,963,184...76,967,878
|
|
G |
Chrm1 |
cholinergic receptor, muscarinic 1 |
multiple interactions decreases expression |
ISO |
Cycloheximide inhibits the reaction [Dihydrotestosterone results in decreased expression of CHRM1 mRNA] |
CTD |
PMID:17624924 |
|
NCBI chr 1:205,567,226...205,583,001
Ensembl chr 1:205,567,220...205,582,356
|
|
G |
Chst2 |
carbohydrate sulfotransferase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CHST2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:95,960,067...95,966,312
Ensembl chr 8:95,959,826...95,966,955
|
|
G |
Chsy1 |
chondroitin sulfate synthase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CHSY1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:119,689,626...119,750,711
Ensembl chr 1:119,686,350...119,750,601
|
|
G |
Cited1 |
Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CITED1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:67,350,376...67,355,072
Ensembl chr X:67,350,373...67,355,162
|
|
G |
Ckb |
creatine kinase B |
increases activity multiple interactions |
ISO EXP |
Dihydrotestosterone results in increased activity of CKB protein Glucose inhibits the reaction [Dihydrotestosterone results in increased activity of CKB protein] |
CTD |
PMID:16621514 PMID:17029789 |
|
NCBI chr 6:130,729,420...130,732,301
Ensembl chr 6:130,729,423...130,732,315
|
|
G |
Cldn8 |
claudin 8 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CLDN8 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:27,875,857...27,878,106
Ensembl chr11:27,875,692...27,878,513
|
|
G |
Clgn |
calmegin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CLGN mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:24,695,140...24,728,542
Ensembl chr19:24,696,875...24,728,758
|
|
G |
Clu |
clusterin |
multiple interactions decreases expression |
ISO |
4,4'-dichlorobenzophenone inhibits the reaction [Dihydrotestosterone results in decreased expression of CLU mRNA]; Dichlorodiphenyl Dichloroethylene inhibits the reaction [Dihydrotestosterone results in decreased expression of CLU mRNA] |
CTD |
PMID:21291947 |
|
NCBI chr15:40,161,068...40,200,315
Ensembl chr15:40,174,617...40,200,315
|
|
G |
Cmc2 |
C-x(9)-C motif containing 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CMC2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:44,943,283...44,971,930
Ensembl chr19:44,943,285...44,971,983
|
|
G |
Cmklr1 |
chemerin chemokine-like receptor 1 |
increases expression |
EXP |
Dihydrotestosterone results in increased expression of CMKLR1 mRNA |
CTD |
PMID:22948218 |
|
NCBI chr12:42,974,462...43,027,321
Ensembl chr12:42,974,410...43,028,129
|
|
G |
Cnksr2 |
connector enhancer of kinase suppressor of Ras 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CNKSR2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:36,908,135...37,148,337
Ensembl chr X:36,907,850...37,150,555
|
|
G |
Cog5 |
component of oligomeric golgi complex 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of COG5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:48,242,470...48,545,185
Ensembl chr 6:48,242,482...48,529,009
|
|
G |
Col12a1 |
collagen type XII alpha 1 chain |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of COL12A1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:80,547,592...80,665,665
Ensembl chr 8:80,547,593...80,665,686
|
|
G |
Col1a1 |
collagen type I alpha 1 chain |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of COL1A1 mRNA |
CTD |
PMID:17898587 |
|
NCBI chr10:79,883,622...79,900,625
Ensembl chr10:79,883,622...79,900,624
|
|
G |
Col4a6 |
collagen type IV alpha 6 chain |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of COL4A6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:104,766,463...105,117,499
Ensembl chr X:104,766,957...105,117,500
|
|
G |
Col6a1 |
collagen type VI alpha 1 chain |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of COL6A1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr20:11,906,105...11,924,599
Ensembl chr20:11,905,957...11,924,597
|
|
G |
Coro2a |
coronin 2A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CORO2A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:60,825,630...60,881,917
Ensembl chr 5:60,828,247...60,859,035
|
|
G |
Cpeb3 |
cytoplasmic polyadenylation element binding protein 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CPEB3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:234,749,138...234,931,219
Ensembl chr 1:234,751,733...234,931,560
|
|
G |
Creb1 |
cAMP responsive element binding protein 1 |
multiple interactions |
ISO |
CREB1 protein promotes the reaction [Dihydrotestosterone results in increased expression of FOS mRNA] [cypermethrin results in decreased susceptibility to Dihydrotestosterone] which results in decreased phosphorylation of CREB1 protein |
CTD |
PMID:15466214 PMID:30974244 |
|
NCBI chr 9:65,903,511...65,972,562
Ensembl chr 9:65,903,547...65,970,816
|
|
G |
Creb3l2 |
cAMP responsive element binding protein 3-like 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CREB3L2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:65,907,570...66,112,078
Ensembl chr 4:65,907,655...66,023,763
|
|
G |
Creb3l4 |
cAMP responsive element binding protein 3-like 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CREB3L4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:175,690,340...175,695,846
Ensembl chr 2:175,690,335...175,695,932
|
|
G |
Crebbp |
CREB binding protein |
multiple interactions |
ISO |
Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [CREBBP protein binds to KLK3 enhancer]]; Dihydrotestosterone promotes the reaction [CREBBP protein binds to KLK3 enhancer] |
CTD |
PMID:22258452 |
|
NCBI chr10:11,335,551...11,461,888
Ensembl chr10:11,335,953...11,461,888
|
|
G |
Creld2 |
cysteine-rich with EGF-like domains 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CRELD2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:119,909,626...119,916,556
Ensembl chr 7:119,909,633...119,916,543
|
|
G |
Crisp3 |
cysteine-rich secretory protein 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CRISP3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:20,432,051...20,472,663
Ensembl chr 9:20,450,908...20,472,658
|
|
G |
Crispld2 |
cysteine-rich secretory protein LCCL domain containing 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CRISPLD2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:48,053,153...48,111,485
Ensembl chr19:48,053,287...48,110,465
|
|
G |
Crot |
carnitine O-octanoyltransferase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CROT mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:25,068,270...25,133,111
Ensembl chr 4:25,080,587...25,133,109
|
|
G |
Crym |
crystallin, mu |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CRYM mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:174,560,423...174,575,660
Ensembl chr 1:174,560,416...174,575,633
|
|
G |
Csf1 |
colony stimulating factor 1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CSF1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 2:195,377,215...195,396,608
Ensembl chr 2:195,377,215...195,411,704
|
|
G |
Csf2 |
colony stimulating factor 2 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [TNF protein results in increased secretion of CSF2 protein] |
CTD |
PMID:16317058 |
|
NCBI chr10:38,386,945...38,388,926
Ensembl chr10:38,386,945...38,389,199
|
|
G |
Csgalnact1 |
chondroitin sulfate N-acetylgalactosaminyltransferase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CSGALNACT1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:20,995,210...21,330,586
Ensembl chr16:21,235,784...21,330,319
|
|
G |
Csk |
C-terminal Src kinase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CSK mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:58,029,748...58,048,742
Ensembl chr 8:58,029,749...58,048,292
|
|
G |
Csnk2a1 |
casein kinase 2 alpha 1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CSNK2A1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 3:140,709,984...140,756,757
Ensembl chr 3:140,709,991...140,756,696
|
|
G |
Csrp2 |
cysteine and glycine-rich protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CSRP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:46,349,109...46,367,743
Ensembl chr 7:46,348,686...46,367,745
|
|
G |
Cst8 |
cystatin 8 |
decreases expression increases expression |
ISO |
Dihydrotestosterone results in decreased expression of CST8 mRNA Dihydrotestosterone results in increased expression of CST8 protein |
CTD |
PMID:16837735 |
|
NCBI chr 3:136,244,586...136,255,412
Ensembl chr 3:136,244,636...136,251,273
|
|
G |
Ctbp1 |
C-terminal binding protein 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CTBP1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:77,455,580...77,482,821
Ensembl chr14:77,455,696...77,482,821
|
|
G |
Ctcf |
CCCTC-binding factor |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CTCF mRNA |
CTD |
PMID:17023530 |
|
NCBI chr19:33,521,726...33,571,124
Ensembl chr19:33,529,319...33,571,123
|
|
G |
Ctnna1 |
catenin alpha 1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CTNNA1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr18:26,728,246...26,860,911
Ensembl chr18:26,728,485...26,860,910
|
|
G |
Ctnna2 |
catenin alpha 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CTNNA2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:109,294,249...110,443,409
Ensembl chr 4:109,293,978...110,443,522
|
|
G |
Ctsl |
cathepsin L |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CTSL mRNA |
CTD |
PMID:17023530 |
|
NCBI chr17:764,370...770,533
Ensembl chr17:764,309...770,548
|
|
G |
Cux2 |
cut-like homeobox 2 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CUX2 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr12:34,507,723...34,707,581
Ensembl chr12:34,520,959...34,705,806
|
|
G |
Cxcl1 |
C-X-C motif chemokine ligand 1 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [TNF protein results in increased secretion of CXCL1 protein] |
CTD |
PMID:16317058 |
|
NCBI chr14:17,193,364...17,195,143
Ensembl chr14:17,193,365...17,195,215
|
|
G |
Cxcl12 |
C-X-C motif chemokine ligand 12 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CXCL12 mRNA; Dihydrotestosterone results in decreased expression of CXCL12 protein |
CTD |
PMID:15953861 |
|
NCBI chr 4:150,388,326...150,401,173
Ensembl chr 4:150,388,325...150,401,168
|
|
G |
Cxcl3 |
C-X-C motif chemokine ligand 3 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [TNF protein results in increased secretion of CXCL1 protein] |
CTD |
PMID:16317058 |
|
NCBI chr14:17,287,727...17,289,451
Ensembl chr14:17,270,146...17,289,511
|
|
G |
Cxcr4 |
C-X-C motif chemokine receptor 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CXCR4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:40,077,976...40,081,883
Ensembl chr13:40,077,976...40,081,883
|
|
G |
Cyb5a |
cytochrome b5 type A |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Androgens deficiency results in increased expression of CYB5A mRNA] |
CTD |
PMID:29367455 |
|
NCBI chr18:78,213,067...78,245,677
Ensembl chr18:78,202,342...78,258,535 Ensembl chr18:78,202,342...78,258,535
|
|
G |
Cyp11a1 |
cytochrome P450, family 11, subfamily a, polypeptide 1 |
increases expression multiple interactions decreases expression |
EXP ISO |
Dihydrotestosterone results in increased expression of CYP11A1 mRNA FSHB protein inhibits the reaction [Dihydrotestosterone results in decreased expression of CYP11A1 protein] Dihydrotestosterone results in decreased expression of CYP11A1 mRNA; Dihydrotestosterone results in decreased expression of CYP11A1 protein |
CTD |
PMID:21273442 PMID:22948218 PMID:29581250 |
|
NCBI chr 8:58,422,807...58,434,342
Ensembl chr 8:58,404,669...58,434,338
|
|
G |
Cyp19a1 |
cytochrome P450, family 19, subfamily a, polypeptide 1 |
increases expression multiple interactions decreases expression |
EXP |
Dihydrotestosterone results in increased expression of CYP19A1 mRNA; Dihydrotestosterone results in increased expression of CYP19A1 protein FSHB protein inhibits the reaction [Dihydrotestosterone results in decreased expression of CYP19A1 protein] Dihydrotestosterone results in decreased expression of CYP19A1 mRNA; Dihydrotestosterone results in decreased expression of CYP19A1 protein |
CTD |
PMID:15525594 PMID:21273442 PMID:22948218 |
|
NCBI chr 8:54,552,978...54,580,375
Ensembl chr 8:54,553,165...54,580,758
|
|
G |
Cyp1a1 |
cytochrome P450, family 1, subfamily a, polypeptide 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CYP1A1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:58,096,021...58,102,130
Ensembl chr 8:58,096,077...58,102,125
|
|
G |
Cyp1b1 |
cytochrome P450, family 1, subfamily b, polypeptide 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CYP1B1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:15,342,312...15,350,886
Ensembl chr 6:15,342,344...15,350,917
|
|
G |
Cyp24a1 |
cytochrome P450, family 24, subfamily a, polypeptide 1 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Calcifediol results in increased expression of CYP24A1 mRNA]; Dihydrotestosterone inhibits the reaction [Calcitriol results in increased expression of CYP24A1 mRNA] |
CTD |
PMID:15538745 PMID:16524720 |
|
NCBI chr 3:159,275,947...159,290,383
Ensembl chr 3:159,275,947...159,290,383
|
|
G |
Cyp26a1 |
cytochrome P450, family 26, subfamily a, polypeptide 1 |
multiple interactions |
ISO |
[Retinaldehyde co-treated with Dihydrotestosterone] results in increased expression of CYP26A1 mRNA |
CTD |
PMID:17526768 |
|
NCBI chr 1:235,471,368...235,475,204
Ensembl chr 1:235,471,298...235,475,204
|
|
G |
Cyp27b1 |
cytochrome P450, family 27, subfamily b, polypeptide 1 |
affects expression |
ISO |
Dihydrotestosterone affects the expression of CYP27B1 mRNA |
CTD |
PMID:17659868 |
|
NCBI chr 7:62,869,340...62,876,242
Ensembl chr 7:62,871,297...62,876,241
|
|
G |
Cyp2u1 |
cytochrome P450, family 2, subfamily u, polypeptide 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CYP2U1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:219,849,403...219,866,959
Ensembl chr 2:219,849,407...219,866,882
|
|
G |
Cyp3a2 |
cytochrome P450, family 3, subfamily a, polypeptide 2 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [[Monocrotaline results in increased activity of NR1I2 protein] which results in increased expression of CYP3A4 mRNA]; Flutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [[Monocrotaline results in increased activity of NR1I2 protein] which results in increased expression of CYP3A4 mRNA]] |
CTD |
PMID:32682830 |
|
NCBI chr12:9,207,978...9,230,064
Ensembl chr12:9,015,383...9,285,008
|
|
G |
Cyp4f6 |
cytochrome P450, family 4, subfamily f, polypeptide 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CYP4F8 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:12,030,276...12,058,020
Ensembl chr 7:12,030,301...12,057,782
|
|
G |
Cyp51 |
cytochrome P450, family 51 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of CYP51 mRNA |
CTD |
PMID:29367455 |
|
NCBI chr 4:30,036,956...30,055,410
Ensembl chr 4:30,036,865...30,055,410
|
|
G |
Cyp7b1 |
cytochrome P450 family 7 subfamily B member 1 |
decreases activity decreases expression |
ISO |
Dihydrotestosterone results in decreased activity of CYP7B1 protein Dihydrotestosterone results in decreased expression of CYP7B1 mRNA |
CTD |
PMID:16630558 |
|
NCBI chr 2:100,502,791...100,669,713
Ensembl chr 2:100,502,791...100,669,698
|
|
G |
Cyth1 |
cytohesin 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of CYTH1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:103,402,727...103,485,826
Ensembl chr10:103,366,145...103,485,760
|
|
G |
Dbi |
diazepam binding inhibitor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DBI mRNA |
CTD |
PMID:16963002 PMID:29581250 |
|
NCBI chr13:31,241,466...31,249,853
Ensembl chr13:31,206,988...31,268,693
|
|
G |
Dcaf6 |
DDB1 and CUL4 associated factor 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DCAF6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:77,626,257...77,727,645
Ensembl chr13:77,626,307...77,727,512
|
|
G |
Dcaf8 |
DDB1 and CUL4 associated factor 8 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DCAF8 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:84,609,838...84,667,025
Ensembl chr13:84,610,248...84,669,726
|
|
G |
Degs1 |
delta(4)-desaturase, sphingolipid 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DEGS1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:93,946,154...93,953,677
Ensembl chr13:93,946,157...93,953,664
|
|
G |
Depdc1 |
DEP domain containing 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DEPDC1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:248,684,508...248,717,951
Ensembl chr 2:248,684,523...248,717,951
|
|
G |
Deptor |
DEP domain containing MTOR-interacting protein |
decreases expression multiple interactions |
ISO |
Dihydrotestosterone results in decreased expression of DEPTOR mRNA; Dihydrotestosterone results in decreased expression of DEPTOR protein bicalutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of DEPTOR mRNA] |
CTD |
PMID:26558456 |
|
NCBI chr 7:86,514,859...86,668,817
Ensembl chr 7:86,514,988...86,667,773
|
|
G |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of DGAT2 mRNA |
CTD |
PMID:18801408 |
|
NCBI chr 1:153,454,078...153,484,432
Ensembl chr 1:153,454,080...153,484,428
|
|
G |
Dgcr6 |
DiGeorge syndrome critical region gene 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DGCR6 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr11:82,927,725...82,932,823
Ensembl chr11:82,927,725...82,932,823
|
|
G |
Dhcr24 |
24-dehydrocholesterol reductase |
affects expression multiple interactions increases expression |
ISO |
Dihydrotestosterone affects the expression of DHCR24 mRNA Dihydrotestosterone inhibits the reaction [Androgens deficiency results in increased expression of DHCR24 mRNA] Dihydrotestosterone results in increased expression of DHCR24 mRNA |
CTD |
PMID:17094431 PMID:29367455 PMID:29581250 |
|
NCBI chr 5:121,344,552...121,371,124
Ensembl chr 5:121,344,575...121,371,137
|
|
G |
Dhrs11 |
dehydrogenase/reductase 11 |
increases oxidation |
ISO |
DHRS11 protein results in increased oxidation of Dihydrotestosterone |
CTD |
PMID:30926317 |
|
NCBI chr10:69,698,214...69,708,294
Ensembl chr10:69,698,214...69,708,295
|
|
G |
Dipk1a |
divergent protein kinase domain 1A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM69A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:1,772,412...1,843,508
Ensembl chr14:1,772,422...1,843,743
|
|
G |
Dipk2a |
divergent protein kinase domain 2A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DIPK2A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:95,070,695...95,089,815
Ensembl chr 8:95,030,279...95,089,815
|
|
G |
Dkk1 |
dickkopf WNT signaling pathway inhibitor 1 |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of DKK1 mRNA; Dihydrotestosterone results in increased expression of DKK1 protein ascorbate-2-phosphate inhibits the reaction [Dihydrotestosterone results in increased expression of DKK1 mRNA]; ascorbate-2-phosphate inhibits the reaction [Dihydrotestosterone results in increased expression of DKK1 protein] |
CTD |
PMID:20701628 |
|
NCBI chr 1:228,381,521...228,385,202
Ensembl chr 1:228,381,521...228,385,202
|
|
G |
Dlg2 |
discs large MAGUK scaffold protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DLG2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:144,451,653...146,503,949
Ensembl chr 1:144,451,472...146,499,475
|
|
G |
Dlx1 |
distal-less homeobox 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DLX1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:56,356,190...56,360,780
Ensembl chr 3:56,356,190...56,360,780
|
|
G |
Dlx2 |
distal-less homeobox 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DLX2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:56,370,238...56,373,581
Ensembl chr 3:56,370,483...56,373,597
|
|
G |
Dnaaf9 |
dynein axonemal assembly factor 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNAAF9 mRNA |
CTD |
PMID:17254854 |
|
NCBI chr 3:117,918,047...118,052,641
Ensembl chr 3:117,921,620...118,052,630
|
|
G |
Dnah5 |
dynein, axonemal, heavy chain 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNAH5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:78,937,788...79,255,551
Ensembl chr 2:78,937,800...79,254,890
|
|
G |
Dnajb11 |
DnaJ heat shock protein family (Hsp40) member B11 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNAJB11 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:78,151,750...78,168,259
Ensembl chr11:78,150,429...78,180,407
|
|
G |
Dnajb5 |
DnaJ heat shock protein family (Hsp40) member B5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNAJB5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:57,176,840...57,186,067
Ensembl chr 5:57,176,845...57,185,490
|
|
G |
Dnajb9 |
DnaJ heat shock protein family (Hsp40) member B9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNAJB9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:61,270,385...61,276,795
Ensembl chr 6:61,269,913...61,275,063
|
|
G |
Dnajc10 |
DnaJ heat shock protein family (Hsp40) member C10 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNAJC10 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:65,232,031...65,272,732
Ensembl chr 3:65,232,697...65,272,719
|
|
G |
Dnajc3 |
DnaJ heat shock protein family (Hsp40) member C3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNAJC3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:96,025,605...96,068,585
Ensembl chr15:96,025,624...96,065,181
|
|
G |
Dnase2b |
deoxyribonuclease 2 beta |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNASE2B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:235,470,915...235,515,211
Ensembl chr 2:235,470,919...235,486,295
|
|
G |
Dner |
delta/notch-like EGF repeat containing |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNER mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:85,586,985...85,902,461
Ensembl chr 9:85,586,987...85,902,637
|
|
G |
Dnm1l |
dynamin 1-like |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DNM1L mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:84,581,216...84,632,382
Ensembl chr11:84,581,216...84,631,482
|
|
G |
Dock4 |
dedicator of cytokinesis 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DOCK4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:57,512,929...57,902,597
Ensembl chr 6:57,512,908...57,901,855
|
|
G |
Dock8 |
dedicator of cytokinesis 8 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DOCK8 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:222,649,309...222,842,474
Ensembl chr 1:222,649,309...222,842,474
|
|
G |
Dpp4 |
dipeptidylpeptidase 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DPP4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:46,962,233...47,043,870
Ensembl chr 3:46,962,243...47,043,901
|
|
G |
Dsc1 |
desmocollin 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DSC1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:11,499,936...11,556,801
Ensembl chr18:11,502,003...11,528,494
|
|
G |
Dusp4 |
dual specificity phosphatase 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DUSP4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:57,376,659...57,398,161
Ensembl chr16:57,377,229...57,398,138
|
|
G |
Dynll1 |
dynein light chain LC8-type 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DYNLL1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr12:41,312,365...41,316,157
Ensembl chr12:41,312,367...41,314,741
|
|
G |
Dynll2 |
dynein light chain LC8-type 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of DYNLL2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:72,767,035...72,785,824
Ensembl chr10:72,767,035...72,785,805
|
|
G |
E2f1 |
E2F transcription factor 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of E2F1 mRNA; Dihydrotestosterone results in increased expression of E2F1 protein |
CTD |
PMID:15647840 |
|
NCBI chr 3:143,064,535...143,075,362
Ensembl chr 3:143,049,478...143,075,361
|
|
G |
Eaf2 |
ELL associated factor 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EAF2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:63,960,200...64,004,610
Ensembl chr11:63,960,200...64,004,610
|
|
G |
Eci2 |
enoyl-CoA delta isomerase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ECI2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:29,850,884...29,886,781
Ensembl chr17:29,870,391...29,886,781
|
|
G |
Edem1 |
ER degradation enhancing alpha-mannosidase like protein 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EDEM1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:141,797,631...141,829,717
Ensembl chr 4:141,797,701...141,829,717
|
|
G |
Edem3 |
ER degradation enhancing alpha-mannosidase like protein 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EDEM3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:63,858,282...63,920,538
Ensembl chr13:63,858,716...63,920,523
|
|
G |
Efcab12 |
EF-hand calcium binding domain 12 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EFCAB12 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:148,869,381...148,892,922
Ensembl chr 4:148,869,387...148,890,560
|
|
G |
Egfr |
epidermal growth factor receptor |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of EGFR mRNA [cypermethrin results in decreased susceptibility to Dihydrotestosterone] which results in decreased phosphorylation of EGFR protein |
CTD |
PMID:29581250 PMID:30974244 |
|
NCBI chr14:91,176,979...91,349,722
Ensembl chr14:91,177,067...91,344,382
|
|
G |
Egr1 |
early growth response 1 |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of EGR1 mRNA; Dihydrotestosterone results in increased expression of EGR1 protein cypermethrin inhibits the reaction [Dihydrotestosterone results in increased expression of EGR1 mRNA]; cypermethrin inhibits the reaction [Dihydrotestosterone results in increased expression of EGR1 protein] |
CTD |
PMID:17023530 PMID:30974244 |
|
NCBI chr18:26,462,967...26,466,766
Ensembl chr18:26,462,981...26,466,766
|
|
G |
Ehbp1 |
EH domain binding protein 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EHBP1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:96,093,327...96,380,502
Ensembl chr14:96,093,327...96,345,332
|
|
G |
Ehf |
ets homologous factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EHF mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:89,639,845...89,680,061
Ensembl chr 3:89,641,833...89,679,997
|
|
G |
Eif2a |
eukaryotic translation initiation factor 2A |
increases phosphorylation multiple interactions |
ISO |
Dihydrotestosterone results in increased phosphorylation of EIF2A protein AR protein affects the reaction [Dihydrotestosterone results in increased phosphorylation of EIF2A protein] |
CTD |
PMID:23405127 |
|
NCBI chr 2:142,761,303...142,794,767
Ensembl chr 2:142,761,416...142,795,068
|
|
G |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EIF2AK3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:102,805,495...102,866,914
Ensembl chr 4:102,805,510...102,866,911
|
|
G |
Elf2 |
E74 like ETS transcription factor 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ELF2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:135,292,291...135,385,942
Ensembl chr 2:135,294,906...135,385,947
|
|
G |
Elk4 |
ETS transcription factor ELK4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ELK4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:43,451,130...43,475,035
Ensembl chr13:43,435,843...43,475,035
|
|
G |
Ell2 |
elongation factor for RNA polymerase II 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ELL2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:5,189,375...5,258,781
Ensembl chr 2:5,189,971...5,258,781
|
|
G |
Elovl2 |
ELOVL fatty acid elongase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ELOVL2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:23,544,598...23,584,855
Ensembl chr17:23,544,568...23,584,848
|
|
G |
Elovl5 |
ELOVL fatty acid elongase 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ELOVL5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:78,790,846...78,857,307
Ensembl chr 8:78,790,846...78,857,284
|
|
G |
Elovl7 |
ELOVL fatty acid elongase 7 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ELOVL7 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:39,789,229...39,858,579
Ensembl chr 2:39,789,250...39,856,845
|
|
G |
Eml1 |
EMAP like 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EML1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:127,283,968...127,457,246
Ensembl chr 6:127,284,029...127,457,246
|
|
G |
Emp2 |
epithelial membrane protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EMP2 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr10:5,360,073...5,394,734
Ensembl chr10:5,360,073...5,394,733
|
|
G |
Enc1 |
ectodermal-neural cortex 1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of ENC1 mRNA |
CTD |
PMID:18007998 |
|
NCBI chr 2:28,550,670...28,562,591
Ensembl chr 2:28,550,464...28,562,713
|
|
G |
Endod1 |
endonuclease domain containing 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ENDOD1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:11,209,113...11,238,507
Ensembl chr 8:11,211,110...11,238,892
|
|
G |
Entrep1 |
endosomal transmembrane epsin interactor 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ENTREP1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:221,592,500...221,646,603
Ensembl chr 1:221,592,503...221,646,758
|
|
G |
Ep300 |
E1A binding protein p300 |
multiple interactions |
ISO |
Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [EP300 protein binds to KLK3 enhancer]]; Dihydrotestosterone promotes the reaction [AR protein binds to EP300 protein]; Dihydrotestosterone promotes the reaction [EP300 protein binds to GAS6 promoter]; Dihydrotestosterone promotes the reaction [EP300 protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [EP300 protein binds to KLK3 promoter] |
CTD |
PMID:18487222 PMID:20048160 PMID:22258452 |
|
NCBI chr 7:113,108,476...113,178,529
Ensembl chr 7:113,106,247...113,136,088 Ensembl chr 7:113,106,247...113,136,088
|
|
G |
Epb41l4b |
erythrocyte membrane protein band 4.1 like 4B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EPB41L4B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:71,691,706...71,852,583
Ensembl chr 5:71,694,331...71,851,990
|
|
G |
Epn2 |
epsin 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EPN2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:46,197,785...46,259,673
Ensembl chr10:46,197,785...46,259,642
|
|
G |
Erg |
ETS transcription factor ERG |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of ERG mRNA; Dihydrotestosterone results in increased expression of ERG protein (+)-JQ1 compound inhibits the reaction [Dihydrotestosterone results in increased expression of ERG mRNA]; (+)-JQ1 compound inhibits the reaction [Dihydrotestosterone results in increased expression of ERG protein] |
CTD |
PMID:24759320 |
|
NCBI chr11:34,678,614...34,900,951
Ensembl chr11:34,678,618...34,845,871
|
|
G |
Ergic2 |
ERGIC and golgi 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ERGIC2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:181,090,808...181,123,074
Ensembl chr 4:181,090,808...181,123,060
|
|
G |
Erlec1 |
endoplasmic reticulum lectin 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ERLEC1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:104,655,745...104,693,508
Ensembl chr14:104,655,673...104,693,480
|
|
G |
Ern1 |
endoplasmic reticulum to nucleus signaling 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ERN1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:91,326,889...91,421,201
Ensembl chr10:91,330,654...91,421,029
|
|
G |
Ero1a |
endoplasmic reticulum oxidoreductase 1 alpha |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ERO1A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:18,495,037...18,530,440
Ensembl chr15:18,492,945...18,530,478
|
|
G |
Ero1b |
endoplasmic reticulum oxidoreductase 1 beta |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ERO1B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:85,861,086...86,003,244
Ensembl chr17:85,929,618...86,003,398
|
|
G |
Erp44 |
endoplasmic reticulum protein 44 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ERP44 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:62,516,550...62,610,762
Ensembl chr 5:62,516,551...62,610,761
|
|
G |
Errfi1 |
ERBB receptor feedback inhibitor 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ERRFI1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:161,323,981...161,337,289
Ensembl chr 5:161,323,998...161,337,282
|
|
G |
Esr1 |
estrogen receptor 1 |
multiple interactions increases phosphorylation increases expression affects response to substance affects binding increases activity |
ISO EXP |
[Dihydrotestosterone co-treated with Estradiol] results in decreased expression of ESR1 protein; Dichlorodiphenyl Dichloroethylene inhibits the reaction [[Dihydrotestosterone co-treated with Estradiol] results in decreased expression of ESR1 protein]; Dihydrotestosterone binds to and results in increased activity of ESR1 protein; Dihydrotestosterone inhibits the reaction [Estradiol binds to ESR1 protein]; hydroxyflutamide inhibits the reaction [[Dihydrotestosterone co-treated with Estradiol] results in decreased expression of ESR1 protein] Dihydrotestosterone results in increased phosphorylation of ESR1 protein Dihydrotestosterone results in increased expression of ESR1 protein alternative form ESR1 protein affects the susceptibility to Dihydrotestosterone Dihydrotestosterone binds to ESR1 protein Dihydrotestosterone results in increased activity of ESR1 protein |
CTD |
PMID:11162928 PMID:11750080 PMID:12676605 PMID:18275596 PMID:19022364 PMID:19913605 PMID:22275727 PMID:25969534 PMID:29162470 More...
|
|
NCBI chr 1:41,106,335...41,499,104
Ensembl chr 1:41,210,475...41,495,002
|
|
G |
Esr2 |
estrogen receptor 2 |
multiple interactions affects binding increases localization increases activity decreases expression |
ISO EXP |
AR protein mutant form affects the reaction [Dihydrotestosterone results in decreased expression of ESR2 protein]; fulvestrant inhibits the reaction [Dihydrotestosterone results in increased activity of ESR2 protein]; fulvestrant inhibits the reaction [Dihydrotestosterone results in increased localization of ESR2 protein] 5alpha-dihydrotestosterone binds to Esr2 protein Dihydrotestosterone results in decreased expression of ESR2 mRNA; Dihydrotestosterone results in decreased expression of ESR2 protein |
CTD RGD |
PMID:15171712 PMID:18007998 PMID:9048584 |
RGD:8694130 |
NCBI chr 6:94,858,438...94,909,630
Ensembl chr 6:94,809,547...94,908,919
|
|
G |
Etl4 |
enhancer trap locus 4 |
multiple interactions decreases expression |
ISO |
bicalutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of KIAA1217 mRNA] |
CTD |
PMID:17624924 |
|
NCBI chr17:82,841,075...83,304,868
Ensembl chr17:82,495,041...83,304,715
|
|
G |
Etv1 |
ETS variant transcription factor 1 |
multiple interactions increases expression |
ISO |
bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of ETV1 mRNA] |
CTD |
PMID:28757136 |
|
NCBI chr 6:55,590,149...55,681,784
Ensembl chr 6:55,590,234...55,681,775
|
|
G |
Ezr |
ezrin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of EZR mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:46,967,961...47,011,505
Ensembl chr 1:46,967,658...47,011,505
|
|
G |
F2r |
coagulation factor II (thrombin) receptor |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of F2R mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 2:26,869,343...26,885,856
Ensembl chr 2:26,868,404...26,885,870
|
|
G |
F5 |
coagulation factor V |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of F5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:76,513,509...76,583,106
Ensembl chr13:76,513,255...76,582,317
|
|
G |
Fabp4 |
fatty acid binding protein 4 |
multiple interactions decreases expression |
ISO |
bicalutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of FABP4 protein] Dihydrotestosterone results in decreased expression of FABP4 mRNA; Dihydrotestosterone results in decreased expression of FABP4 protein |
CTD |
PMID:18801408 |
|
NCBI chr 2:91,580,879...91,585,567
Ensembl chr 2:91,580,885...91,585,578
|
|
G |
Fads1 |
fatty acid desaturase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FADS1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:206,827,724...206,842,734
Ensembl chr 1:206,827,765...206,842,734
|
|
G |
Fam107a |
family with sequence similarity 107, member A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM107A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:16,608,362...16,630,398
Ensembl chr15:16,607,205...16,630,396
|
|
G |
Fam110b |
family with sequence similarity 110, member B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM110B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:18,789,362...18,929,647
Ensembl chr 5:18,789,389...18,929,828
|
|
G |
Fam13c |
family with sequence similarity 13, member C |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM13C mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:18,065,625...18,187,792
Ensembl chr20:18,065,628...18,187,592
|
|
G |
Fam174b |
family with sequence similarity 174, member B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM174B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:127,515,393...127,618,591
Ensembl chr 1:127,514,041...127,596,128 Ensembl chr 1:127,514,041...127,596,128
|
|
G |
Fam193a |
family with sequence similarity 193, member A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM193A mRNA |
CTD |
PMID:16631469 |
|
NCBI chr14:76,250,103...76,382,525
Ensembl chr14:76,256,161...76,382,514
|
|
G |
Fasn |
fatty acid synthase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FASN mRNA |
CTD |
PMID:16990341 PMID:29581250 |
|
NCBI chr10:106,072,093...106,090,259
Ensembl chr10:106,072,091...106,090,261
|
|
G |
Fbxl16 |
F-box and leucine-rich repeat protein 16 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of FBXL16 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr10:14,829,453...14,841,739
Ensembl chr10:14,829,449...14,840,986
|
|
G |
Fbxo28 |
F-box protein 28 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of FBXO28 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr13:93,995,993...94,021,464
Ensembl chr13:93,995,996...94,021,464
|
|
G |
Fdft1 |
farnesyl diphosphate farnesyl transferase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FDFT1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:37,412,143...37,440,198
Ensembl chr15:37,412,146...37,440,287
|
|
G |
Fdps |
farnesyl diphosphate synthase |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Androgens deficiency results in increased expression of FDPS mRNA] |
CTD |
PMID:29367455 |
|
NCBI chr 2:174,497,402...174,507,031
Ensembl chr 2:174,486,665...174,507,776
|
|
G |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FGD4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:84,399,989...84,551,013
Ensembl chr11:84,399,816...84,546,972
|
|
G |
Fgf2 |
fibroblast growth factor 2 |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of FGF2 mRNA; Dihydrotestosterone results in increased expression of FGF2 protein Flutamide inhibits the reaction [Dihydrotestosterone results in increased expression of FGF2 mRNA]; Flutamide inhibits the reaction [Dihydrotestosterone results in increased expression of FGF2 protein] |
CTD |
PMID:20421132 |
|
NCBI chr 2:120,236,328...120,290,673
Ensembl chr 2:120,236,328...120,291,221
|
|
G |
Fgfr1 |
Fibroblast growth factor receptor 1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of FGFR1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr16:66,491,930...66,547,161
Ensembl chr16:66,494,042...66,547,350
|
|
G |
Fhl2 |
four and a half LIM domains 2 |
multiple interactions |
ISO |
[FHL2 protein co-treated with Tetrachlorodibenzodioxin] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]; AHR protein inhibits the reaction [[FHL2 protein co-treated with Tetrachlorodibenzodioxin] inhibits the reaction [Dihydrotestosterone results in increased activity of AR protein]]; FHL2 protein affects the reaction [[Dihydrotestosterone co-treated with Tetrachlorodibenzodioxin] results in increased activity of AR protein]; FHL2 protein inhibits the reaction [AHR protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]]; FHL2 protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein] |
CTD |
PMID:19815066 |
|
NCBI chr 9:45,388,979...45,462,421
Ensembl chr 9:45,388,981...45,431,192
|
|
G |
Ficd |
FIC domain protein adenylyltransferase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FICD mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:42,889,195...42,894,090
Ensembl chr12:42,889,194...42,894,070
|
|
G |
Fkbp11 |
FKBP prolyl isomerase 11 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FKBP11 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:129,871,870...129,877,760
Ensembl chr 7:129,871,870...129,875,303
|
|
G |
Fkbp14 |
FKBP prolyl isomerase 14 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FKBP14 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:83,705,531...83,721,515
Ensembl chr 4:83,705,652...83,721,528
|
|
G |
Fkbp1b |
FKBP prolyl isomerase 1B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FKBP1B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:27,832,128...27,850,600
Ensembl chr 6:27,838,802...27,848,653
|
|
G |
Fkbp5 |
FKBP prolyl isomerase 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FKBP5 mRNA |
CTD |
PMID:18007998 PMID:26558456 PMID:29581250 |
|
NCBI chr20:6,457,207...6,575,404
Ensembl chr20:6,457,216...6,541,674
|
|
G |
Fmo5 |
flavin containing dimethylaniline monoxygenase 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FMO5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:185,197,184...185,249,699
Ensembl chr 2:185,222,204...185,249,693
|
|
G |
Fnbp1l |
formin binding protein 1-like |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FNBP1L mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:210,647,241...210,748,203
Ensembl chr 2:210,647,246...210,738,455
|
|
G |
Folh1 |
folate hydrolase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FOLH1 mRNA |
CTD |
PMID:12711008 |
|
NCBI chr 1:140,428,101...140,501,563
Ensembl chr 1:140,428,101...140,501,379
|
|
G |
Fos |
Fos proto-oncogene, AP-1 transcription factor subunit |
multiple interactions increases expression |
ISO |
2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in increased expression of FOS mRNA]; AR protein promotes the reaction [Dihydrotestosterone results in increased expression of FOS mRNA]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of FOS mRNA]; CREB1 protein promotes the reaction [Dihydrotestosterone results in increased expression of FOS mRNA] |
CTD |
PMID:15466214 |
|
NCBI chr 6:105,121,170...105,124,036
Ensembl chr 6:105,121,170...105,124,036
|
|
G |
Fosl1 |
FOS like 1, AP-1 transcription factor subunit |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FOSL1 protein |
CTD |
PMID:20025956 |
|
NCBI chr 1:202,754,549...202,763,057
Ensembl chr 1:202,754,529...202,764,930
|
|
G |
Fosl2 |
FOS like 2, AP-1 transcription factor subunit |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FOSL2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:24,297,898...24,319,219
Ensembl chr 6:24,300,956...24,320,034
|
|
G |
Foxa1 |
forkhead box A1 |
multiple interactions |
ISO |
Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [FOXA1 protein binds to KLK3 enhancer]]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [FOXA1 protein binds to TMPRSS2 enhancer]]; Dihydrotestosterone promotes the reaction [FOXA1 protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [FOXA1 protein binds to TMPRSS2 enhancer] |
CTD |
PMID:22258452 |
|
NCBI chr 6:75,099,907...75,136,534
Ensembl chr 6:75,103,503...75,136,188
|
|
G |
Foxa2 |
forkhead box A2 |
multiple interactions |
ISO |
FOXA2 protein inhibits the reaction [Dihydrotestosterone results in increased expression of LCN5 mRNA] |
CTD |
PMID:16740652 |
|
NCBI chr 3:135,470,123...135,474,326
Ensembl chr 3:135,470,131...135,474,326
|
|
G |
Foxg1 |
forkhead box G1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FOXG1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:66,674,797...66,677,611
Ensembl chr 6:66,666,587...66,678,607
|
|
G |
Foxo3 |
forkhead box O3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FOXO3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:45,669,708...45,764,606
Ensembl chr20:45,672,995...45,764,561
|
|
G |
Frat1 |
FRAT regulator of WNT signaling pathway 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FRAT1 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr 1:240,638,309...240,640,857
Ensembl chr 1:240,638,296...240,640,945
|
|
G |
Frk |
fyn-related Src family tyrosine kinase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FRK mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:38,265,416...38,371,038
Ensembl chr20:38,265,280...38,371,114
|
|
G |
Frmd4a |
FERM domain containing 4A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FRMD4A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:73,667,787...74,258,487
Ensembl chr17:73,667,789...74,258,687
|
|
G |
Fry |
FRY microtubule binding protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FRY mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:4,493,890...4,887,118
Ensembl chr12:4,493,891...4,799,116
|
|
G |
Fryl |
FRY like transcription coactivator |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FRYL mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:34,956,623...35,189,738
Ensembl chr14:34,956,620...35,190,222
|
|
G |
Fsbp |
fibrinogen silencer binding protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FSBP mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:25,058,003...25,064,276
Ensembl chr 5:25,032,066...25,104,616
|
|
G |
Fshb |
follicle stimulating hormone subunit beta |
multiple interactions affects expression increases expression |
ISO EXP |
[FSHB protein co-treated with LHB protein co-treated with CGB3 protein] results in increased abundance of Dihydrotestosterone; [FSHB protein co-treated with testosterone enanthate] results in increased abundance of Dihydrotestosterone Dihydrotestosterone affects the expression of FSHB protein Dihydrotestosterone inhibits the reaction [FSHB protein results in increased abundance of Estradiol]; Dihydrotestosterone inhibits the reaction [FSHB protein results in increased abundance of Progesterone]; Dihydrotestosterone inhibits the reaction [FSHB protein results in increased phosphorylation of RPS6KB1 protein]; Dihydrotestosterone inhibits the reaction [FSHB protein results in increased phosphorylation of TSC2 protein]; FSHB protein inhibits the reaction [Dihydrotestosterone results in decreased expression of CYP11A1 protein]; FSHB protein inhibits the reaction [Dihydrotestosterone results in decreased expression of CYP19A1 protein] Dihydrotestosterone results in increased expression of FSHB mRNA |
CTD |
PMID:8263139 PMID:10709760 PMID:16675544 PMID:17510244 PMID:22948218 |
|
NCBI chr 3:93,548,560...93,552,370
Ensembl chr 3:93,548,560...93,552,370
|
|
G |
Fst |
follistatin |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of FST mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 2:46,123,260...46,130,584
Ensembl chr 2:46,123,439...46,130,571
|
|
G |
Fv1 |
Friend virus susceptibility 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of C19ORF48P mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:94,730,839...94,736,791
Ensembl chr 1:94,730,606...94,737,594
|
|
G |
Fzd1 |
frizzled class receptor 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FZD1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:29,310,303...29,314,701
Ensembl chr 4:29,310,091...29,312,643 Ensembl chr 4:29,310,091...29,312,643
|
|
G |
Fzd5 |
frizzled class receptor 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FZD5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:66,113,096...66,120,276
Ensembl chr 9:66,113,112...66,121,457
|
|
G |
Fzd6 |
frizzled class receptor 6 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of FZD6 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 7:70,055,012...70,086,781
Ensembl chr 7:70,055,068...70,086,776
|
|
G |
G3bp2 |
G3BP stress granule assembly factor 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of G3BP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:15,932,403...16,020,555
Ensembl chr14:15,987,417...16,020,548
|
|
G |
Gabrg2 |
gamma-aminobutyric acid type A receptor subunit gamma 2 |
decreases expression |
EXP |
Dihydrotestosterone decreases expression of Gabrg2 protein in hippocampal neurons |
RGD |
PMID:18289534 |
RGD:402528886 |
NCBI chr10:26,374,693...26,463,937
Ensembl chr10:26,374,694...26,464,346
|
|
G |
Gadd45g |
growth arrest and DNA-damage-inducible, gamma |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GADD45G mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:13,376,842...13,378,587
Ensembl chr17:13,376,839...13,378,610
|
|
G |
Gapdh |
glyceraldehyde-3-phosphate dehydrogenase |
decreases activity multiple interactions |
EXP |
Dihydrotestosterone results in decreased activity of GAPDH protein nilutamide inhibits the reaction [Dihydrotestosterone results in decreased activity of GAPDH protein] |
CTD |
PMID:10650946 |
|
NCBI chr 4:157,962,312...157,967,158
Ensembl chr 4:157,962,343...157,966,235
|
|
G |
Gas6 |
growth arrest specific 6 |
multiple interactions increases expression |
ISO |
AR mutant form inhibits the reaction [Dihydrotestosterone results in increased expression of GAS6 mRNA]; Dihydrotestosterone promotes the reaction [AR protein binds to GAS6 promoter]; Dihydrotestosterone promotes the reaction [EP300 protein binds to GAS6 promoter]; Flutamide inhibits the reaction [Dihydrotestosterone results in increased expression of GAS6 mRNA] |
CTD |
PMID:20048160 |
|
NCBI chr16:76,045,430...76,075,904
Ensembl chr16:76,045,426...76,075,904
|
|
G |
Gata2 |
GATA binding protein 2 |
multiple interactions |
ISO |
Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [GATA2 protein binds to KLK3 enhancer]]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [GATA2 protein binds to TMPRSS2 enhancer]]; Dihydrotestosterone promotes the reaction [GATA2 protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [GATA2 protein binds to TMPRSS2 enhancer] |
CTD |
PMID:22258452 |
|
NCBI chr 4:120,654,205...120,667,763
Ensembl chr 4:120,658,986...120,667,761
|
|
G |
Gba1 |
glucosylceramidase beta 1 |
decreases activity |
EXP |
Dihydrotestosterone results in decreased activity of GBA1 protein |
CTD |
PMID:9101438 |
|
NCBI chr 2:174,609,437...174,615,457
Ensembl chr 2:174,609,403...174,618,263
|
|
G |
Gcfc2 |
GC-rich sequence DNA-binding factor 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GCFC2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:114,481,613...114,519,268
Ensembl chr 4:114,481,607...114,519,962
|
|
G |
Gcnt1 |
glucosaminyl (N-acetyl) transferase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GCNT1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:214,718,344...214,755,735
Ensembl chr 1:214,718,293...214,758,776
|
|
G |
Gdf15 |
growth differentiation factor 15 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GDF15 mRNA |
CTD |
PMID:16523695 |
|
NCBI chr16:18,804,457...18,808,043
Ensembl chr16:18,805,239...18,808,055
|
|
G |
Gemin8 |
gem (nuclear organelle) associated protein 8 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GEMIN8 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:28,259,806...28,278,641
Ensembl chr X:28,259,793...28,278,663
|
|
G |
Gfpt1 |
glutamine fructose-6-phosphate transaminase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GFPT1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:119,496,691...119,546,472
Ensembl chr 4:119,496,714...119,546,471
|
|
G |
Gjb3 |
gap junction protein, beta 3 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of GJB3 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 5:139,649,227...139,654,970
Ensembl chr 5:139,649,195...139,654,980
|
|
G |
Gli1 |
GLI family zinc finger 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GLI1 mRNA |
CTD |
PMID:29367455 |
|
NCBI chr 7:63,156,926...63,169,579
Ensembl chr 7:63,156,926...63,169,251
|
|
G |
Glis3 |
GLIS family zinc finger 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GLIS3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:225,976,029...226,395,849
Ensembl chr 1:225,976,326...226,395,899
|
|
G |
Glmp |
glycosylated lysosomal membrane protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GLMP mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:173,794,273...173,797,863
Ensembl chr 2:173,794,255...173,799,960
|
|
G |
Glrx |
glutaredoxin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GLRX mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:5,341,873...5,351,686
Ensembl chr 2:5,341,885...5,351,680
|
|
G |
Glrx2 |
glutaredoxin 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GLRX2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:55,481,875...55,504,737
Ensembl chr13:55,482,694...55,492,831
|
|
G |
Glud1 |
glutamate dehydrogenase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GLUD1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:9,640,312...9,673,961
Ensembl chr16:9,640,312...9,673,957
|
|
G |
Glul |
glutamate-ammonia ligase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GLUL mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:65,969,053...66,035,121
Ensembl chr13:66,025,630...66,035,108
|
|
G |
Gmppa |
GDP-mannose pyrophosphorylase A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GMPPA mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:76,926,724...76,934,274
Ensembl chr 9:76,926,739...76,934,269
|
|
G |
Gmppb |
GDP-mannose pyrophosphorylase B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GMPPB mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:108,737,429...108,740,437
Ensembl chr 8:108,693,060...108,767,286
|
|
G |
Gnal |
G protein subunit alpha L |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GNAL mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:60,622,311...60,762,599
Ensembl chr18:60,622,311...60,762,599
|
|
G |
Gnaq |
G protein subunit alpha q |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GNAQ mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:213,425,631...213,671,947
Ensembl chr 1:213,424,465...213,667,672
|
|
G |
Gnb4 |
G protein subunit beta 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GNB4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:115,360,746...115,400,680
Ensembl chr 2:115,364,918...115,400,579
|
|
G |
Gnmt |
glycine N-methyltransferase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GNMT mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:14,254,675...14,258,028
Ensembl chr 9:14,254,675...14,258,434
|
|
G |
Golga2 |
golgin A2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GOLGA2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:15,583,862...15,604,279
Ensembl chr 3:15,584,039...15,604,279
|
|
G |
Golga4 |
golgin A4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GOLGA4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:118,208,200...118,285,003
|
|
G |
Golgb1 |
golgin B1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GOLGB1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:63,843,179...63,900,665
Ensembl chr11:63,843,986...63,900,770
|
|
G |
Gpc6 |
glypican 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GPC6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:94,030,218...95,027,883
Ensembl chr15:94,029,884...95,024,006
|
|
G |
Gpi |
glucose-6-phosphate isomerase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GPI1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 1:86,828,211...86,856,077
Ensembl chr 1:86,828,216...86,856,086
|
|
G |
Gpm6b |
glycoprotein m6b |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GPM6B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:28,057,788...28,204,409
Ensembl chr X:28,059,450...28,204,211
|
|
G |
Gpr158 |
G protein-coupled receptor 158 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GPR158 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:83,777,625...84,244,428
Ensembl chr17:83,834,569...84,244,428
|
|
G |
Gpr37 |
G protein-coupled receptor 37 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GPR37 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:54,138,860...54,160,927
Ensembl chr 4:54,138,870...54,161,001
|
|
G |
Gpx5 |
glutathione peroxidase 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GPX5 mRNA |
CTD |
PMID:8469239 |
|
NCBI chr17:43,436,126...43,443,074
Ensembl chr17:43,416,340...43,443,074
|
|
G |
Greb1 |
growth regulating estrogen receptor binding 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GREB1 mRNA |
CTD |
PMID:16496412 PMID:29581250 |
|
NCBI chr 6:39,440,522...39,562,364
Ensembl chr 6:39,440,504...39,581,633
|
|
G |
Grhl2 |
grainyhead-like transcription factor 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GRHL2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:68,400,287...68,530,269
Ensembl chr 7:68,400,477...68,530,258
|
|
G |
Grin3a |
glutamate ionotropic receptor NMDA type subunit 3A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GRIN3A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:64,006,847...64,206,408
Ensembl chr 5:64,009,980...64,206,085
|
|
G |
Gsr |
glutathione-disulfide reductase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GSR mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:58,482,209...58,525,256
Ensembl chr16:58,482,505...58,525,661
|
|
G |
Gtf2i |
general transcription factor II I |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GTF2I mRNA |
CTD |
PMID:17023530 |
|
NCBI chr12:22,400,933...22,476,243
Ensembl chr12:22,401,431...22,476,243
|
|
G |
Gucy1a1 |
guanylate cyclase 1 soluble subunit alpha 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of GUCY1A1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:167,418,615...167,482,293
Ensembl chr 2:167,418,640...167,481,671
|
|
G |
Hcfc2 |
host cell factor C2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HCFC2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:20,983,986...21,019,826
Ensembl chr 7:20,991,017...21,019,801
|
|
G |
Hebp2 |
heme binding protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HEBP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:13,194,982...13,201,777
Ensembl chr 1:13,194,982...13,201,777
|
|
G |
Herc3 |
HECT and RLD domain containing E3 ubiquitin protein ligase 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HERC3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:87,952,202...88,042,492
Ensembl chr 4:87,952,274...88,042,488
|
|
G |
Herc6 |
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HERC6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:87,524,470...87,566,895
Ensembl chr 4:87,524,493...87,581,744
|
|
G |
Hes1 |
hes family bHLH transcription factor 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HES1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:70,705,763...70,708,176
Ensembl chr11:70,705,764...70,708,192
|
|
G |
Hey1 |
hes-related family bHLH transcription factor with YRPW motif 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HEY1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:93,096,605...93,100,316
Ensembl chr 2:93,095,498...93,100,312
|
|
G |
Hgd |
homogentisate 1, 2-dioxygenase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HGD mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:63,086,750...63,138,325
Ensembl chr11:63,086,752...63,138,323
|
|
G |
Hipk2 |
homeodomain interacting protein kinase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HIPK2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:67,439,327...67,619,223
Ensembl chr 4:67,440,501...67,619,223
|
|
G |
Hk2 |
hexokinase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HK2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:115,234,509...115,283,530
Ensembl chr 4:115,234,509...115,283,530
|
|
G |
Hm13 |
histocompatibility minor 13 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HM13 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:141,145,792...141,183,557
Ensembl chr 3:141,145,782...141,184,703
|
|
G |
Hmgcr |
3-hydroxy-3-methylglutaryl-CoA reductase |
increases expression decreases expression |
ISO |
Dihydrotestosterone results in increased expression of HMGCR mRNA Dihydrotestosterone results in decreased expression of HMGCR mRNA |
CTD |
PMID:29367455 PMID:29581250 |
|
NCBI chr 2:27,997,523...28,018,983
Ensembl chr 2:27,997,525...28,019,703
|
|
G |
Hmgcs1 |
3-hydroxy-3-methylglutaryl-CoA synthase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HMGCS1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:51,649,368...51,667,100
Ensembl chr 2:51,649,497...51,667,100
|
|
G |
Hmgn1 |
high mobility group nucleosome binding domain 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HMGN1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr11:35,422,328...35,428,247
Ensembl chr11:35,422,328...35,428,254
|
|
G |
Hmgxb3 |
HMG-box containing 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HMGXB3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:54,590,558...54,638,050
Ensembl chr18:54,590,560...54,638,155
|
|
G |
Homer2 |
homer scaffold protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HOMER2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:135,558,977...135,659,780
Ensembl chr 1:135,567,414...135,659,772
|
|
G |
Hoxb2 |
homeobox B2 |
increases expression |
EXP |
Dihydrotestosterone results in increased expression of HOXB2 protein alternative form |
CTD |
PMID:17494099 |
|
NCBI chr10:81,317,828...81,320,220
Ensembl chr10:81,318,026...81,320,192
|
|
G |
Hoxd11 |
homeobox D11 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HOXD11 mRNA |
CTD |
PMID:17254854 |
|
NCBI chr 3:59,584,840...59,587,257
Ensembl chr 3:59,585,039...59,586,783
|
|
G |
Hs3st1 |
heparan sulfate-glucosamine 3-sulfotransferase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HS3ST1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:71,185,826...71,223,263
Ensembl chr14:71,185,682...71,223,248
|
|
G |
Hsd17b1 |
hydroxysteroid (17-beta) dehydrogenase 1 |
decreases expression |
EXP |
Dihydrotestosterone results in decreased expression of HSD17B1 mRNA |
CTD |
PMID:22948218 |
|
NCBI chr10:86,009,728...86,011,928
Ensembl chr10:86,009,728...86,011,927
|
|
G |
Hsd17b11 |
hydroxysteroid (17-beta) dehydrogenase 11 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HSD17B11 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:5,693,304...5,743,157
Ensembl chr14:5,711,964...5,743,161
|
|
G |
Hsd17b3 |
hydroxysteroid (17-beta) dehydrogenase 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HSD17B3 mRNA |
CTD |
PMID:29556062 |
|
NCBI chr17:1,027,229...1,058,554
Ensembl chr17:1,027,229...1,058,554
|
|
G |
Hsd17b7 |
hydroxysteroid (17-beta) dehydrogenase 7 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Androgens deficiency results in increased expression of HSD17B7 mRNA] |
CTD |
PMID:29367455 |
|
NCBI chr13:82,170,079...82,190,018
Ensembl chr13:82,173,179...82,190,017
|
|
G |
Hsd3b1 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 1 |
decreases expression |
EXP |
Dihydrotestosterone results in decreased expression of HSD3B1 mRNA |
CTD |
PMID:22948218 |
|
NCBI chr 2:186,169,864...186,175,984
Ensembl chr 2:186,169,863...186,175,999
|
|
G |
Hsd3b2 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HSD3B2 mRNA |
CTD |
PMID:29556062 |
|
NCBI chr 2:186,095,897...186,105,354
Ensembl chr 2:186,095,897...186,101,852
|
|
G |
Hsp90ab1 |
heat shock protein 90 alpha family class B member 1 |
increases expression decreases expression |
ISO |
Dihydrotestosterone results in increased expression of HSP90AB1 mRNA Dihydrotestosterone results in decreased expression of HSP90AB1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 9:15,432,986...15,438,358
Ensembl chr 9:15,433,691...15,438,488
|
|
G |
Hsp90b1 |
heat shock protein 90 beta family member 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HSP90B1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:21,110,431...21,124,762
Ensembl chr 7:21,110,457...21,124,788
|
|
G |
Hspa13 |
heat shock protein family A (Hsp70) member 13 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HSPA13 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:14,375,669...14,389,853
Ensembl chr11:14,373,275...14,389,895
|
|
G |
Hspa2 |
heat shock protein family A (Hsp70) member 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HSPA2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:95,128,504...95,131,281
Ensembl chr 6:95,128,350...95,131,287
|
|
G |
Hspa5 |
heat shock protein family A (Hsp70) member 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HSPA5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:18,055,507...18,059,969
Ensembl chr 3:18,055,405...18,059,891
|
|
G |
Hyou1 |
hypoxia up-regulated 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of HYOU1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:44,706,073...44,718,189
Ensembl chr 8:44,706,263...44,718,186
|
|
G |
Icam1 |
intercellular adhesion molecule 1 |
multiple interactions |
ISO |
bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of ICAM1 mRNA]]; bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of ICAM1 mRNA]]; Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of ICAM1 mRNA]; Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of ICAM1 protein]; Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of ICAM1 mRNA]; Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of ICAM1 protein] |
CTD |
PMID:16317058 |
|
NCBI chr 8:19,553,063...19,565,438
Ensembl chr 8:19,553,645...19,565,438
|
|
G |
Id1 |
inhibitor of DNA binding 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ID1 mRNA |
CTD |
PMID:16541417 |
|
NCBI chr 3:141,210,666...141,212,420
Ensembl chr 3:141,211,267...141,212,419
|
|
G |
Id2 |
inhibitor of DNA binding 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ID2 mRNA |
CTD |
PMID:16541417 |
|
NCBI chr 6:41,740,556...41,742,393
Ensembl chr 6:41,728,946...41,744,400
|
|
G |
Id3 |
inhibitor of DNA binding 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ID3 mRNA |
CTD |
PMID:16541417 |
|
NCBI chr 5:148,372,784...148,374,353
Ensembl chr 5:148,372,762...148,374,349
|
|
G |
Id4 |
inhibitor of DNA binding 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ID4 mRNA |
CTD |
PMID:16541417 |
|
NCBI chr17:16,389,387...16,391,956
Ensembl chr17:16,389,387...16,392,470
|
|
G |
Idi1 |
isopentenyl-diphosphate delta isomerase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IDI1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:61,629,592...61,637,357
Ensembl chr17:61,629,594...61,637,357
|
|
G |
Ift57 |
intraflagellar transport 57 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IFT57 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:51,051,520...51,124,909
Ensembl chr11:51,059,611...51,124,812
|
|
G |
Igf1 |
insulin-like growth factor 1 |
multiple interactions increases secretion decreases expression increases expression |
ISO EXP |
bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of IGF1 mRNA]; Flutamide inhibits the reaction [Dihydrotestosterone results in increased expression of IGF1 mRNA] resveratrol inhibits the reaction [Dihydrotestosterone results in increased secretion of IGF1 protein] Dihydrotestosterone results in decreased expression of IGF1 mRNA |
CTD |
PMID:16368782 PMID:17023530 PMID:25667201 PMID:29581250 PMID:36822333 |
|
NCBI chr 7:22,282,895...22,361,972
Ensembl chr 7:22,282,930...22,359,296
|
|
G |
Igf1r |
insulin-like growth factor 1 receptor |
multiple interactions decreases expression increases expression |
ISO EXP |
Masoprocol inhibits the reaction [Dihydrotestosterone results in increased expression of IGF1R mRNA]; Masoprocol inhibits the reaction [Dihydrotestosterone results in increased expression of IGF1R protein] nilutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of IGF1R protein] Dihydrotestosterone results in increased expression of IGF1R mRNA; Dihydrotestosterone results in increased expression of IGF1R protein |
CTD |
PMID:10650946 PMID:18491370 PMID:29581250 |
|
NCBI chr 1:121,549,831...121,838,548
Ensembl chr 1:121,550,743...121,831,777
|
|
G |
Igfbp1 |
insulin-like growth factor binding protein 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IGFBP1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:82,047,415...82,052,482
Ensembl chr14:82,047,415...82,052,482
|
|
G |
Igfbp2 |
insulin-like growth factor binding protein 2 |
multiple interactions increases expression |
ISO |
bicalutamide promotes the reaction [Dihydrotestosterone results in increased expression of IGFBP2 mRNA]; Flutamide inhibits the reaction [Dihydrotestosterone results in increased expression of IGFBP2 mRNA] |
CTD |
PMID:16368782 |
|
NCBI chr 9:74,415,574...74,442,945
Ensembl chr 9:74,415,546...74,442,937
|
|
G |
Igfbp3 |
insulin-like growth factor binding protein 3 |
decreases expression increases expression decreases secretion |
ISO |
Dihydrotestosterone results in decreased expression of IGFBP3 mRNA Dihydrotestosterone results in increased expression of IGFBP3 mRNA Dihydrotestosterone results in decreased secretion of IGFBP3 protein |
CTD |
PMID:16368782 PMID:16825320 |
|
NCBI chr14:82,056,347...82,064,083
Ensembl chr14:82,056,347...82,064,083
|
|
G |
Igfbp6 |
insulin-like growth factor binding protein 6 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of IGFBP6 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 7:133,276,309...133,280,944
Ensembl chr 7:133,276,234...133,280,966
|
|
G |
Ighl16 |
immunoglobulin heavy chain like 16 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IGHV3OR16-13 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:134,212,480...134,234,464
|
|
G |
Il1r1 |
interleukin 1 receptor type 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IL1R1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:42,504,917...42,580,958
Ensembl chr 9:42,504,735...42,579,937
|
|
G |
Il20ra |
interleukin 20 receptor subunit alpha |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IL20RA mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:14,424,215...14,494,226
Ensembl chr 1:14,451,228...14,493,602
|
|
G |
Il25 |
interleukin 25 |
multiple interactions |
ISO |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of IL25 protein]]; Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of IL25 protein] |
CTD |
PMID:35982617 |
|
NCBI chr15:28,408,766...28,412,157
Ensembl chr15:28,408,842...28,411,893
|
|
G |
Il33 |
interleukin 33 |
multiple interactions |
EXP ISO |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of IL33 protein]]; Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of IL33 protein] 1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of IL33 protein]]; Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of IL33 protein] |
CTD |
PMID:35982617 |
|
NCBI chr 1:227,701,964...227,736,374
Ensembl chr 1:227,721,435...227,736,373
|
|
G |
Il4 |
interleukin 4 |
multiple interactions |
EXP |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of IL4 protein]]; Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of IL4 protein] |
CTD |
PMID:35982617 |
|
NCBI chr10:37,771,203...37,776,750
Ensembl chr10:37,771,203...37,776,750
|
|
G |
Il5 |
interleukin 5 |
multiple interactions |
EXP |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of IL5 protein]]; Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of IL5 protein] |
CTD |
PMID:35982617 |
|
NCBI chr10:37,874,342...37,877,213
Ensembl chr10:37,874,342...37,877,213
|
|
G |
Il6 |
interleukin 6 |
multiple interactions decreases expression |
ISO |
AR protein affects the reaction [Dihydrotestosterone inhibits the reaction [BCG Vaccine results in increased expression of IL6 mRNA]]; bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [BCG Vaccine results in increased expression of IL6 mRNA]]; bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of IL6 mRNA]]; bicalutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of IL6 mRNA]]; Dihydrotestosterone inhibits the reaction [BCG Vaccine results in increased expression of IL6 mRNA]; Dihydrotestosterone inhibits the reaction [Lipopolysaccharides results in increased expression of IL6 mRNA]; Dihydrotestosterone inhibits the reaction [TNF protein results in increased expression of IL6 mRNA]; Dihydrotestosterone inhibits the reaction [TNF protein results in increased secretion of IL6 protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [BCG Vaccine results in increased expression of IL6 mRNA]] Dihydrotestosterone inhibits the reaction [lipopolysaccharide, Escherichia coli O111 B4 results in increased secretion of IL6 protein]; Flutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [lipopolysaccharide, Escherichia coli O111 B4 results in increased secretion of IL6 protein]] Dihydrotestosterone results in decreased expression of IL6 mRNA |
CTD |
PMID:14532843 PMID:15953861 PMID:16317058 PMID:31416231 |
|
NCBI chr 4:5,214,602...5,219,178
Ensembl chr 4:5,213,394...5,219,178
|
|
G |
Il6r |
interleukin 6 receptor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IL6R mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:175,289,157...175,347,719
Ensembl chr 2:175,298,686...175,347,536
|
|
G |
Il7 |
interleukin 7 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IL7 mRNA |
CTD |
PMID:15953861 |
|
NCBI chr 2:94,235,219...94,280,075
Ensembl chr 2:94,234,766...94,280,075
|
|
G |
Inpp4b |
inositol polyphosphate-4-phosphatase type II B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of INPP4B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:25,920,189...26,670,085
Ensembl chr19:25,925,358...26,280,634
|
|
G |
Insig1 |
insulin induced gene 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of INSIG1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:7,315,494...7,323,972
Ensembl chr 4:7,315,495...7,323,952
|
|
G |
Ints10 |
integrator complex subunit 10 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of INTS10 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:20,915,223...20,947,146
Ensembl chr16:20,916,082...20,967,610
|
|
G |
Ints4 |
integrator complex subunit 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of INTS4 mRNA |
CTD |
PMID:17254854 |
|
NCBI chr 1:151,790,062...151,853,827
Ensembl chr 1:151,786,553...151,853,827
|
|
G |
Iqcb1 |
IQ motif containing B1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IQCB1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:63,905,595...63,960,141
Ensembl chr11:63,905,590...63,960,093
|
|
G |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IQGAP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:26,894,836...27,170,270
Ensembl chr 2:26,894,825...27,170,279
|
|
G |
Irs2 |
insulin receptor substrate 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IRS2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:78,488,249...78,512,482
Ensembl chr16:78,485,045...78,512,482
|
|
G |
Itga9 |
integrin subunit alpha 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ITGA9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:118,307,424...118,615,527
Ensembl chr 8:118,307,381...118,613,754
|
|
G |
Itgav |
integrin subunit alpha V |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ITGAV mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:68,838,514...68,926,653
Ensembl chr 3:68,838,189...68,926,639
|
|
G |
Itgb1 |
integrin subunit beta 1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of ITGB1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr19:56,705,123...56,753,199
Ensembl chr19:56,705,171...56,753,195
|
|
G |
Ivns1abp |
influenza virus NS1A binding protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of IVNS1ABP mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:63,427,040...63,446,701
Ensembl chr13:63,427,041...63,446,701
|
|
G |
Jmjd6 |
jumonji domain containing 6, arginine demethylase and lysine hydroxylase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of JMJD6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:102,041,131...102,047,182
Ensembl chr10:102,041,120...102,047,182
|
|
G |
Kcnk1 |
potassium two pore domain channel subfamily K member 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KCNK1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:53,959,411...53,997,726
Ensembl chr19:53,959,657...53,997,724
|
|
G |
Kcnma1 |
potassium calcium-activated channel subfamily M alpha 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KCNMA1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:302,480...1,007,675
Ensembl chr15:302,214...1,001,198
|
|
G |
Kcnn2 |
potassium calcium-activated channel subfamily N member 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KCNN2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:37,817,966...38,258,347
Ensembl chr18:37,817,957...38,258,347
|
|
G |
Kcnrg |
potassium channel regulator |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KCNRG mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:35,774,456...35,779,409
Ensembl chr15:35,774,326...35,779,415
|
|
G |
Kctd3 |
potassium channel tetramerization domain containing 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KCTD3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:100,510,193...100,548,765
Ensembl chr13:100,510,195...100,548,718
|
|
G |
Kctd9 |
potassium channel tetramerization domain containing 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KCTD9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:41,942,165...41,969,862
Ensembl chr15:41,942,381...41,969,862
|
|
G |
Kdelr2 |
KDEL endoplasmic reticulum protein retention receptor 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KDELR2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:11,138,820...11,157,117
Ensembl chr12:11,138,820...11,157,153
|
|
G |
Kdelr3 |
KDEL endoplasmic reticulum protein retention receptor 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KDELR3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:111,079,236...111,089,463
Ensembl chr 7:111,079,218...111,101,600
|
|
G |
Kdm4b |
lysine demethylase 4B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KDM4B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:1,158,737...1,237,233
Ensembl chr 9:1,158,752...1,236,543
|
|
G |
Kif13b |
kinesin family member 13B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KIF13B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:38,908,257...39,066,021
Ensembl chr15:38,924,624...39,084,879
|
|
G |
Kif22 |
kinesin family member 22 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KIF22 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:181,635,347...181,650,351
Ensembl chr 1:181,635,183...181,650,401
|
|
G |
Kif5c |
kinesin family member 5C |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KIF5C mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:34,032,082...34,185,597
Ensembl chr 3:34,032,105...34,182,413
|
|
G |
Kitlg |
KIT ligand |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KITLG mRNA; Dihydrotestosterone results in increased expression of KITLG protein |
CTD |
PMID:15953861 |
|
NCBI chr 7:34,896,075...34,977,215
Ensembl chr 7:34,896,053...34,977,214
|
|
G |
Kl |
Klotho |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KL mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:490,402...531,417
Ensembl chr12:490,399...530,080
|
|
G |
Klf15 |
KLF transcription factor 15 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLF15 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:122,965,718...122,978,403
Ensembl chr 4:122,965,807...122,978,374
|
|
G |
Klf3 |
KLF transcription factor 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLF3 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr14:43,474,767...43,505,801
Ensembl chr14:43,474,767...43,497,209
|
|
G |
Klf4 |
KLF transcription factor 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLF4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:70,278,843...70,283,751
Ensembl chr 5:70,278,972...70,283,602
|
|
G |
Klf5 |
KLF transcription factor 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLF5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:76,060,320...76,079,445
Ensembl chr15:76,064,258...76,079,445
|
|
G |
Klhl29 |
kelch-like family member 29 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLHL29 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:28,086,489...28,390,647
Ensembl chr 6:28,086,489...28,390,647
|
|
G |
Klk15 |
kallikrein-related peptidase 15 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLK15 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:94,699,422...94,706,626
Ensembl chr 1:94,703,158...94,706,329 Ensembl chr 1:94,703,158...94,706,329
|
|
G |
Klk1c10 |
kallikrein 1-related peptidase C10 |
decreases expression multiple interactions affects binding increases secretion increases expression |
ISO |
Dihydrotestosterone results in decreased expression of KLK3 mRNA 2,3-dibromopropyl-2,4,6-tribromophenyl ether analog inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; 2,3-dibromopropyl-2,4,6-tribromophenyl ether inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; 2,3-dibromopropyl-2,4,6-tribromophenyl ether inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; 2-(((3,5-dichlorophenyl)carbamoyl)oxy)-2-methyl-3-butenoic acid inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; 2-(((3,5-dichlorophenyl)carbamoyl)oxy)-2-methyl-3-butenoic acid inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein]; 2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; 3',5'-dichloro-2-hydroxy-2-methylbut-3-enanilide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; 3',5'-dichloro-2-hydroxy-2-methylbut-3-enanilide inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein]; 4-androstene-3,17-diol inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(6-methylpyridin-2-yl)nicotinamide analog inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; [Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein; [Dihydrotestosterone co-treated with AR protein] results in increased expression of KLK3 mRNA; allyl 2,4,6-tribromophenyl ether inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; alpha-naphthoflavone inhibits the reaction [Benzo(a)pyrene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]]; alpha-naphthoflavone inhibits the reaction [Benzo(a)pyrene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]]; alpha-naphthoflavone inhibits the reaction [benzo(k)fluoranthene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]]; alpha-naphthoflavone inhibits the reaction [benzo(k)fluoranthene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]]; alpha-naphthoflavone inhibits the reaction [chrysene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]]; alpha-naphthoflavone inhibits the reaction [chrysene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]]; alpha-terthienyl inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Androstenedione inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; angelicae sinensis extract inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; AR protein affects the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; AR protein alternative form promotes the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Benomyl inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein]; Benzo(a)pyrene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Benzo(a)pyrene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; benzo(k)fluoranthene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; benzo(k)fluoranthene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; bicalutamide inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; bicalutamide inhibits the reaction [AR protein alternative form promotes the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein]; Capsaicin inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Capsaicin inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; chrysene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; chrysene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 enhancer]]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [CREBBP protein binds to KLK3 enhancer]]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [EP300 protein binds to KLK3 enhancer]]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [FOXA1 protein binds to KLK3 enhancer]]; Curcumin inhibits the reaction [Dihydrotestosterone promotes the reaction [GATA2 protein binds to KLK3 enhancer]]; Cyproterone Acetate inhibits the reaction [[Dihydrotestosterone binds to and results in increased activity of AR protein] which results in increased expression of KLK3 protein]; Dihydrotestosterone inhibits the reaction [NCOR1 protein binds to KLK3 promoter]; Dihydrotestosterone inhibits the reaction [NCOR2 protein binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [[MAK protein binds to AR protein] which binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [Calcitriol results in increased secretion of KLK3 protein]; Dihydrotestosterone promotes the reaction [CREBBP protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [EP300 protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [EP300 protein binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [FOXA1 protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [GATA2 protein binds to KLK3 enhancer]; Dihydrotestosterone promotes the reaction [NCOA1 protein binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [NCOA2 protein binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [SMARCA2 protein binds to KLK3 promoter]; Etoposide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; fisetin inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; Flutamide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Fulvestrant inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Fulvestrant inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; hydroxyflutamide inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein]; merbarone inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; methylselenic acid inhibits the reaction [Dihydrotestosterone inhibits the reaction [NCOR1 protein binds to KLK3 promoter]]; methylselenic acid inhibits the reaction [Dihydrotestosterone inhibits the reaction [NCOR2 protein binds to KLK3 promoter]]; methylselenic acid inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to KLK3 promoter]]; methylselenic acid inhibits the reaction [Dihydrotestosterone promotes the reaction [NCOA1 protein binds to KLK3 promoter]]; methylselenic acid inhibits the reaction [Dihydrotestosterone promotes the reaction [NCOA2 protein binds to KLK3 promoter]]; Niclosamide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Nocodazole inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Paclitaxel inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; palbociclib promotes the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; PHB1 protein promotes the reaction [bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]]; phenothiazine analog affects the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; Proadifen promotes the reaction [Benzo(a)pyrene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]]; Proadifen promotes the reaction [benzo(k)fluoranthene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]]; Proadifen promotes the reaction [chrysene inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]]; prochloraz inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein]; Promensil inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; Tocopherols inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; Tocopherols inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 protein]; TOP2B protein promotes the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; vinclozolin inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; vinclozolin inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein]; vinclozolin metabolite inhibits the reaction [Dihydrotestosterone results in increased expression of KLK3 mRNA]; vinclozolin metabolite inhibits the reaction [Dihydrotestosterone results in increased secretion of KLK3 protein] Dihydrotestosterone binds to KLK3 protein mutant form Dihydrotestosterone results in increased expression of KLK3 mRNA; Dihydrotestosterone results in increased expression of KLK3 protein |
CTD |
PMID:9231780 PMID:11580929 PMID:12032296 PMID:12391264 PMID:12711008 PMID:12799773 PMID:15336702 PMID:15950459 PMID:15994348 PMID:16140617 PMID:16540674 PMID:16648561 PMID:16951154 PMID:17075824 PMID:17131305 PMID:17503469 PMID:17606915 PMID:17624924 PMID:18007998 PMID:18487222 PMID:18922931 PMID:20363314 PMID:20601956 PMID:20807808 PMID:21111724 PMID:22258452 PMID:23405127 PMID:23708653 PMID:24740322 PMID:25324206 PMID:25369342 PMID:25454221 PMID:25846647 PMID:27473015 PMID:27720946 PMID:28500234 PMID:28757136 PMID:28916285 PMID:29556062 PMID:29581250 PMID:33932781 PMID:35595151 PMID:35691152 PMID:37019376 More...
|
|
NCBI chr 1:94,402,993...94,407,052
Ensembl chr 1:94,402,993...94,407,052
|
|
G |
Klk4 |
kallikrein-related peptidase 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLK4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:94,344,195...94,349,425
Ensembl chr 1:94,344,195...94,349,424
|
|
G |
Klk7 |
kallikrein-related peptidase 7 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KLK7 mRNA |
CTD |
PMID:17254854 |
|
NCBI chr 1:94,267,170...94,271,361
Ensembl chr 1:94,266,605...94,271,332
|
|
G |
Krt18 |
keratin 18 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KRT18 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:133,157,486...133,161,162
Ensembl chr 7:133,157,475...133,161,166
|
|
G |
Krt19 |
keratin 19 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KRT19 mRNA |
CTD |
PMID:17023530 PMID:29581250 |
|
NCBI chr10:85,075,835...85,080,552
Ensembl chr10:85,066,802...85,171,799
|
|
G |
Krt73 |
keratin 73 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KRT73 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:132,927,812...132,936,323
Ensembl chr 7:132,928,256...132,936,280
|
|
G |
Krt8 |
keratin 8 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of KRT8 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:133,124,203...133,131,656
Ensembl chr 7:133,124,203...133,131,728
|
|
G |
L3mbtl3 |
L3MBTL histone methyl-lysine binding protein 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of L3MBTL3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:18,988,763...19,089,247
Ensembl chr 1:18,990,618...19,089,263
|
|
G |
Lama1 |
laminin subunit alpha 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LAMA1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:107,692,770...107,816,847
Ensembl chr 9:107,692,770...107,817,478
|
|
G |
Lama3 |
laminin subunit alpha 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LAMA3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:3,523,168...3,751,722
Ensembl chr18:3,523,133...3,751,353
|
|
G |
Lama5 |
laminin subunit alpha 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LAMA5 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 3:167,270,296...167,318,370
Ensembl chr 3:167,270,296...167,318,451
|
|
G |
Lamc1 |
laminin subunit gamma 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LAMC1 mRNA |
CTD |
PMID:18007998 PMID:29581250 |
|
NCBI chr13:65,374,372...65,501,492
Ensembl chr13:65,374,372...65,501,492
|
|
G |
Larp1b |
La ribonucleoprotein 1B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LARP1B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:123,936,057...123,969,254
Ensembl chr 2:123,935,983...123,968,896
|
|
G |
Lck |
LCK proto-oncogene, Src family tyrosine kinase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LCK mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:141,888,318...141,916,945
Ensembl chr 5:141,888,326...141,903,794
|
|
G |
Lcp1 |
lymphocyte cytosolic protein 1 |
multiple interactions increases expression |
ISO |
AR protein affects the reaction [Dihydrotestosterone results in increased expression of LCP1 mRNA] |
CTD |
PMID:27473015 PMID:29556062 PMID:29581250 |
|
NCBI chr15:50,443,300...50,544,682
Ensembl chr15:50,488,149...50,544,680
|
|
G |
Ldlr |
low density lipoprotein receptor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LDLR mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:20,270,020...20,292,981
Ensembl chr 8:20,270,041...20,294,580
|
|
G |
Ldlrad3 |
low density lipoprotein receptor class A domain containing 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LDLRAD3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:88,239,529...88,481,340
Ensembl chr 3:88,239,622...88,481,267
|
|
G |
Lef1 |
lymphoid enhancer binding factor 1 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Androgens deficiency results in decreased expression of LEF1 mRNA] |
CTD |
PMID:29367455 |
|
NCBI chr 2:219,666,549...219,779,815
Ensembl chr 2:219,666,592...219,779,794
|
|
G |
Lep |
leptin |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of LEP mRNA |
CTD |
PMID:18801408 |
|
NCBI chr 4:57,661,127...57,675,262
Ensembl chr 4:57,661,131...57,675,262
|
|
G |
Lgr4 |
leucine-rich repeat-containing G protein-coupled receptor 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LGR4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:96,447,385...96,550,006
Ensembl chr 3:96,447,858...96,548,899
|
|
G |
Lhb |
luteinizing hormone subunit beta |
multiple interactions decreases expression |
ISO |
[FSHB protein co-treated with LHB protein co-treated with CGB3 protein] results in increased abundance of Dihydrotestosterone Dihydrotestosterone results in decreased expression of LHB protein |
CTD |
PMID:8263139 PMID:10709760 |
|
NCBI chr 1:95,898,269...95,901,973
Ensembl chr 1:95,900,984...95,901,972 Ensembl chr 1:95,900,984...95,901,972
|
|
G |
Lifr |
LIF receptor subunit alpha |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LIFR mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:56,224,393...56,292,988
Ensembl chr 2:56,250,120...56,286,699
|
|
G |
Lin7b |
lin-7 homolog B, crumbs cell polarity complex component |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LIN7B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:95,846,888...95,849,628
Ensembl chr 1:95,846,243...95,849,977
|
|
G |
Lman1 |
lectin, mannose-binding, 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LMAN1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:59,508,996...59,530,873
Ensembl chr18:59,508,996...59,530,851
|
|
G |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LONRF1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:55,984,572...56,015,156
Ensembl chr16:55,984,463...56,015,156
|
|
G |
Lox |
lysyl oxidase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LOX mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:45,964,544...45,977,431
Ensembl chr18:45,967,343...46,041,477
|
|
G |
Lpar3 |
lysophosphatidic acid receptor 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LPAR3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:235,125,234...235,193,916
Ensembl chr 2:235,149,065...235,193,357
|
|
G |
Lpl |
lipoprotein lipase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LPL mRNA |
CTD |
PMID:16990341 |
|
NCBI chr16:20,830,055...20,853,855
Ensembl chr16:20,829,465...20,855,249
|
|
G |
Lpxn |
leupaxin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LPXN mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:209,928,297...209,963,085
Ensembl chr 1:209,929,202...209,963,084
|
|
G |
Lrch1 |
leucine rich repeats and calponin homology domain containing 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LRCH1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:50,070,605...50,249,724
Ensembl chr15:50,071,947...50,249,657
|
|
G |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LRIG1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:127,130,899...127,230,956
Ensembl chr 4:127,130,898...127,231,513
|
|
G |
Lrp4 |
LDL receptor related protein 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LRP4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:77,429,600...77,483,593
Ensembl chr 3:77,429,798...77,483,593
|
|
G |
Lrp5 |
LDL receptor related protein 5 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Androgens deficiency results in decreased expression of LRP5 mRNA] |
CTD |
PMID:29367455 |
|
NCBI chr 1:200,814,247...200,917,581
Ensembl chr 1:200,814,250...200,917,581
|
|
G |
Lrrc28 |
leucine rich repeat containing 28 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LRRC28 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr 1:121,116,833...121,245,805
Ensembl chr 1:121,127,733...121,245,784
|
|
G |
Lrrc59 |
leucine rich repeat containing 59 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LRRC59 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:79,572,295...79,586,953
Ensembl chr10:79,572,317...79,602,533
|
|
G |
Lrrc8a |
leucine rich repeat containing 8 VRAC subunit A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LRRC8A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:13,509,577...13,537,174
Ensembl chr 3:13,510,513...13,536,202
|
|
G |
Lrrfip2 |
LRR binding FLII interacting protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of LRRFIP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:111,091,453...111,193,947
Ensembl chr 8:111,091,503...111,193,255
|
|
G |
Maf |
MAF bZIP transcription factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAF mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:43,353,867...43,713,162
Ensembl chr19:43,360,342...43,712,365
|
|
G |
Mafb |
MAF bZIP transcription factor B |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of MAFB mRNA; Dihydrotestosterone results in increased expression of MAFB protein Fenitrothion inhibits the reaction [Dihydrotestosterone results in increased expression of MAFB mRNA]; Fenitrothion inhibits the reaction [Dihydrotestosterone results in increased expression of MAFB protein] |
CTD |
PMID:35951760 |
|
NCBI chr 3:148,998,111...149,000,031
Ensembl chr 3:148,998,122...149,000,031
|
|
G |
Mak |
male germ cell-associated kinase |
multiple interactions increases expression |
ISO |
Dihydrotestosterone promotes the reaction [[MAK protein binds to AR protein] which binds to KLK3 promoter]; Dihydrotestosterone promotes the reaction [MAK protein binds to and results in increased activity of AR protein] Dihydrotestosterone results in increased expression of MAK mRNA; Dihydrotestosterone results in increased expression of MAK protein |
CTD |
PMID:16951154 PMID:29581250 |
|
NCBI chr17:23,683,753...23,731,125
Ensembl chr17:23,693,878...23,730,001
|
|
G |
Malt1 |
MALT1 paracaspase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MALT1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:58,942,282...58,996,318
Ensembl chr18:58,942,299...58,994,260
|
|
G |
Maml3 |
mastermind-like transcriptional coactivator 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAML3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:135,720,431...136,137,829
Ensembl chr 2:135,721,021...136,137,814
|
|
G |
Manf |
mesencephalic astrocyte-derived neurotrophic factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MANF mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:107,500,856...107,551,595
Ensembl chr 8:107,548,352...107,551,438
|
|
G |
Map2 |
microtubule-associated protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:67,723,422...67,981,886
Ensembl chr 9:67,723,371...67,979,809
|
|
G |
Map2k1 |
mitogen activated protein kinase kinase 1 |
multiple interactions |
ISO |
2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAP2K1 protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAP2K1 protein]; Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAP2K1 protein |
CTD |
PMID:15466214 |
|
NCBI chr 8:64,683,449...64,754,900
Ensembl chr 8:64,683,449...64,755,147
|
|
G |
Map2k2 |
mitogen activated protein kinase kinase 2 |
multiple interactions |
ISO EXP |
2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAP2K2 protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAP2K2 protein]; Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAP2K2 protein 1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of MAP2K2 protein]]; Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of MAP2K2 protein] |
CTD |
PMID:15466214 PMID:35982617 |
|
NCBI chr 7:8,590,729...8,610,279
Ensembl chr 7:8,580,905...8,610,243
|
|
G |
Map2k4 |
mitogen activated protein kinase kinase 4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAP2K4 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:50,343,227...50,447,956
Ensembl chr10:50,344,915...50,447,993
|
|
G |
Map3k6 |
mitogen-activated protein kinase kinase kinase 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAP3K6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:145,440,126...145,452,213
Ensembl chr 5:145,440,346...145,452,212
|
|
G |
Map7 |
microtubule-associated protein 7 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAP7 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:14,910,433...15,037,574
Ensembl chr 1:14,910,551...15,037,574
|
|
G |
Map7d1 |
MAP7 domain containing 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAP7D1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:138,527,944...138,552,537
Ensembl chr 5:138,527,401...138,552,499
|
|
G |
Map9 |
microtubule-associated protein 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAP9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:167,708,661...167,743,927
Ensembl chr 2:167,708,765...167,740,736
|
|
G |
Mapk1 |
mitogen activated protein kinase 1 |
multiple interactions |
ISO EXP |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of MAPK1 protein]]; 2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK1 protein]; [Dihydrotestosterone results in increased activity of AR protein mutant form] which results in increased phosphorylation of MAPK1 protein; AR protein promotes the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK1 protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK1 protein]; Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of MAPK1 protein]; Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK1 protein [cypermethrin results in decreased susceptibility to Dihydrotestosterone] which results in decreased phosphorylation of MAPK1 protein 1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of MAPK1 protein]]; [Dihydrotestosterone co-treated with Glutamic Acid] results in increased phosphorylation of MAPK1 protein; bisphenol A inhibits the reaction [[Dihydrotestosterone co-treated with Glutamic Acid] results in increased phosphorylation of MAPK1 protein]; Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of MAPK1 protein] |
CTD |
PMID:15466214 PMID:18819937 PMID:30707916 PMID:30974244 PMID:35982617 |
|
NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616
|
|
G |
Mapk10 |
mitogen activated protein kinase 10 |
multiple interactions |
ISO |
APOE gene polymorphism affects the reaction [Dihydrotestosterone affects the phosphorylation of MAPK10 protein] |
CTD |
PMID:17395708 |
|
NCBI chr14:6,497,662...6,790,109
Ensembl chr14:6,497,707...6,786,201
|
|
G |
Mapk14 |
mitogen activated protein kinase 14 |
increases expression multiple interactions |
ISO EXP |
Dihydrotestosterone results in increased expression of MAPK14 mRNA Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of MAPK14 protein] 1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of MAPK14 protein]]; Dihydrotestosterone inhibits the reaction [Ovalbumin results in increased expression of MAPK14 protein] |
CTD |
PMID:17023530 PMID:35982617 |
|
NCBI chr20:6,749,646...6,810,590
Ensembl chr20:6,749,670...6,810,589
|
|
G |
Mapk3 |
mitogen activated protein kinase 3 |
multiple interactions |
ISO EXP |
1-hexadecyl-2-acetyl-glycero-3-phosphocholine inhibits the reaction [Dihydrotestosterone inhibits the reaction [TGFB1 protein results in increased expression of MAPK3 protein]]; 2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK3 protein]; [Dihydrotestosterone results in increased activity of AR protein mutant form] which results in increased phosphorylation of MAPK3 protein; AR protein promotes the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK3 protein]; bicalutamide inhibits the reaction [Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK3 protein]; Dihydrotestosterone results in increased phosphorylation of and results in increased activity of MAPK3 protein [cypermethrin results in decreased susceptibility to Dihydrotestosterone] which results in decreased phosphorylation of MAPK3 protein [Dihydrotestosterone co-treated with Glutamic Acid] results in increased phosphorylation of MAPK3 protein; bisphenol A inhibits the reaction [[Dihydrotestosterone co-treated with Glutamic Acid] results in increased phosphorylation of MAPK3 protein] |
CTD |
PMID:15466214 PMID:18819937 PMID:30707916 PMID:30974244 PMID:35982617 |
|
NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
|
|
G |
Mapk6 |
mitogen-activated protein kinase 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MAPK6 mRNA |
CTD |
PMID:16631469 PMID:29581250 |
|
NCBI chr 8:76,146,650...76,169,767
Ensembl chr 8:76,146,690...76,169,720
|
|
G |
Mapk9 |
mitogen-activated protein kinase 9 |
multiple interactions |
ISO |
APOE gene polymorphism affects the reaction [Dihydrotestosterone affects the phosphorylation of MAPK9 protein] |
CTD |
PMID:17395708 |
|
NCBI chr10:34,169,661...34,211,138
Ensembl chr10:34,169,675...34,210,178
|
|
G |
Marcks |
myristoylated alanine rich protein kinase C substrate |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MARCKS mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:40,685,315...40,691,012
Ensembl chr20:40,685,315...40,691,012
|
|
G |
Mboat2 |
membrane bound O-acyltransferase domain containing 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MBOAT2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:41,471,135...41,597,599
Ensembl chr 6:41,471,161...41,593,485
|
|
G |
Mccc2 |
methylcrotonyl-CoA carboxylase subunit 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MCCC2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:31,304,927...31,375,978
Ensembl chr 2:31,304,932...31,375,972
|
|
G |
Mcfd2 |
multiple coagulation factor deficiency 2, ER cargo receptor complex subunit |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MCFD2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:7,274,469...7,285,841
Ensembl chr 6:7,274,469...7,285,841
|
|
G |
Mcm5 |
minichromosome maintenance complex component 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MCM5 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr19:13,483,030...13,504,389
Ensembl chr19:13,483,066...13,504,389
|
|
G |
Me1 |
malic enzyme 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ME1 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr 8:87,549,043...87,660,251
Ensembl chr 8:87,549,043...87,660,304
|
|
G |
Meaf6 |
MYST/Esa1-associated factor 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MEAF6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:137,344,681...137,369,703
Ensembl chr 5:137,344,380...137,370,014
|
|
G |
Med30 |
mediator complex subunit 30 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MED30 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:84,004,735...84,026,474
Ensembl chr 7:84,004,722...84,026,595
|
|
G |
Mef2a |
myocyte enhancer factor 2a |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MEF2A mRNA |
CTD |
PMID:16631469 |
|
NCBI chr 1:120,847,874...120,982,488
Ensembl chr 1:120,850,080...120,981,948
|
|
G |
Mef2c |
myocyte enhancer factor 2C |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MEF2C mRNA |
CTD |
PMID:18007998 |
|
NCBI chr 2:13,973,299...14,136,065
Ensembl chr 2:13,993,438...14,132,880
|
|
G |
Meis1 |
Meis homeobox 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MEIS1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:93,155,426...93,294,373
Ensembl chr14:93,155,419...93,294,265
|
|
G |
Mertk |
MER proto-oncogene, tyrosine kinase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MERTK mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 3:115,939,351...116,045,141
Ensembl chr 3:115,939,351...116,046,554
|
|
G |
Mfsd2a |
MFSD2 lysolipid transporter A, lysophospholipid |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MFSD2A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:135,225,801...135,240,744
Ensembl chr 5:135,225,816...135,240,690
|
|
G |
Mical1 |
microtubule associated monooxygenase, calponin and LIM domain containing 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MICAL1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:44,974,137...44,986,089
Ensembl chr20:44,974,138...44,986,089
|
|
G |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MICAL2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:166,345,853...166,530,575
Ensembl chr 1:166,345,859...166,471,719 Ensembl chr 1:166,345,859...166,471,719
|
|
G |
Micos10 |
mitochondrial contact site and cristae organizing system subunit 10 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MICOS10 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:151,341,124...151,367,403
Ensembl chr 5:151,339,176...151,367,485
|
|
G |
Mif |
macrophage migration inhibitory factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MIF protein |
CTD |
PMID:16751997 |
|
NCBI chr20:12,790,919...12,791,784
Ensembl chr20:12,790,902...12,799,504
|
|
G |
Mir100 |
microRNA 100 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR100 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 8:41,901,225...41,901,304
Ensembl chr 8:41,901,225...41,901,304
|
|
G |
Mir107 |
microRNA 107 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR107 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 1:232,337,767...232,337,853
Ensembl chr 1:232,337,767...232,337,853
|
|
G |
Mir125b2 |
microRNA 125b-2 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR125B2 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr11:16,245,620...16,245,707
|
|
G |
Mir148a |
microRNA 148a |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR148A mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 4:80,333,762...80,333,858
Ensembl chr 4:80,333,762...80,333,858
|
|
G |
Mir15b |
microRNA 15b |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR15B mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 2:153,245,200...153,245,297
Ensembl chr 2:153,245,200...153,245,297
|
|
G |
Mir17 |
microRNA 17 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR17 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr15:92,180,629...92,180,712
Ensembl chr15:92,180,629...92,180,712
|
|
G |
Mir183 |
microRNA 183 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR183 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 4:58,788,614...58,788,723
Ensembl chr 4:58,788,614...58,788,723
|
|
G |
Mir195 |
microRNA 195 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR195 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr10:54,951,838...54,951,924
Ensembl chr10:54,951,838...54,951,924
|
|
G |
Mir200a |
microRNA 200a |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MIR200A mRNA |
CTD |
PMID:23052036 |
|
NCBI chr 5:166,648,494...166,648,582
|
|
G |
Mir200b |
microRNA 200b |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MIR200B mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 5:166,649,272...166,649,366
Ensembl chr 5:166,649,272...166,649,366
|
|
G |
Mir200c |
microRNA 200c |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR200C mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 4:157,523,679...157,523,747
|
|
G |
Mir21 |
microRNA 21 |
multiple interactions increases expression |
ISO |
bicalutamide inhibits the reaction [Dihydrotestosterone results in increased expression of MIR21 mRNA]; Cycloheximide inhibits the reaction [Dihydrotestosterone results in increased expression of MIR21 mRNA]; Dactinomycin inhibits the reaction [Dihydrotestosterone results in increased expression of MIR21 mRNA] |
CTD |
PMID:23052036 PMID:29581250 |
|
NCBI chr10:71,405,257...71,405,348
Ensembl chr10:71,405,257...71,405,348
|
|
G |
Mir22 |
microRNA 22 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MIR22 mRNA |
CTD |
PMID:23052036 |
|
NCBI chr10:60,307,039...60,307,133
Ensembl chr10:60,307,039...60,307,133
|
|
G |
Mir221 |
microRNA 221 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR221 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr X:3,429,465...3,429,573
Ensembl chr X:3,429,465...3,429,573
|
|
G |
Mir23a |
microRNA 23a |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR23A mRNA |
CTD |
PMID:25846647 |
|
NCBI chr19:23,954,997...23,955,071
Ensembl chr19:23,954,997...23,955,071
|
|
G |
Mir23b |
microRNA 23b |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR23B mRNA |
CTD |
PMID:25846647 |
|
NCBI chr17:1,813,667...1,813,763
Ensembl chr17:1,813,667...1,813,763
|
|
G |
Mir25 |
microRNA 25 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR25 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr12:17,042,932...17,043,015
Ensembl chr12:17,042,932...17,043,015
|
|
G |
Mir26b |
microRNA 26b |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR26B mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 9:75,976,596...75,976,680
Ensembl chr 9:75,976,596...75,976,680
|
|
G |
Mir30b |
microRNA 30b |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR30B mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 7:100,132,589...100,132,675
Ensembl chr 7:100,132,589...100,132,675
|
|
G |
Mir374b |
microRNA 374b |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR374B mRNA |
CTD |
PMID:25846647 |
|
NCBI chr X:68,591,732...68,591,799
Ensembl chr X:68,591,732...68,591,799
|
|
G |
Mir425 |
microRNA 425 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR425 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 8:109,264,555...109,264,637
Ensembl chr 8:109,264,555...109,264,637
|
|
G |
Mir494 |
microRNA 494 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MIR494 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 6:128,728,710...128,728,792
Ensembl chr 6:128,728,709...128,728,793
|
|
G |
Mir93 |
microRNA 93 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR93 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr12:17,043,135...17,043,221
Ensembl chr12:17,043,135...17,043,221
|
|
G |
Mir98 |
microRNA 98 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MIR98 mRNA |
CTD |
PMID:25846647 |
|
NCBI chr X:20,981,235...20,981,342
Ensembl chr X:20,981,235...20,981,342
|
|
G |
Mir99a |
microRNA 99a |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIR99A mRNA |
CTD |
PMID:25846647 |
|
NCBI chr11:16,200,443...16,200,523
Ensembl chr11:16,200,443...16,200,523
|
|
G |
Mirlet7b |
microRNA let-7b |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIRLET7B mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 7:116,804,186...116,804,270
Ensembl chr 7:116,804,186...116,804,270
|
|
G |
Mirlet7c1 |
microRNA let-7c-1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIRLET7C mRNA |
CTD |
PMID:25846647 |
|
NCBI chr11:16,201,163...16,201,256
Ensembl chr11:16,201,158...16,201,265
|
|
G |
Mirlet7d |
microRNA let-7d |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIRLET7D mRNA |
CTD |
PMID:25846647 |
|
NCBI chr17:16,115,893...16,115,990
Ensembl chr17:16,115,893...16,115,990
|
|
G |
Mirlet7i |
microRNA let-7i |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MIRLET7I mRNA |
CTD |
PMID:25846647 |
|
NCBI chr 7:58,642,485...58,642,569
Ensembl chr 7:58,642,480...58,642,571
|
|
G |
Mlec |
malectin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MLEC mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:41,458,234...41,468,710
Ensembl chr12:41,458,231...41,468,708
|
|
G |
Mlph |
melanophilin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MLPH mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:91,507,410...91,542,984
Ensembl chr 9:91,507,591...91,542,983
|
|
G |
Mmp1 |
matrix metallopeptidase 1 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Tetradecanoylphorbol Acetate results in increased expression of MMP1 mRNA] |
CTD |
PMID:8798622 |
|
NCBI chr 8:4,658,588...4,679,099
Ensembl chr 8:4,658,588...4,679,097
|
|
G |
Mmp3 |
matrix metallopeptidase 3 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [Tetradecanoylphorbol Acetate results in increased expression of MMP3 mRNA] |
CTD |
PMID:8798622 |
|
NCBI chr 8:4,640,397...4,653,963
Ensembl chr 8:4,640,416...4,653,961
|
|
G |
Mmp7 |
matrix metallopeptidase 7 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MMP7 mRNA |
CTD |
PMID:8798622 |
|
NCBI chr 8:4,848,186...4,855,908
Ensembl chr 8:4,848,186...4,855,902
|
|
G |
Mon1b |
MON1 homolog B, secretory trafficking associated |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MON1B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr19:41,617,372...41,625,347
Ensembl chr19:41,617,364...41,625,347
|
|
G |
Mpc2 |
mitochondrial pyruvate carrier 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MPC2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:77,728,176...77,747,664
Ensembl chr13:77,728,250...77,747,664
|
|
G |
Mphosph9 |
M-phase phosphoprotein 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MPHOSPH9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:32,275,449...32,346,097
Ensembl chr12:32,275,558...32,342,392
|
|
G |
Mpzl1 |
myelin protein zero-like 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MPZL1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr13:77,852,467...77,889,305
Ensembl chr13:77,852,467...77,896,616
|
|
G |
Mrps18a |
mitochondrial ribosomal protein S18A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MRPS18A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:14,853,322...14,869,819
Ensembl chr 9:14,853,291...14,869,835
|
|
G |
Msmb |
microseminoprotein, beta |
increases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of MSMB mRNA AR protein affects the reaction [Dihydrotestosterone results in increased expression of MSMB mRNA] |
CTD |
PMID:25454221 PMID:27473015 PMID:29556062 PMID:33932781 |
|
NCBI chr16:7,366,536...7,387,124
Ensembl chr16:7,366,536...7,387,123
|
|
G |
Msmo1 |
methylsterol monooxygenase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MSMO1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:24,980,680...24,997,927
Ensembl chr16:24,980,697...24,998,016
|
|
G |
Mt2A |
metallothionein 2A |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of MT2A mRNA |
CTD |
PMID:20945400 |
|
NCBI chr19:10,832,009...10,832,783
Ensembl chr19:10,832,002...10,832,784
|
|
G |
Mtfp1 |
mitochondrial fission process 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MTFP1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:78,968,434...78,972,274
Ensembl chr14:78,968,442...78,972,274
|
|
G |
Mtmr11 |
myotubularin related protein 11 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MTMR11 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:183,721,983...183,732,148
Ensembl chr 2:183,723,530...183,732,148
|
|
G |
Mtmr9 |
myotubularin related protein 9 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MTMR9 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:37,769,161...37,791,195
Ensembl chr15:37,769,078...37,791,244
|
|
G |
Mtor |
mechanistic target of rapamycin kinase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MTOR mRNA |
CTD |
PMID:36822333 |
|
NCBI chr 5:158,884,856...158,994,311
Ensembl chr 5:158,884,804...158,994,311
|
|
G |
Mtus2 |
microtubule associated scaffold protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MTUS2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:6,706,531...7,078,331
Ensembl chr12:6,706,532...7,078,331
|
|
G |
Mybl2 |
MYB proto-oncogene like 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYBL2 mRNA |
CTD |
PMID:17254854 |
|
NCBI chr 3:151,705,254...151,733,714
Ensembl chr 3:151,705,288...151,733,708
|
|
G |
Mybpc1 |
myosin binding protein C1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYBPC1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:22,930,350...23,015,981
Ensembl chr 7:22,930,350...23,015,957
|
|
G |
Myc |
MYC proto-oncogene, bHLH transcription factor |
increases expression decreases expression multiple interactions |
ISO |
Dihydrotestosterone results in increased expression of MYC mRNA Dihydrotestosterone results in decreased expression of MYC mRNA; Dihydrotestosterone results in decreased expression of MYC protein (+)-JQ1 compound promotes the reaction [Dihydrotestosterone results in decreased expression of MYC mRNA]; (+)-JQ1 compound promotes the reaction [Dihydrotestosterone results in decreased expression of MYC protein]; bicalutamide inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to MYC enhancer]]; bicalutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of MYC mRNA]; Dihydrotestosterone promotes the reaction [AR protein binds to MYC enhancer]; enzalutamide inhibits the reaction [Dihydrotestosterone promotes the reaction [AR protein binds to MYC enhancer]]; enzalutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of MYC mRNA]; enzalutamide inhibits the reaction [Dihydrotestosterone results in decreased expression of MYC protein] |
CTD |
PMID:20945400 PMID:24759320 PMID:28757136 |
|
NCBI chr 7:93,593,705...93,598,633
Ensembl chr 7:93,593,705...93,598,630
|
|
G |
Mydgf |
myeloid-derived growth factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYDGF mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:999,659...1,008,804
Ensembl chr 9:1,000,722...1,008,822
|
|
G |
Myh2 |
myosin heavy chain 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYH2 mRNA; Dihydrotestosterone results in increased expression of MYH2 protein |
CTD |
PMID:12960001 |
|
NCBI chr10:51,856,738...51,883,236
Ensembl chr10:51,856,738...51,883,236 Ensembl chr10:51,856,738...51,883,236
|
|
G |
Myl12a |
myosin light chain 12A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYL12A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:110,891,970...110,899,655
Ensembl chr 9:110,873,959...110,916,580
|
|
G |
Myo1b |
myosin Ib |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYO1B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:49,690,043...49,852,373
Ensembl chr 9:49,690,086...49,850,798
|
|
G |
Myo1e |
myosin IE |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYO1E mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:70,887,934...71,080,180
Ensembl chr 8:70,887,870...71,080,169
|
|
G |
Myod1 |
myogenic differentiation 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYOD1 protein Dihydrotestosterone results in increased expression of MYOD1 mRNA; Dihydrotestosterone results in increased expression of MYOD1 protein |
CTD |
PMID:12960001 PMID:17440010 |
|
NCBI chr 1:96,884,864...96,887,574
Ensembl chr 1:96,884,948...96,887,554
|
|
G |
Myof |
myoferlin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYOF mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:235,673,666...235,822,413
Ensembl chr 1:235,673,666...235,822,334
|
|
G |
Myog |
myogenin |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of MYOG protein |
CTD |
PMID:17440010 |
|
NCBI chr13:45,745,455...45,748,044
Ensembl chr13:45,745,436...45,748,039
|
|
G |
Nans |
N-acetylneuraminate synthase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NANS mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:60,780,441...60,797,583
Ensembl chr 5:60,780,392...60,814,950
|
|
G |
Nat1 |
N-acetyltransferase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NAT1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:22,218,217...22,238,516
Ensembl chr16:22,208,194...22,238,520
|
|
G |
Nbl1 |
NBL1, DAN family BMP antagonist |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NBL1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:151,318,752...151,329,948
Ensembl chr 5:151,318,754...151,338,719
|
|
G |
Ncapd3 |
non-SMC condensin II complex, subunit D3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NCAPD3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:25,437,067...25,506,375
Ensembl chr 8:25,437,123...25,506,373
|
|
G |
Ncoa1 |
nuclear receptor coactivator 1 |
multiple interactions |
ISO |
Dihydrotestosterone promotes the reaction [NCOA1 protein binds to KLK3 promoter]; methylselenic acid inhibits the reaction [Dihydrotestosterone promotes the reaction [NCOA1 protein binds to KLK3 promoter]]; NCOA1 protein promotes the reaction [Dihydrotestosterone results in increased expression of AR mRNA]; NCOA1 protein results in increased activity of [Dihydrotestosterone binds to AR protein] |
CTD |
PMID:16648561 PMID:16877366 PMID:17804755 |
|
NCBI chr 6:27,232,609...27,507,992
Ensembl chr 6:27,232,611...27,475,664
|
|
G |
Ncoa2 |
nuclear receptor coactivator 2 |
multiple interactions |
ISO |
Dihydrotestosterone promotes the reaction [NCOA2 protein binds to KLK3 promoter]; methylselenic acid inhibits the reaction [Dihydrotestosterone promotes the reaction [NCOA2 protein binds to KLK3 promoter]]; NCOA2 protein promotes the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein]; NCOA2 protein promotes the reaction [Dihydrotestosterone results in increased expression of AR mRNA] |
CTD |
PMID:15336702 PMID:16648561 PMID:16877366 |
|
NCBI chr 5:5,835,642...6,069,693
Ensembl chr 5:5,835,706...6,067,451
|
|
G |
Ncoa3 |
nuclear receptor coactivator 3 |
multiple interactions |
ISO |
NCOA3 protein promotes the reaction [Dihydrotestosterone results in increased expression of AR mRNA] |
CTD |
PMID:16877366 |
|
NCBI chr 3:154,738,566...154,821,395
Ensembl chr 3:154,738,581...154,818,594
|
|
G |
Ncoa4 |
nuclear receptor coactivator 4 |
multiple interactions |
ISO |
NCOA4 promotes the reaction [Dihydrotestosterone results in increased activity of AR protein]; NCOA4 protein promotes the reaction [Dihydrotestosterone results in increased activity of AR protein] |
CTD |
PMID:11751618 PMID:19815066 |
|
NCBI chr16:7,389,222...7,409,564
Ensembl chr16:7,366,542...7,409,641 Ensembl chr16:7,366,542...7,409,641
|
|
G |
Ncor1 |
nuclear receptor co-repressor 1 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [NCOR1 protein binds to KLK3 promoter]; methylselenic acid inhibits the reaction [Dihydrotestosterone inhibits the reaction [NCOR1 protein binds to KLK3 promoter]]; NCOR1 protein inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein] |
CTD |
PMID:16648561 PMID:17804755 |
|
NCBI chr10:46,999,536...47,142,294
Ensembl chr10:46,999,536...47,141,032
|
|
G |
Ncor2 |
nuclear receptor co-repressor 2 |
multiple interactions |
ISO |
Dihydrotestosterone inhibits the reaction [NCOR2 protein binds to KLK3 promoter]; methylselenic acid inhibits the reaction [Dihydrotestosterone inhibits the reaction [NCOR2 protein binds to KLK3 promoter]]; NCOR2 protein inhibits the reaction [Dihydrotestosterone binds to and results in increased activity of AR protein] |
CTD |
PMID:16648561 PMID:17804755 |
|
NCBI chr12:31,466,418...31,628,319
Ensembl chr12:31,466,412...31,628,319
|
|
G |
Ndfip2 |
Nedd4 family interacting protein 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NDFIP2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:82,032,366...82,087,043
Ensembl chr15:82,032,366...82,086,317
|
|
G |
Ndrg1 |
N-myc downstream regulated 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NDRG1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:98,684,487...98,725,869
Ensembl chr 7:98,684,487...98,725,880
|
|
G |
Nebl |
nebulette |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NEBL mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:80,113,891...80,466,331
Ensembl chr17:80,118,543...80,466,210
|
|
G |
Nedd4l |
NEDD4 like E3 ubiquitin protein ligase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NEDD4L mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:58,393,759...58,726,709
Ensembl chr18:58,393,509...58,723,137
|
|
G |
Neo1 |
neogenin 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NEO1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:59,273,860...59,426,486
Ensembl chr 8:59,275,569...59,430,348
|
|
G |
Nfe2l2 |
NFE2 like bZIP transcription factor 2 |
decreases activity |
ISO |
Dihydrotestosterone results in decreased activity of NFE2L2 protein |
CTD |
PMID:30114225 |
|
NCBI chr 3:60,594,239...60,621,712
Ensembl chr 3:60,594,242...60,621,737
|
|
G |
Nfib |
nuclear factor I/B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NFIB mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:96,759,208...96,974,001
Ensembl chr 5:96,764,653...96,975,479
|
|
G |
Nfkbia |
NFKB inhibitor alpha |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NFKBIA mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:72,858,713...72,861,941
Ensembl chr 6:72,858,712...72,861,941
|
|
G |
Nkx3-1 |
NK3 homeobox 1 |
decreases expression multiple interactions increases expression |
ISO |
Dihydrotestosterone results in decreased expression of NKX3-1 mRNA 2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one inhibits the reaction [Dihydrotestosterone results in increased expression of NKX3-1 mRNA] |
CTD |
PMID:12711008 PMID:17131305 PMID:29581250 |
|
NCBI chr15:44,473,851...44,476,443
Ensembl chr15:44,473,851...44,476,441
|
|
G |
Nkx3-2 |
NK3 homeobox 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NKX3-2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr14:69,183,795...69,186,182
Ensembl chr14:69,183,820...69,186,061
|
|
G |
Nnmt |
nicotinamide N-methyltransferase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NNMT mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 8:48,928,663...48,947,734
Ensembl chr 8:48,933,598...48,946,655
|
|
G |
Nnt |
nicotinamide nucleotide transhydrogenase |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NNT mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:51,411,413...51,505,125
Ensembl chr 2:51,411,413...51,504,823
|
|
G |
Nos2 |
nitric oxide synthase 2 |
multiple interactions |
EXP |
[pimagedine inhibits the reaction [testosterone enanthate results in increased expression of NOS2 mRNA]] which results in increased secretion of Dihydrotestosterone |
CTD |
PMID:20463352 |
|
NCBI chr10:63,815,308...63,851,208
Ensembl chr10:63,815,308...63,851,210
|
|
G |
Nppc |
natriuretic peptide C |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NPPC mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 9:87,320,051...87,324,251
Ensembl chr 9:87,320,051...87,324,251
|
|
G |
Nr1i2 |
nuclear receptor subfamily 1, group I, member 2 |
multiple interactions |
EXP ISO |
Dihydrotestosterone binds to and results in increased activity of NR1I2 protein Dihydrotestosterone binds to and results in increased activity of NR1I2 protein; Dihydrotestosterone inhibits the reaction [[Monocrotaline results in increased activity of NR1I2 protein] which results in increased expression of CYP3A4 mRNA]; Dihydrotestosterone inhibits the reaction [Monocrotaline results in increased activity of NR1I2 protein]; Flutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [[Monocrotaline results in increased activity of NR1I2 protein] which results in increased expression of CYP3A4 mRNA]]; Flutamide inhibits the reaction [Dihydrotestosterone inhibits the reaction [Monocrotaline results in increased activity of NR1I2 protein]] |
CTD |
PMID:14613717 PMID:32682830 PMID:33049310 |
|
NCBI chr11:62,460,213...62,496,665
Ensembl chr11:62,460,213...62,496,658
|
|
G |
Nr1i3 |
nuclear receptor subfamily 1, group I, member 3 |
increases activity |
ISO |
Dihydrotestosterone results in increased activity of NR1I3 protein |
CTD |
PMID:28927721 |
|
NCBI chr13:83,632,940...83,638,193
Ensembl chr13:83,632,899...83,637,906
|
|
G |
Nr3c1 |
nuclear receptor subfamily 3, group C, member 1 |
affects binding |
EXP |
NR3C1 protein binds to Dihydrotestosterone |
CTD |
PMID:1597467 |
|
NCBI chr18:31,271,681...31,393,320
Ensembl chr18:31,271,681...31,393,375
|
|
G |
Nr3c2 |
nuclear receptor subfamily 3, group C, member 2 |
affects binding multiple interactions |
ISO |
Dihydrotestosterone binds to NR3C2 protein Dihydrotestosterone inhibits the reaction [Aldosterone results in increased activity of NR3C2 protein] |
CTD |
PMID:17105867 |
|
NCBI chr19:30,715,634...31,059,885
Ensembl chr19:30,715,648...31,059,885
|
|
G |
Nr4a1 |
nuclear receptor subfamily 4, group A, member 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NR4A1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:132,368,399...132,389,300
Ensembl chr 7:132,374,840...132,389,297
|
|
G |
Nrxn3 |
neurexin 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NRXN3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:107,641,760...109,272,849
Ensembl chr 6:107,641,780...109,272,044
|
|
G |
Nsmaf |
neutral sphingomyelinase activation associated factor |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NSMAF mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 5:19,517,795...19,578,773
Ensembl chr 5:19,518,348...19,577,627
|
|
G |
Nt5dc3 |
5'-nucleotidase domain containing 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NT5DC3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:21,190,554...21,247,374
Ensembl chr 7:21,190,554...21,247,374
|
|
G |
Ntaq1 |
N-terminal glutamine amidase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NTAQ1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:89,684,318...89,704,484
Ensembl chr 7:89,684,323...89,704,474
|
|
G |
Nts |
neurotensin |
affects expression |
ISO |
Dihydrotestosterone affects the expression of NTS mRNA |
CTD |
PMID:17094431 |
|
NCBI chr 7:37,564,944...37,574,350
Ensembl chr 7:37,564,533...37,574,423
|
|
G |
Nucb1 |
nucleobindin 1 |
decreases expression |
ISO |
Dihydrotestosterone results in decreased expression of NUCB1 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 1:95,968,325...95,999,183
Ensembl chr 1:95,968,326...96,003,220
|
|
G |
Nudt11 |
nudix hydrolase 11 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NUDT11 mRNA |
CTD |
PMID:16631469 |
|
NCBI chr X:16,326,775...16,333,396
Ensembl chr X:16,326,598...16,333,145
|
|
G |
Nup58 |
nucleoporin 58 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NUP58 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr15:34,358,170...34,407,160
Ensembl chr15:34,358,277...34,407,060
|
|
G |
Nxpe3 |
neurexophilin and PC-esterase domain family, member 3 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of NXPE3 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:44,726,905...44,777,694
Ensembl chr11:44,727,069...44,777,694
|
|
G |
Odc1 |
ornithine decarboxylase 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ODC1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:40,329,831...40,336,444
Ensembl chr 6:40,329,964...40,336,440
|
|
G |
Ofd1 |
Ofd1 centriole and centriolar satellite protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of OFD1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr X:28,015,347...28,056,115
Ensembl chr X:28,015,347...28,056,110
|
|
G |
Orc5 |
origin recognition complex, subunit 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ORC5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 4:12,548,007...12,612,611
Ensembl chr 4:12,548,007...12,612,568
|
|
G |
Orm1 |
orosomucoid 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of ORM1 protein Dihydrotestosterone results in increased expression of ORM1 mRNA |
CTD |
PMID:20025956 PMID:29581250 |
|
NCBI chr 5:76,766,637...76,776,149
Ensembl chr 5:76,772,941...76,776,154
|
|
G |
Otud7b |
OTU deubiquitinase 7B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of OTUD7B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:183,661,955...183,722,584
Ensembl chr 2:183,662,163...183,718,674
|
|
G |
Otulin |
OTU deubiquitinase with linear linkage specificity |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM105B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:78,290,437...78,316,633
Ensembl chr 2:78,290,959...78,316,422
|
|
G |
Otulinl |
OTU deubiquitinase with linear linkage specificity like |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of FAM105A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:78,405,994...78,433,860
Ensembl chr 2:78,408,593...78,433,838
|
|
G |
Pa2g4 |
proliferation-associated 2G4 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PA2G4 mRNA |
CTD |
PMID:17023530 |
|
NCBI chr 7:984,795...992,264
Ensembl chr 7:983,971...992,331
|
|
G |
Pacs1 |
phosphofurin acidic cluster sorting protein 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PACS1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:202,437,503...202,569,473
Ensembl chr 1:202,437,505...202,569,473
|
|
G |
Pacsin2 |
protein kinase C and casein kinase substrate in neurons 2 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PACSIN2 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 7:114,505,525...114,599,087
Ensembl chr 7:114,505,152...114,598,546
|
|
G |
Pak1ip1 |
PAK1 interacting protein 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PAK1IP1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr17:23,742,217...23,753,325
Ensembl chr17:23,741,414...23,753,324
|
|
G |
Palld |
palladin, cytoskeletal associated protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PALLD mRNA |
CTD |
PMID:29581250 |
|
NCBI chr16:28,228,006...28,621,349
Ensembl chr16:27,981,354...28,621,337
|
|
G |
Parva |
parvin, alpha |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PARVA mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 1:166,547,142...166,704,958
Ensembl chr 1:166,547,132...166,704,950
|
|
G |
Pcdh1 |
protocadherin 1 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PCDH1 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr18:30,011,692...30,039,679
Ensembl chr18:30,013,185...30,039,318
|
|
G |
Pcna |
proliferating cell nuclear antigen |
multiple interactions |
ISO |
[Dihydrotestosterone co-treated with Curcumin co-treated with Quercetin] results in increased expression of PCNA protein |
CTD |
PMID:27132804 |
|
NCBI chr 3:119,499,039...119,502,911
Ensembl chr 3:119,498,810...119,502,995
|
|
G |
Pctp |
phosphatidylcholine transfer protein |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PCTP mRNA |
CTD |
PMID:29581250 |
|
NCBI chr10:74,808,887...74,856,260
Ensembl chr10:74,808,887...74,849,867
|
|
G |
Pde9a |
phosphodiesterase 9A |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PDE9A mRNA |
CTD |
PMID:29581250 |
|
NCBI chr20:9,469,809...9,562,949
Ensembl chr20:9,469,848...9,562,948
|
|
G |
Pdia3 |
protein disulfide isomerase family A, member 3 |
affects expression increases expression multiple interactions |
EXP ISO |
Dihydrotestosterone affects the expression of PDIA3 protein Dihydrotestosterone results in increased expression of PDIA3 mRNA [2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine co-treated with Dihydrotestosterone] affects the expression of PDIA3 protein |
CTD |
PMID:19639176 PMID:29581250 |
|
NCBI chr 3:108,388,189...108,412,013
Ensembl chr 3:108,388,245...108,413,236
|
|
G |
Pdia4 |
protein disulfide isomerase family A, member 4 |
decreases expression increases expression |
ISO |
Dihydrotestosterone results in decreased expression of PDIA4 mRNA Dihydrotestosterone results in increased expression of PDIA4 mRNA |
CTD |
PMID:17023530 PMID:29581250 |
|
NCBI chr 4:76,803,198...76,822,245
Ensembl chr 4:76,803,198...76,822,107
|
|
G |
Pdia5 |
protein disulfide isomerase family A, member 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PDIA5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr11:65,272,152...65,359,087
Ensembl chr11:65,272,155...65,359,084
|
|
G |
Pdia6 |
protein disulfide isomerase family A, member 6 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PDIA6 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 6:40,062,980...40,080,223
Ensembl chr 6:40,062,926...40,080,613
|
|
G |
Pdlim5 |
PDZ and LIM domain 5 |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PDLIM5 mRNA |
CTD |
PMID:29581250 |
|
NCBI chr 2:230,952,251...231,120,329
Ensembl chr 2:230,952,248...231,120,275
|
|
G |
Pds5b |
PDS5 cohesin associated factor B |
increases expression |
ISO |
Dihydrotestosterone results in increased expression of PDS5B mRNA |
CTD |
PMID:29581250 |
|
NCBI chr12:202 | |