Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:CB-5083
go back to main search page
Accession:CHEBI:232521 term browser browse the term
Synonyms:exact_synonym: 1-[4-(benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methylindole-4-carboxamide
 related_synonym: Formula=C24H23N5O2;   InChI=1S/C24H23N5O2/c1-15-12-18-17(22(25)30)8-5-9-21(18)29(15)24-27-20-10-11-31-14-19(20)23(28-24)26-13-16-6-3-2-4-7-16/h2-9,12H,10-11,13-14H2,1H3,(H2,25,30)(H,26,27,28);   InChIKey=RDALZZCKQFLGJP-UHFFFAOYSA-N;   SMILES=CC1=CC2=C(C=CC=C2N1C3=NC=4CCOCC4/C(=N/CC5=CC=CC=C5)/N3)C(=N)O
 xref: CAS:1542705-92-9
 xref_mesh: MESH:C000606272



show annotations for term's descendants           Sort by:
CB-5083 term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Marchf6 membrane associated ring-CH-type finger 6 increases stability ISO CB-5083 results in increased stability of MARCHF6 protein CTD PMID:30545937 NCBI chr 2:82,455,686...82,532,917 JBrowse link
G Pml PML nuclear body scaffold multiple interactions ISO CB-5083 inhibits the reaction [Arsenic results in increased degradation of PML protein]; CB-5083 inhibits the reaction [RNF4 protein promotes the reaction [Arsenic results in increased degradation of PML protein]]; CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO1 protein binds to PML protein]]; CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO2 protein binds to PML protein]]; CB-5083 promotes the reaction [Arsenic results in increased ubiquitination of PML protein]; SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO1 protein binds to PML protein]]]; SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO2 protein binds to PML protein]]]; SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic results in increased ubiquitination of PML protein]]; USP2 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic results in increased ubiquitination of PML protein]] CTD PMID:36880596 NCBI chr 8:58,627,347...58,661,927 JBrowse link
G Rnf4 ring finger protein 4 multiple interactions ISO CB-5083 inhibits the reaction [RNF4 protein promotes the reaction [Arsenic results in increased degradation of PML protein]] CTD PMID:36880596 NCBI chr14:76,401,292...76,423,270 JBrowse link
G Senp1 SUMO specific peptidase 1 multiple interactions ISO SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO1 protein binds to PML protein]]]; SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO2 protein binds to PML protein]]]; SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic results in increased ubiquitination of PML protein]] CTD PMID:36880596 NCBI chr 7:131,042,237...131,105,826 JBrowse link
G Sumo1 small ubiquitin-like modifier 1 multiple interactions ISO CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO1 protein binds to PML protein]]; SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO1 protein binds to PML protein]]] CTD PMID:36880596 NCBI chr 9:61,078,790...61,108,697 JBrowse link
G Sumo2 small ubiquitin-like modifier 2 multiple interactions ISO CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO2 protein binds to PML protein]]; SENP1 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic promotes the reaction [SUMO2 protein binds to PML protein]]] CTD PMID:36880596 NCBI chr10:100,771,941...100,784,503 JBrowse link
G Usp2 ubiquitin specific peptidase 2 multiple interactions ISO USP2 protein inhibits the reaction [CB-5083 promotes the reaction [Arsenic results in increased ubiquitination of PML protein]] CTD PMID:36880596 NCBI chr 8:53,308,264...53,336,800 JBrowse link
G Vcp valosin-containing protein decreases activity ISO CB-5083 results in decreased activity of VCP protein CTD PMID:30545937 NCBI chr 5:62,005,984...62,025,387 JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19898
    role 19869
      biological role 19867
        inhibitor 18949
          CB-5083 8
Path 2
Term Annotations click to browse term
  CHEBI ontology 19898
    subatomic particle 19896
      composite particle 19896
        hadron 19896
          baryon 19896
            nucleon 19896
              atomic nucleus 19896
                atom 19896
                  main group element atom 19835
                    p-block element atom 19835
                      p-block molecular entity 19835
                        carbon group molecular entity 19774
                          organic molecular entity 19770
                            CB-5083 8
paths to the root