Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:L-gamma-glutamyl-L-cysteine
go back to main search page
Accession:CHEBI:17515 term browser browse the term
Definition:A molecular entity formed when L-cysteine amino group binds to the gamma-carbonyl of L-glutamic acid.
Synonyms:related_synonym: 5-L-Glutamyl-L-cysteine;   Formula=C8H14N2O5S;   Glu(-Cys);   InChI=1S/C8H14N2O5S/c9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1;   InChIKey=RITKHVBHSGLULN-WHFBIAKZSA-N;   L-gamma-Glutamylcysteine;   SMILES=N[C@@H](CCC(=O)N[C@@H](CS)C(O)=O)C(O)=O;   gamma-Glu-Cys;   gamma-Glutamylcysteine;   gammaGluCys
 alt_id: CHEBI:10566;   CHEBI:10570;   CHEBI:12400;   CHEBI:12404;   CHEBI:24185;   CHEBI:24194;   CHEBI:39975
 xref: CAS:636-58-8;   DrugBank:DB03408;   HMDB:HMDB0001049;   KEGG:C00669;   KNApSAcK:C00007507
 xref_mesh: MESH:C017341
 xref: MetaCyc:L-GAMMA-GLUTAMYLCYSTEINE;   PMID:11409324;   Reaxys:1729154;   Wikipedia:Gamma-Glutamylcysteine
 cyclic_relationship: is_conjugate_acid_of CHEBI:58173



show annotations for term's descendants           Sort by:
L-gamma-glutamyl-L-cysteine term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Aif1 allograft inflammatory factor 1 multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased expression of AIF1 protein] CTD PMID:35714925 NCBI chr20:3,646,784...3,652,670
Ensembl chr20:3,646,777...3,652,668
JBrowse link
G Akt1 AKT serine/threonine kinase 1 multiple interactions EXP gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased phosphorylation of AKT1 protein] CTD PMID:34767868 NCBI chr 6:131,713,716...131,735,319
Ensembl chr 6:131,713,720...131,733,921
JBrowse link
G Bax BCL2 associated X, apoptosis regulator multiple interactions EXP gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased expression of BAX protein] CTD PMID:34767868 NCBI chr 1:95,940,001...95,945,407
Ensembl chr 1:95,938,808...95,945,368
JBrowse link
G Bcl2 BCL2, apoptosis regulator multiple interactions EXP gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in decreased expression of BCL2 protein] CTD PMID:34767868 NCBI chr13:22,689,783...22,853,920
Ensembl chr13:22,684,989...22,853,743
Ensembl chr13:22,684,989...22,853,743
JBrowse link
G Casp3 caspase 3 multiple interactions EXP AKT activator SC79 inhibits the reaction [gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of CASP3 protein]]; Anisomycin inhibits the reaction [gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of CASP3 protein]]; gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of CASP3 protein] CTD PMID:34767868 NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648
JBrowse link
G Casp9 caspase 9 multiple interactions EXP AKT activator SC79 inhibits the reaction [gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of CASP9 protein]]; Anisomycin inhibits the reaction [gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of CASP9 protein]]; gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of CASP9 protein] CTD PMID:34767868 NCBI chr 5:154,108,872...154,126,628
Ensembl chr 5:154,109,046...154,126,626
JBrowse link
G Cat catalase multiple interactions EXP gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in decreased activity of CAT protein] CTD PMID:34767868 NCBI chr 3:89,842,393...89,874,577
Ensembl chr 3:89,842,399...89,874,478
JBrowse link
G Chuk component of inhibitor of nuclear factor kappa B kinase complex multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased phosphorylation of CHUK protein] CTD PMID:35714925 NCBI chr 1:242,959,539...242,995,066
Ensembl chr 1:242,959,760...242,995,065
JBrowse link
G Cycs cytochrome c, somatic multiple interactions EXP gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased expression of CYCS protein] CTD PMID:34767868 NCBI chr 4:79,651,894...79,653,994
Ensembl chr 4:79,651,378...79,654,054
Ensembl chr18:79,651,378...79,654,054
JBrowse link
G Gclc glutamate-cysteine ligase, catalytic subunit multiple interactions
increases chemical synthesis
EXP Buthionine Sulfoximine inhibits the reaction [GCLC protein results in increased chemical synthesis of gamma-glutamylcysteine]; Cysteine promotes the reaction [GCLC protein results in increased chemical synthesis of gamma-glutamylcysteine]; Excitatory Amino Acid Agents promotes the reaction [GCLC protein results in increased chemical synthesis of gamma-glutamylcysteine] CTD PMID:15115889 NCBI chr 8:78,629,899...78,668,547
Ensembl chr 8:78,630,127...78,668,544
JBrowse link
G Il1b interleukin 1 beta multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased secretion of IL1B protein]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased secretion of IL1B protein]] CTD PMID:35714925 NCBI chr 3:116,577,005...116,583,386
Ensembl chr 3:116,577,010...116,583,415
JBrowse link
G Map2k7 mitogen activated protein kinase kinase 7 multiple interactions EXP gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased phosphorylation of MAP2K7 protein] CTD PMID:34767868 NCBI chr12:2,591,312...2,600,534
Ensembl chr12:2,591,219...2,604,222
JBrowse link
G Mapk8 mitogen-activated protein kinase 8 multiple interactions EXP gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased phosphorylation of MAPK8 protein] CTD PMID:34767868 NCBI chr16:8,638,897...8,721,960
Ensembl chr16:8,638,924...8,721,981
JBrowse link
G Nfkbia NFKB inhibitor alpha multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased phosphorylation of and results in increased degradation of NFKBIA protein] CTD PMID:35714925 NCBI chr 6:72,858,713...72,861,941
Ensembl chr 6:72,858,712...72,861,941
JBrowse link
G Nos2 nitric oxide synthase 2 multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) promotes the reaction [RELA protein binds to NOS2 promoter]]; gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased expression of NOS2 protein]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) promotes the reaction [RELA protein binds to NOS2 promoter]]]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased expression of NOS2 protein]] CTD PMID:35714925 NCBI chr10:63,815,308...63,851,208
Ensembl chr10:63,815,308...63,851,210
JBrowse link
G Nr4a2 nuclear receptor subfamily 4, group A, member 2 multiple interactions ISO gamma-glutamylcysteine promotes the reaction [amyloid beta-protein (1-42) results in increased expression of NR4A2 mRNA]; gamma-glutamylcysteine promotes the reaction [amyloid beta-protein (1-42) results in increased expression of NR4A2 protein]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) promotes the reaction [RELA protein binds to NOS2 promoter]]]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased expression of NOS2 protein]]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased expression of PTGS2 protein]]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased secretion of IL1B protein]]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased secretion of TNF protein]] CTD PMID:35714925 NCBI chr 3:41,689,847...41,707,036
Ensembl chr 3:41,689,851...41,697,877
JBrowse link
G Parp1 poly (ADP-ribose) polymerase 1 multiple interactions EXP AKT activator SC79 inhibits the reaction [gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of PARP1 protein]]; Anisomycin inhibits the reaction [gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of PARP1 protein]]; gamma-glutamylcysteine inhibits the reaction [[Cadmium Chloride results in increased abundance of Cadmium] which results in increased cleavage of PARP1 protein] CTD PMID:34767868 NCBI chr13:92,307,593...92,339,406
Ensembl chr13:92,307,586...92,339,404
JBrowse link
G Ptgs2 prostaglandin-endoperoxide synthase 2 multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased expression of PTGS2 protein]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased expression of PTGS2 protein]] CTD PMID:35714925 NCBI chr13:62,163,936...62,172,193
Ensembl chr13:62,163,932...62,172,188
JBrowse link
G Rela RELA proto-oncogene, NF-kB subunit multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) promotes the reaction [RELA protein binds to NOS2 promoter]]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) promotes the reaction [RELA protein binds to NOS2 promoter]]] CTD PMID:35714925 NCBI chr 1:202,925,001...202,935,484
Ensembl chr 1:202,924,945...202,935,484
JBrowse link
G Tnf tumor necrosis factor multiple interactions ISO gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased secretion of TNF protein]; NR4A2 protein affects the reaction [gamma-glutamylcysteine inhibits the reaction [amyloid beta-protein (1-42) results in increased secretion of TNF protein]] CTD PMID:35714925 NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19922
    role 19894
      biological role 19864
        biochemical role 19596
          ferroptosis inducer 15752
            L-glutamic acid 10264
              L-gamma-glutamyl-L-cysteine 20
                DON-10-gamma-glutamylcysteine 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19922
    subatomic particle 19892
      composite particle 19892
        hadron 19920
          baryon 19892
            nucleon 19920
              atomic nucleus 19892
                atom 19892
                  main group element atom 19866
                    p-block element atom 19866
                      carbon group element atom 19805
                        carbon atom 19802
                          organic molecular entity 19775
                            heteroorganic entity 19556
                              organochalcogen compound 19315
                                organooxygen compound 19205
                                  carbon oxoacid 18694
                                    carboxylic acid 18691
                                      carboacyl group 17723
                                        univalent carboacyl group 17723
                                          carbamoyl group 17576
                                            carboxamide 17576
                                              peptide 11440
                                                oligopeptide 1349
                                                  dipeptide 414
                                                    glutamyl-L-amino acid 20
                                                      gamma-glutamylcysteine 20
                                                        L-gamma-glutamyl-L-cysteine 20
                                                          DON-10-gamma-glutamylcysteine 0
paths to the root